aboutsummaryrefslogtreecommitdiff
path: root/inst/web/pai.html
diff options
context:
space:
mode:
authorJohannes Ranke <jranke@uni-bremen.de>2015-09-28 21:34:23 +0200
committerJohannes Ranke <jranke@uni-bremen.de>2015-09-28 22:10:56 +0200
commitf908377f1de2e04ca3720d10084169c46a477ce2 (patch)
tree439bd00dec3a988f76ff74fd5ee652f55b17d061 /inst/web/pai.html
parent1df33dbb3d310f94ccddbf57906e12bd6fa93c3f (diff)
Several changes heading for a release to the public
- Add tests - Add staticdocs - Documentation improvements - Several small code improvements
Diffstat (limited to 'inst/web/pai.html')
-rw-r--r--inst/web/pai.html123
1 files changed, 123 insertions, 0 deletions
diff --git a/inst/web/pai.html b/inst/web/pai.html
new file mode 100644
index 0000000..bd19dc7
--- /dev/null
+++ b/inst/web/pai.html
@@ -0,0 +1,123 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>pai. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>An R6 class for pesticidal active ingredients and associated data</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>pai</div></pre>
+
+ <div class="Format">
+ <h2>Format</h2>
+
+ <p>An <code><a href='http://www.inside-r.org/packages/cran/R6/docs/R6Class'>R6Class</a></code> generator object</p>
+
+ </div>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>The class is initialised with an identifier which is generally an ISO common name.
+Additional chemical information is retrieved from the internet.</p>
+
+ </div>
+
+ <div class="Fields">
+ <h2>Fields</h2>
+
+ <p></p>
+
+ <p><dl>
+<dt><code>iso</code></dt><dd>ISO common name according to ISO 1750 as retreived from www.alanwood.net/pesticides</dd></p>
+
+ <p><dt><code>alanwood</code></dt><dd>List of information retreived from www.alanwood.net/pesticides</dd></p>
+
+ <p></dl></p>
+
+ </div>
+
+ <h2 id="examples">Examples</h2>
+ <pre class="examples"><div class='input'>atr &lt;- pai$new(&quot;atrazine&quot;)
+</div>
+<strong class='message'>Querying atrazine.html</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&amp;db=pccompound&amp;term=atrazine</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&amp;db=pccompound&amp;ID=2256</strong>
+<div class='input'>print(atr)
+</div>
+<div class='output'>&lt;pai&gt; with ISO common name $iso atrazine
+&lt;chent&gt;
+Identifier $identifier atrazine
+InChI Key $inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N
+SMILES string $smiles CCNC1=NC(=NC(=N1)Cl)NC(C)C
+Molecular weight $mw: 215.7
+PubChem synonyms (first 10):
+ [1] &quot;atrazine&quot; &quot;1912-24-9&quot; &quot;Atazinax&quot; &quot;Atrasine&quot; &quot;Chromozin&quot; &quot;Fenatrol&quot; &quot;Gesaprim&quot; &quot;Gesoprim&quot;
+ [9] &quot;Hungazin&quot; &quot;Oleogesaprim&quot;
+</div></pre>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>pai</li>
+ </ul>
+ <ul>
+ <li>data</li>
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file

Contact - Imprint