From 79123acfdd9a9b905a5b177e2b7aa0d604e52267 Mon Sep 17 00:00:00 2001
From: Johannes Ranke The class is initialised with an identifier which is generally an ISO common name.
Additional chemical information is retrieved from the internet if available. An ISO common name according to ISO 1750 as retreived from pesticidecompendium.bcpc.org List of information retrieved from pesticidecompendium.bcpc.orgpai
-
+
+
Format
R6Class generator objectFields
+ Super class
+
+ chents::chent -> paiPublic fields
+
+
+
isobcpc
isoISO common name according to ISO 1750 as retreived from www.alanwood.net/pesticides
alanwoodList of information retreived from www.alanwood.net/pesticides
Inherited methods
+
+
+
new()pai$new( + iso, + identifier = iso, + smiles = NULL, + smiles_source = "user", + inchikey = NULL, + inchikey_source = "user", + bcpc = TRUE, + pubchem = TRUE, + pubchem_from = "auto", + rdkit = TRUE, + template = NULL, + chyaml = TRUE +)
clone()The objects of this class are cloneable with this method.
pai$clone(deep = FALSE)
deepWhether to make a deep clone.
- + + + -- cgit v1.2.3atr <- pai$new("atrazine")#>#>#>#>#>#>#> -#>#>print(atr)#> <pai> with ISO common name $iso atrazine ++#> [1] "atrazine" "1912-24-9" "Gesaprim" "Oleogesaprim" "Chromozin" +#> [6] "Aktikon" "Atrazin" "Argezin" "Atazinax" "Atranex"atr <- pai$new("atrazine") +#>#>#> +#>#>#> <pai> with ISO common name $iso atrazine #> <chent> #> Identifier $identifier atrazine #> InChI Key $inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N @@ -138,36 +209,36 @@ Additional chemical information is retrieved from the internet if available. #> "CCNC1=NC(=NC(=N1)Cl)NC(C)C" #> Molecular weight $mw: 215.7 #> PubChem synonyms (up to 10): -#> [1] "2256" "atrazine" "1912-24-9" "Gesaprim" "Chromozin" -#> [6] "Oleogesaprim" "Aktikon" "Argezin" "Atazinax" "Atranex"