summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorJohannes Ranke <jranke@uni-bremen.de>2015-09-28 21:34:23 +0200
committerJohannes Ranke <jranke@uni-bremen.de>2015-09-28 22:10:56 +0200
commitf908377f1de2e04ca3720d10084169c46a477ce2 (patch)
tree439bd00dec3a988f76ff74fd5ee652f55b17d061
parent1df33dbb3d310f94ccddbf57906e12bd6fa93c3f (diff)
Several changes heading for a release to the public
- Add tests - Add staticdocs - Documentation improvements - Several small code improvements
-rw-r--r--.Rbuildignore3
-rw-r--r--ChangeLog17
-rw-r--r--DESCRIPTION9
-rw-r--r--NAMESPACE11
-rw-r--r--R/chent.R106
-rw-r--r--inst/examples/caffeine.R4
-rw-r--r--inst/examples/octanol.R (renamed from inst/examples/chents.R)1
-rw-r--r--inst/examples/pai.R (renamed from inst/examples/ai.R)0
-rw-r--r--inst/web/chent-15.pngbin0 -> 7664 bytes
-rw-r--r--inst/web/chent-8.pngbin0 -> 2688 bytes
-rw-r--r--inst/web/chent.html156
-rw-r--r--inst/web/css/bootstrap-responsive.css815
-rw-r--r--inst/web/css/bootstrap-responsive.min.css9
-rw-r--r--inst/web/css/bootstrap.css4983
-rw-r--r--inst/web/css/bootstrap.min.css9
-rw-r--r--inst/web/css/highlight.css28
-rw-r--r--inst/web/css/staticdocs.css18
-rw-r--r--inst/web/draw_svg.chent.html96
-rw-r--r--inst/web/img/glyphicons-halflings-white.pngbin0 -> 8777 bytes
-rw-r--r--inst/web/img/glyphicons-halflings.pngbin0 -> 13826 bytes
-rw-r--r--inst/web/index.html134
-rw-r--r--inst/web/js/bootstrap.js1825
-rw-r--r--inst/web/js/bootstrap.min.js6
-rw-r--r--inst/web/pai.html123
-rw-r--r--inst/web/plot.chent-8.pngbin0 -> 7664 bytes
-rw-r--r--inst/web/plot.chent.html112
-rw-r--r--inst/web/pp.html107
-rw-r--r--inst/web/print.chent.html90
-rw-r--r--inst/web/print.pai.html90
-rw-r--r--man/chent.Rd12
-rw-r--r--man/draw_svg.chent.Rd24
-rw-r--r--man/plot.chent.Rd23
-rw-r--r--roxygen.log3
-rw-r--r--test.log15
-rw-r--r--tests/testthat.R4
-rw-r--r--tests/testthat/test_chent.R21
-rw-r--r--tests/testthat/test_pai.R25
37 files changed, 8849 insertions, 30 deletions
diff --git a/.Rbuildignore b/.Rbuildignore
index 740d75d..ad9f5bd 100644
--- a/.Rbuildignore
+++ b/.Rbuildignore
@@ -1,4 +1,5 @@
-^chents_*.tar.gz
+^chents_.*.tar.gz
GNUmakefile
README.html
sd/*
+^test.log$
diff --git a/ChangeLog b/ChangeLog
index ee3afc4..bcfaf09 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -1,3 +1,20 @@
+commit a52eab41324f4bf13555b822ad3c2f9e89422455
+Author: Johannes Ranke <jranke@uni-bremen.de>
+Date: 2015-09-28 21:34:23 +0200
+
+ Several changes heading for a release to the public
+
+ - Add tests
+ - Add staticdocs
+ - Documentation improvements
+ - Several small code improvements
+
+commit 1df33dbb3d310f94ccddbf57906e12bd6fa93c3f
+Author: Johannes Ranke <jranke@uni-bremen.de>
+Date: 2015-09-11 10:04:54 +0200
+
+ Working version with basic functionality
+
commit 7cc5df2ad1e2a1aa5c6d4d9f5865491c6b30ee2a
Author: Johannes Ranke <jranke@uni-bremen.de>
Date: 2015-08-26 13:24:57 +0200
diff --git a/DESCRIPTION b/DESCRIPTION
index 4a650e0..1b8a590 100644
--- a/DESCRIPTION
+++ b/DESCRIPTION
@@ -1,12 +1,15 @@
Package: chents
Type: Package
Title: Chemical Entities as R Objects
-Version: 0.1-2
-Date: 2015-09-11
+Version: 0.2-1
+Date: 2015-09-28
Authors@R: c(person("Johannes", "Ranke", role = c("aut", "cre", "cph"),
email = "jranke@uni-bremen.de"))
Description: Utilities for dealing with chemical entities and associated data as R objects.
