diff options
Diffstat (limited to 'inst/web/pai.html')
| -rw-r--r-- | inst/web/pai.html | 123 |
1 files changed, 123 insertions, 0 deletions
diff --git a/inst/web/pai.html b/inst/web/pai.html new file mode 100644 index 0000000..bd19dc7 --- /dev/null +++ b/inst/web/pai.html @@ -0,0 +1,123 @@ +<!DOCTYPE html> +<html lang="en"> + <head> + <meta charset="utf-8"> +<title>pai. chents 0.2-1</title> +<meta name="viewport" content="width=device-width, initial-scale=1.0"> +<meta name="author" content=""> + +<link href="css/bootstrap.css" rel="stylesheet"> +<link href="css/bootstrap-responsive.css" rel="stylesheet"> +<link href="css/highlight.css" rel="stylesheet"> +<link href="css/staticdocs.css" rel="stylesheet"> + +<!--[if lt IE 9]> + <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script> +<![endif]--> + +<script type="text/x-mathjax-config"> + MathJax.Hub.Config({ + tex2jax: { + inlineMath: [ ['$','$'], ["\\(","\\)"] ], + processEscapes: true + } + }); +</script> +<script type="text/javascript" + src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML"> +</script> + </head> + + <body> + <div class="navbar"> + <div class="navbar-inner"> + <div class="container"> + <a class="brand" href="#">chents 0.2-1</a> + <div class="nav"> + <ul class="nav"> + <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li> + </ul> + </div> + </div> + </div> +</div> + + <div class="container"> + <header> + + </header> + + <h1>An R6 class for pesticidal active ingredients and associated data</h1> + +<div class="row"> + <div class="span8"> + <h2>Usage</h2> + <pre><div>pai</div></pre> + + <div class="Format"> + <h2>Format</h2> + + <p>An <code><a href='http://www.inside-r.org/packages/cran/R6/docs/R6Class'>R6Class</a></code> generator object</p> + + </div> + + <div class="Description"> + <h2>Description</h2> + + <p>The class is initialised with an identifier which is generally an ISO common name. +Additional chemical information is retrieved from the internet.</p> + + </div> + + <div class="Fields"> + <h2>Fields</h2> + + <p></p> + + <p><dl> +<dt><code>iso</code></dt><dd>ISO common name according to ISO 1750 as retreived from www.alanwood.net/pesticides</dd></p> + + <p><dt><code>alanwood</code></dt><dd>List of information retreived from www.alanwood.net/pesticides</dd></p> + + <p></dl></p> + + </div> + + <h2 id="examples">Examples</h2> + <pre class="examples"><div class='input'>atr <- pai$new("atrazine") +</div> +<strong class='message'>Querying atrazine.html</strong> +<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&db=pccompound&term=atrazine</strong> +<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&db=pccompound&ID=2256</strong> +<div class='input'>print(atr) +</div> +<div class='output'><pai> with ISO common name $iso atrazine +<chent> +Identifier $identifier atrazine +InChI Key $inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N +SMILES string $smiles CCNC1=NC(=NC(=N1)Cl)NC(C)C +Molecular weight $mw: 215.7 +PubChem synonyms (first 10): + [1] "atrazine" "1912-24-9" "Atazinax" "Atrasine" "Chromozin" "Fenatrol" "Gesaprim" "Gesoprim" + [9] "Hungazin" "Oleogesaprim" +</div></pre> + </div> + <div class="span4"> + <!-- <ul> + <li>pai</li> + </ul> + <ul> + <li>data</li> + </ul> --> + + + </div> +</div> + + <footer> + <p class="pull-right"><a href="#">Back to top</a></p> +<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p> + </footer> + </div> + </body> +</html>
\ No newline at end of file |