summaryrefslogtreecommitdiff
path: root/inst/web/plot.chent.html
diff options
context:
space:
mode:
Diffstat (limited to 'inst/web/plot.chent.html')
-rw-r--r--inst/web/plot.chent.html112
1 files changed, 112 insertions, 0 deletions
diff --git a/inst/web/plot.chent.html b/inst/web/plot.chent.html
new file mode 100644
index 0000000..beba724
--- /dev/null
+++ b/inst/web/plot.chent.html
@@ -0,0 +1,112 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>plot.chent. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>Plot method for chent objects</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>"plot"(x, ...)</div></pre>
+
+ <h2>Arguments</h2>
+ <dl>
+ <dt>x</dt>
+ <dd>The chent object to be plotted</dd>
+ <dt>...</dt>
+ <dd>Further arguments passed to <code><a href='http://www.inside-r.org/packages/cran/grImport/docs/grid.picture'>grid.picture</a></code></dd>
+ </dl>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>Plot method for chent objects</p>
+
+ </div>
+
+ <h2 id="examples">Examples</h2>
+ <pre class="examples"><div class='input'>caffeine &lt;- chent$new(&quot;caffeine&quot;, source = &quot;pubchem&quot;)
+</div>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&amp;db=pccompound&amp;term=caffeine</strong>
+<strong class='message'>Found 217 entries in PubChem, using the first one.</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&amp;db=pccompound&amp;ID=1188</strong>
+<div class='input'>print(caffeine)
+</div>
+<div class='output'>&lt;chent&gt;
+Identifier $identifier caffeine
+InChI Key $inchikey LRFVTYWOQMYALW-UHFFFAOYSA-N
+SMILES string $smiles C1=NC2=C(N1)C(=O)NC(=O)N2
+Molecular weight $mw: 152.1
+PubChem synonyms (first 10):
+ [1] &quot;xanthine&quot; &quot;2,6-Dihydroxypurine&quot; &quot;69-89-6&quot; &quot;Xanthin&quot; &quot;2,6-dioxopurine&quot;
+ [6] &quot;Pseudoxanthine&quot; &quot;Isoxanthine&quot; &quot;Xanthic oxide&quot; &quot;1H-Purine-2,6-diol&quot; &quot;Purine-2,6-diol&quot;
+</div>
+<div class='input'>caffeine$get_rdkit()
+plot(caffeine)
+</div>
+<p><img src='plot.chent-8.png' alt='' width='540' height='400' /></p></pre>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>plot.chent</li>
+ </ul>
+ <ul>
+
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file

Contact - Imprint