-Imports: webchem, R6
+ If Python and RDKit are installed and configured for use with 'PythonInR',
+ some basic chemoinformatics functions like the calculation of molecular weight
+ and plotting of chemical structures in R graphics are available.
+Imports: webchem, R6, grImport, PythonInR, yaml
Suggests: knitr, testthat
License: GPL
LazyLoad: yes
diff --git a/NAMESPACE b/NAMESPACE
index e96d4f7..2cbde5a 100644
--- a/NAMESPACE
+++ b/NAMESPACE
@@ -1,10 +1,21 @@
# Generated by roxygen2 (4.1.1): do not edit by hand
+S3method(plot,chent)
S3method(print,chent)
S3method(print,pai)
export(chent)
+export(draw_svg.chent)
export(pai)
export(pp)
+importFrom(PythonInR,pyConnect)
+importFrom(PythonInR,pyExec)
+importFrom(PythonInR,pyExecg)
+importFrom(PythonInR,pyImport)
+importFrom(PythonInR,pyIsConnected)
importFrom(R6,R6Class)
+importFrom(grImport,PostScriptTrace)
+importFrom(grImport,grid.picture)
+importFrom(grImport,readPicture)
importFrom(webchem,cid_compinfo)
importFrom(webchem,get_cid)
+importFrom(yaml,yaml.load_file)
diff --git a/R/chent.R b/R/chent.R
index 1ef26be..3f344b9 100644
--- a/R/chent.R
+++ b/R/chent.R
@@ -17,21 +17,27 @@
#' An R6 class for chemical entities with associated data
#'
-#' The class is initialised with an identifier. Chemical information is retrieved
-#' from the internet.
+#' The class is initialised with an identifier. Chemical information is retrieved from
+#' the internet. Additionally, it can be generated using RDKit if RDKit and its
+#' python bindings are installed.
#'
#' @docType class
#' @export
#' @format An \code{\link{R6Class}} generator object
#' @importFrom R6 R6Class
#' @importFrom webchem get_cid cid_compinfo
+#' @importFrom grImport PostScriptTrace readPicture
+#' @importFrom PythonInR pyIsConnected pyConnect pyImport pyExec pyExecg
+#' @importFrom yaml yaml.load_file
#' @field identifier The identifier that was used to initiate the object, with attribute 'source'
#' @field inchikey InChI Key, with attribute 'source'
#' @field smiles SMILES code, with attribute 'source'
#' @field mw Molecular weight, with attribute 'source'
#' @field pubchem List of information retreived from PubChem
#' @field rdkit List of information obtained with RDKit
-#' @example inst/examples/chents.R
+#' @field Picture Graph as a \code{\link{picture}} object obtained using grImport
+#' @example inst/examples/octanol.R
+#' @example inst/examples/caffeine.R
#' @keywords data
chent <- R6Class("chent",
@@ -42,6 +48,8 @@ chent <- R6Class("chent",
mw = NULL,
pubchem = NULL,
rdkit = NULL,
+ Picture = NULL,
+ chyaml = NULL,
initialize = function(identifier, smiles = NULL,
source = c("rdkit", "pubchem")) {
self$identifier <- identifier
@@ -96,25 +104,41 @@ chent <- R6Class("chent",
}
},
get_rdkit = function() {
- if (require(PythonInR)) {
- id <- names(self$identifier)
- try_rdkit <- try(pyImport("Chem", from = "rdkit"))
- if (inherits(try_rdkit, "try-error")) {
- message("Could not import RDKit in Python session")
- } else {
- self$rdkit <- list()
- pyImport("Descriptors", from = "rdkit.Chem")
- pyExec(paste0("mol = Chem.MolFromSmiles('", self$smiles, "')"))
- self$rdkit$mw <- pyExecg("mw = Descriptors.MolWt(mol)", "mw")
- if (!is.null(self$mw)) {
- if (round(self$rdkit$mw, 1) != round(self$mw, 1)) {
