From 79123acfdd9a9b905a5b177e2b7aa0d604e52267 Mon Sep 17 00:00:00 2001
From: Johannes Ranke The class is initialised with an identifier. Chemical information is retrieved from
the internet. Additionally, it can be generated using RDKit if RDKit and its
-python bindings are installed and configured for use with PythonInR. An The identifier that was used to initiate the object, with attribute 'source' InChI Key, with attribute 'source' SMILES code, with attribute 'source' Molecular weight, with attribute 'source' List of information retreived from PubChem List of information obtained with RDKit, if installed and
-configured for use with PythonInR SVG code Graph as a Font size as extracted from the intermediate PostScript file Height of the MediaBox in the pdf after cropping Vapour pressure in Pa Water solubility in mg/L List of information obtained from a YAML file Dataframe of modelling DT50 values Dataframe of formation fractions Dataframe of soil sorption data Plant uptake factor InChI Key, with attribute 'source' SMILES code, with attribute 'source' Molecular weight, with attribute 'source' List of information retreived from PubChem List of information obtained with RDKit <rdkit.Chem.rdchem.Mol> object SVG code Graph as a Font size as extracted from the intermediate PostScript file Height of the MediaBox in the pdf after cropping Vapour pressure in Pa Water solubility in mg/L List of information obtained from a YAML file Dataframe of modelling DT50 values Dataframe of formation fractions Dataframe of soil sorption data Plant uptake factorchent
-
+
+
Format
R6Class generator objectFields
+ Public fields
-
-
+
+
+identifierinchikeysmilesmwpubchemrdkitsvgPicturepicture object obtained using grImportPict_font_sizepdf_heightp0cwsatchyamlsoil_degradationsoil_ffsoil_sorptionPUFinchikeysmilesmwpubchemrdkitmolsvgPicturepicture object obtained using grImportPict_font_sizepdf_heightp0cwsatchyamlsoil_degradationsoil_ffsoil_sorptionPUF
new()chent$new( + identifier, + smiles = NULL, + smiles_source = "user", + inchikey = NULL, + inchikey_source = "user", + pubchem = TRUE, + pubchem_from = c("name", "smiles", "inchikey"), + rdkit = TRUE, + template = NULL, + chyaml = TRUE +)
try_pubchem()chent$try_pubchem(query, from = "name")
get_pubchem()chent$get_pubchem(pubchem_cid)
get_rdkit()chent$get_rdkit(template = NULL)
get_chyaml()chent$get_chyaml( + repo = c("wd", "local", "web"), + chyaml = paste0(URLencode(self$identifier), ".yaml") +)
add_p0()chent$add_p0(p0, T = NA, source = NA, page = NA, remark = "")
add_cwsat()chent$add_cwsat(cwsat, T = NA, pH = NA, source = NA, page = NA, remark = "")
add_PUF()chent$add_PUF( + PUF = 0, + source = "focus_generic_gw_2014", + page = 41, + remark = "Conservative default value" +)
add_TP()chent$add_TP(x, smiles = NULL, pubchem = FALSE)
add_transformation()chent$add_transformation( + study_type, + TP_identifier, + max_occurrence, + remark = "", + source = NA, + pages = NA +)
add_soil_degradation()chent$add_soil_degradation( + soils, + DT50_mod, + DT50_mod_ref, + type = NA, + country = NA, + pH_orig = NA, + pH_medium = NA, + pH_H2O = NA, + perc_OC = NA, + temperature = NA, + moisture = NA, + category = "lab", + formulation = NA, + model = NA, + chi2 = NA, + remark = "", + source, + page = NA +)
add_soil_ff()chent$add_soil_ff(target, soils, ff = 1, remark = "", source, page = NA)
add_soil_sorption()chent$add_soil_sorption( + soils, + Kf, + Kfoc, + N, + type = NA, + pH_orig = NA, + pH_medium = NA, + pH_H2O = NA, + perc_OC = NA, + perc_clay = NA, + CEC = NA, + remark = "", + source, + page = NA +)
pdf()chent$pdf( + file = paste0(self$identifier, ".pdf"), + dir = "structures/pdf", + template = NULL +)
png()chent$png( + file = paste0(self$identifier, ".png"), + dir = "structures/png", + antialias = "gray" +)
emf()chent$emf(file = paste0(self$identifier, ".emf"), dir = "structures/emf")
clone()The objects of this class are cloneable with this method.
chent$clone(deep = FALSE)
deepWhether to make a deep clone.
- + + + -- cgit v1.2.3oct <- chent$new("1-octanol", smiles = "CCCCCCCCO")#>#>#>#>#> -#> -#>#> -#>#>print(oct)#> <chent> ++#> [1] "caffeine" "58-08-2" +#> [3] "1,3,7-Trimethylxanthine" "Guaranine" +#> [5] "Thein" "Methyltheobromine" +#> [7] "Cafeina" "Theine" +#> [9] "Koffein" "Mateina"oct <- chent$new("1-octanol", smiles = "CCCCCCCCO") +#>#> +#>#>#> <chent> #> Identifier $identifier 1-octanol #> InChI Key $inchikey KBPLFHHGFOOTCA-UHFFFAOYSA-N #> SMILES string $smiles: @@ -157,12 +379,16 @@ configured for use with PythonInR #> "CCCCCCCCO" "CCCCCCCCO" #> Molecular weight $mw: 130.2 #> PubChem synonyms (up to 10): -#> [1] "957" "1-octanol" "Octan-1-ol" "octanol" -#> [5] "111-87-5" "N-octanol" "Capryl alcohol" "Octyl alcohol" -#> [9] "caprylic alcohol" "n-Octyl alcohol"caffeine <- chent$new("caffeine")#>#>#>#>#> -#>#>print(caffeine)#> <chent> +#> [1] "1-octanol" "Octan-1-ol" "octanol" "111-87-5" +#> [5] "N-octanol" "Octyl alcohol" "Capryl alcohol" "caprylic alcohol" +#> [9] "n-Octyl alcohol" "Heptyl carbinol"+caffeine <- chent$new("caffeine") +#>#> +#>#>#> <chent> #> Identifier $identifier caffeine #> InChI Key $inchikey RYYVLZVUVIJVGH-UHFFFAOYSA-N #> SMILES string $smiles: @@ -170,41 +396,39 @@ configured for use with PythonInR #> "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" #> Molecular weight $mw: 194.2 #> PubChem synonyms (up to 10): -#> [1] "2519" "caffeine" -#> [3] "58-08-2" "Guaranine" -#> [5] "1,3,7-Trimethylxanthine" "Thein" -#> [7] "Cafeina" "Methyltheobromine" -#> [9] "Koffein" "Mateina"