The class is initialised with an identifier which is generally an ISO common name. Additional chemical information is retrieved from the internet if available.
pai
An R6Class generator object
isoalanwoodatr <- pai$new("atrazine")#>#>#>#>#>#>#> #>#>print(atr)#> <pai> with ISO common name $iso atrazine #> <chent> #> Identifier $identifier atrazine #> InChI Key $inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N #> SMILES string $smiles: #> PubChem_Canonical #> "CCNC1=NC(=NC(=N1)Cl)NC(C)C" #> Molecular weight $mw: 215.7 #> PubChem synonyms (up to 10): #> [1] "2256" "atrazine" "1912-24-9" "Atranex" "Fenatrol" #> [6] "Atred" "Oleogesaprim" "Atazinax" "Atrasine" "Chromozin"