- message("RDKit mw is ", self$rdkit$mw)
- message("mw is ", self$mw)
- }
+ id <- names(self$identifier)
+ if (!pyIsConnected()) {
+ pyConnect()
+ }
+ try_rdkit <- try(pyImport("Chem", from = "rdkit"))
+ if (inherits(try_rdkit, "try-error")) {
+ message("Could not import RDKit in Python session")
+ } else {
+ self$rdkit <- list()
+ pyImport("Descriptors", from = "rdkit.Chem")
+ pyExec(paste0("mol = Chem.MolFromSmiles('", self$smiles, "')"))
+ self$rdkit$mw <- pyExecg("mw = Descriptors.MolWt(mol)", "mw")
+ if (!is.null(self$mw)) {
+ if (round(self$rdkit$mw, 1) != round(self$mw, 1)) {
+ message("RDKit mw is ", self$rdkit$mw)
+ message("mw is ", self$mw)
}
}
- } else {
- stop("rdkit not available as PythonInR is not installed")
+
+ # Create a grImport Picture
+ pyImport("Draw", from = "rdkit.Chem")
+ psfile <- tempfile(fileext = ".ps")
+ xmlfile <- tempfile(fileext = ".xml")
+ cmd <- paste0("Draw.MolToFile(mol, '", psfile, "')")
+ pyExec(cmd)
+ PostScriptTrace(psfile, outfilename = xmlfile)
+ unlink(paste0("capture", basename(psfile)))
+ self$Picture <- readPicture(xmlfile)
+ }
+ },
+ get_chyaml = function(repo = c("local", "web")) {
+ repo = match.arg(repo)
+ if (repo == "local") {
+ self$chyaml = yaml.load_file(file.path("~", "git/chyaml",
+ paste0(URLencode(self$identifier), ".yaml")))
}
},
TPs = list(),
@@ -158,6 +182,7 @@ chent <- R6Class("chent",
stringsAsFactors = FALSE),
add_soil_degradation_endpoints = function(destination, DT50 = NA,
comment = "", pages = NA) {
+ if (length(pages) > 1) pages = paste(pages, collapse = ", ")
i <- nrow(self$soil_degradation_endpoints) + 1
self$soil_degradation_endpoints[i, c("destination", "comment", "pages")] <-
c(destination, comment, pages)
@@ -183,6 +208,45 @@ print.chent = function(x, ...) {
}
}
+#' Draw SVG graph from a chent object using RDKit
+#'
+#' @importFrom PythonInR pyIsConnected pyConnect pyImport pyExec
+#' @param x The chent object to be plotted
+#' @param width The desired width in pixels
+#' @param height The desired height in pixels
+#' @param filename The filename
+#' @param subdir The path to which the file should be written
+#' @export
+draw_svg.chent = function(x, width = 300, height = 150,
+ filename = paste0(names(x$identifier), ".svg"),
+ subdir = "svg") {
+ if (!pyIsConnected()) {
+ pyConnect()
+ }
+ try_rdkit <- try(pyImport("Chem", from = "rdkit"))
+ if (inherits(try_rdkit, "try-error")) {
+ message("Could not import RDKit in Python session")
+ } else {
+ if (!dir.exists(subdir)) dir.create(subdir)
+ pyExec(paste0("mol = Chem.MolFromSmiles('", x$smiles, "')"))
+ pyImport("Draw", from = "rdkit.Chem")
+ cmd <- paste0("Draw.MolToFile(mol, '", file.path(subdir, filename),
+ "', size = (", width, ", ", height, "))")
+ pyExec(cmd)
+ }
+}
+
+#' Plot method for chent objects
+#'
+#' @importFrom grImport grid.picture
+#' @param x The chent object to be plotted
+#' @param ... Further arguments passed to \code{\link{grid.picture}}
+#' @example inst/examples/caffeine.R
+#' @export
+plot.chent = function(x, ...) {
+ grid.picture(x$Picture)
+}
+
#' An R6 class for pesticidal active ingredients and associated data
#'
#' The class is initialised with an identifier which is generally an ISO common name.
@@ -194,7 +258,7 @@ print.chent = function(x, ...) {
#' @format An \code{\link{R6Class}} generator object
#' @field iso ISO common name according to ISO 1750 as retreived from www.alanwood.net/pesticides
#' @field alanwood List of information retreived from www.alanwood.net/pesticides
-#' @example inst/examples/ai.R
+#' @example inst/examples/pai.R
#' @keywords data
pai <- R6Class("pai",
diff --git a/inst/examples/caffeine.R b/inst/examples/caffeine.R
new file mode 100644
index 0000000..ab794ac
--- /dev/null
+++ b/inst/examples/caffeine.R
@@ -0,0 +1,4 @@
+caffeine <- chent$new("caffeine", source = "pubchem")
+print(caffeine)
+caffeine$get_rdkit()
+plot(caffeine)
diff --git a/inst/examples/chents.R b/inst/examples/octanol.R
index 0309e2b..91e23cf 100644
--- a/inst/examples/chents.R
+++ b/inst/examples/octanol.R
@@ -1,3 +1,4 @@
oct <- chent$new("1-octanol", smiles = "CCCCCCCCO")
oct$try_pubchem()
print(oct)
+plot(oct)
diff --git a/inst/examples/ai.R b/inst/examples/pai.R
index 91b644a..91b644a 100644
--- a/inst/examples/ai.R
+++ b/inst/examples/pai.R
diff --git a/inst/web/chent-15.png b/inst/web/chent-15.png
new file mode 100644
index 0000000..dfc7eb3
--- /dev/null
+++ b/inst/web/chent-15.png
Binary files differ
diff --git a/inst/web/chent-8.png b/inst/web/chent-8.png
new file mode 100644
index 0000000..315e30f
--- /dev/null
+++ b/inst/web/chent-8.png
Binary files differ
diff --git a/inst/web/chent.html b/inst/web/chent.html
new file mode 100644
index 0000000..f2adb6b
--- /dev/null
+++ b/inst/web/chent.html
@@ -0,0 +1,156 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>chent. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>An R6 class for chemical entities with associated data</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>chent</div></pre>
+
+ <div class="Format">
+ <h2>Format</h2>
+
+ <p>An <code><a href='http://www.inside-r.org/packages/cran/R6/docs/R6Class'>R6Class</a></code> generator object</p>
+
+ </div>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>The class is initialised with an identifier. Chemical information is retrieved from
+the internet. Additionally, it can be generated using RDKit if RDKit and its
+python bindings are installed.</p>
+
+ </div>
+
+ <div class="Fields">
+ <h2>Fields</h2>
+
+ <p></p>
+
+ <p><dl>
+<dt><code>identifier</code></dt><dd>The identifier that was used to initiate the object, with attribute 'source'</dd></p>
+
+ <p><dt><code>inchikey</code></dt><dd>InChI Key, with attribute 'source'</dd></p>
+
+ <p><dt><code>smiles</code></dt><dd>SMILES code, with attribute 'source'</dd></p>
+
+ <p><dt><code>mw</code></dt><dd>Molecular weight, with attribute 'source'</dd></p>
+
+ <p><dt><code>pubchem</code></dt><dd>List of information retreived from PubChem</dd></p>
+
+ <p><dt><code>rdkit</code></dt><dd>List of information obtained with RDKit</dd></p>
+
+ <p><dt><code>Picture</code></dt><dd>Graph as a <code><a href='http://www.inside-r.org/packages/cran/grImport/docs/picture'>picture</a></code> object obtained using grImport</dd></p>
+
+ <p></dl></p>
+
+ </div>
+
+ <h2 id="examples">Examples</h2>
+ <pre class="examples"><div class='input'>oct &lt;- chent$new(&quot;1-octanol&quot;, smiles = &quot;CCCCCCCCO&quot;)
+oct$try_pubchem()
+</div>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&amp;db=pccompound&amp;term=1-octanol</strong>
+<strong class='message'>Found 1 entries in PubChem, using the first one.</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&amp;db=pccompound&amp;ID=957</strong>
+<div class='input'>print(oct)
+</div>
+<div class='output'>&lt;chent&gt;
+Identifier $identifier 1-octanol
+InChI Key $inchikey KBPLFHHGFOOTCA-UHFFFAOYSA-N
+SMILES string $smiles CCCCCCCCO
+Molecular weight $mw: 130.2
+PubChem synonyms (first 10):
+ [1] &quot;1-octanol&quot; &quot;Octan-1-ol&quot; &quot;octanol&quot; &quot;N-octanol&quot; &quot;Capryl alcohol&quot; &quot;Octyl alcohol&quot;
+ [7] &quot;n-Octyl alcohol&quot; &quot;caprylic alcohol&quot; &quot;Heptyl carbinol&quot; &quot;1-Hydroxyoctane&quot;
+</div>
+<div class='input'>plot(oct)
+</div>
+<div class='input'>caffeine &lt;- chent$new(&quot;caffeine&quot;, source = &quot;pubchem&quot;)
+</div>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&amp;db=pccompound&amp;term=caffeine</strong>
+<strong class='message'>Found 217 entries in PubChem, using the first one.</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&amp;db=pccompound&amp;ID=1188</strong>
+<div class='input'>print(caffeine)
+</div>
+<div class='output'>&lt;chent&gt;
+Identifier $identifier caffeine
+InChI Key $inchikey LRFVTYWOQMYALW-UHFFFAOYSA-N
+SMILES string $smiles C1=NC2=C(N1)C(=O)NC(=O)N2
+Molecular weight $mw: 152.1
+PubChem synonyms (first 10):
+ [1] &quot;xanthine&quot; &quot;2,6-Dihydroxypurine&quot; &quot;69-89-6&quot; &quot;Xanthin&quot; &quot;2,6-dioxopurine&quot;
+ [6] &quot;Pseudoxanthine&quot; &quot;Isoxanthine&quot; &quot;Xanthic oxide&quot; &quot;1H-Purine-2,6-diol&quot; &quot;Purine-2,6-diol&quot;
+</div>
+<div class='input'>caffeine$get_rdkit()
+plot(caffeine)
+</div>
+<p><img src='chent-15.png' alt='' width='540' height='400' /></p></pre>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>chent</li>
+ </ul>
+ <ul>
+ <li>data</li>
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/css/bootstrap-responsive.css b/inst/web/css/bootstrap-responsive.css
new file mode 100644
index 0000000..06e55c0
--- /dev/null
+++ b/inst/web/css/bootstrap-responsive.css
@@ -0,0 +1,815 @@
+/*!
+ * Bootstrap Responsive v2.0.4
+ *
+ * Copyright 2012 Twitter, Inc
+ * Licensed under the Apache License v2.0
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
+ */
+
+.clearfix {
+ *zoom: 1;
+}
+
+.clearfix:before,
+.clearfix:after {
+ display: table;
+ content: "";
+}
+
+.clearfix:after {
+ clear: both;
+}
+
+.hide-text {
+ font: 0/0 a;
+ color: transparent;
+ text-shadow: none;
+ background-color: transparent;
+ border: 0;
+}
+
+.input-block-level {
+ display: block;
+ width: 100%;
+ min-height: 28px;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+.hidden {
+ display: none;
+ visibility: hidden;
+}
+
+.visible-phone {
+ display: none !important;
+}
+
+.visible-tablet {
+ display: none !important;
+}
+
+.hidden-desktop {
+ display: none !important;
+}
+
+@media (max-width: 767px) {
+ .visible-phone {
+ display: inherit !important;
+ }
+ .hidden-phone {
+ display: none !important;
+ }
+ .hidden-desktop {
+ display: inherit !important;
+ }
+ .visible-desktop {
+ display: none !important;
+ }
+}
+
+@media (min-width: 768px) and (max-width: 979px) {
+ .visible-tablet {
+ display: inherit !important;
+ }
+ .hidden-tablet {
+ display: none !important;
+ }
+ .hidden-desktop {
+ display: inherit !important;
+ }
+ .visible-desktop {
+ display: none !important ;
+ }
+}
+
+@media (max-width: 480px) {
+ .nav-collapse {
+ -webkit-transform: translate3d(0, 0, 0);
+ }
+ .page-header h1 small {
+ display: block;
+ line-height: 18px;
+ }
+ input[type="checkbox"],
+ input[type="radio"] {
+ border: 1px solid #ccc;
+ }
+ .form-horizontal .control-group > label {
+ float: none;
+ width: auto;
+ padding-top: 0;
+ text-align: left;
+ }
+ .form-horizontal .controls {
+ margin-left: 0;
+ }
+ .form-horizontal .control-list {
+ padding-top: 0;
+ }
+ .form-horizontal .form-actions {
+ padding-right: 10px;
+ padding-left: 10px;
+ }
+ .modal {
+ position: absolute;
+ top: 10px;
+ right: 10px;
+ left: 10px;
+ width: auto;
+ margin: 0;
+ }
+ .modal.fade.in {
+ top: auto;
+ }
+ .modal-header .close {
+ padding: 10px;
+ margin: -10px;
+ }
+ .carousel-caption {
+ position: static;
+ }
+}
+
+@media (max-width: 767px) {
+ body {
+ padding-right: 20px;
+ padding-left: 20px;
+ }
+ .navbar-fixed-top,
+ .navbar-fixed-bottom {
+ margin-right: -20px;
+ margin-left: -20px;
+ }
+ .container-fluid {
+ padding: 0;
+ }
+ .dl-horizontal dt {
+ float: none;
+ width: auto;
+ clear: none;
+ text-align: left;
+ }
+ .dl-horizontal dd {
+ margin-left: 0;
+ }
+ .container {
+ width: auto;
+ }
+ .row-fluid {
+ width: 100%;
+ }
+ .row,
+ .thumbnails {
+ margin-left: 0;
+ }
+ [class*="span"],
+ .row-fluid [class*="span"] {
+ display: block;
+ float: none;
+ width: auto;
+ margin-left: 0;
+ }
+ .input-large,
+ .input-xlarge,
+ .input-xxlarge,
+ input[class*="span"],
+ select[class*="span"],
+ textarea[class*="span"],
+ .uneditable-input {
+ display: block;
+ width: 100%;
+ min-height: 28px;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+ }
+ .input-prepend input,
+ .input-append input,
+ .input-prepend input[class*="span"],
+ .input-append input[class*="span"] {
+ display: inline-block;
+ width: auto;
+ }
+}
+
+@media (min-width: 768px) and (max-width: 979px) {
+ .row {
+ margin-left: -20px;
+ *zoom: 1;
+ }
+ .row:before,
+ .row:after {
+ display: table;
+ content: "";
+ }
+ .row:after {
+ clear: both;
+ }
+ [class*="span"] {
+ float: left;
+ margin-left: 20px;
+ }
+ .container,
+ .navbar-fixed-top .container,
+ .navbar-fixed-bottom .container {
+ width: 724px;
+ }
+ .span12 {
+ width: 724px;
+ }
+ .span11 {
+ width: 662px;
+ }
+ .span10 {
+ width: 600px;
+ }
+ .span9 {
+ width: 538px;
+ }
+ .span8 {
+ width: 476px;
+ }
+ .span7 {
+ width: 414px;
+ }
+ .span6 {
+ width: 352px;
+ }
+ .span5 {
+ width: 290px;
+ }
+ .span4 {
+ width: 228px;
+ }
+ .span3 {
+ width: 166px;
+ }
+ .span2 {
+ width: 104px;
+ }
+ .span1 {
+ width: 42px;
+ }
+ .offset12 {
+ margin-left: 764px;
+ }
+ .offset11 {
+ margin-left: 702px;
+ }
+ .offset10 {
+ margin-left: 640px;
+ }
+ .offset9 {
+ margin-left: 578px;
+ }
+ .offset8 {
+ margin-left: 516px;
+ }
+ .offset7 {
+ margin-left: 454px;
+ }
+ .offset6 {
+ margin-left: 392px;
+ }
+ .offset5 {
+ margin-left: 330px;
+ }
+ .offset4 {
+ margin-left: 268px;
+ }
+ .offset3 {
+ margin-left: 206px;
+ }
+ .offset2 {
+ margin-left: 144px;
+ }
+ .offset1 {
+ margin-left: 82px;
+ }
+ .row-fluid {
+ width: 100%;
+ *zoom: 1;
+ }
+ .row-fluid:before,
+ .row-fluid:after {
+ display: table;
+ content: "";
+ }
+ .row-fluid:after {
+ clear: both;
+ }
+ .row-fluid [class*="span"] {
+ display: block;
+ float: left;
+ width: 100%;
+ min-height: 28px;
+ margin-left: 2.762430939%;
+ *margin-left: 2.709239449638298%;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+ }
+ .row-fluid [class*="span"]:first-child {
+ margin-left: 0;
+ }
+ .row-fluid .span12 {
+ width: 99.999999993%;
+ *width: 99.9468085036383%;
+ }
+ .row-fluid .span11 {
+ width: 91.436464082%;
+ *width: 91.38327259263829%;
+ }
+ .row-fluid .span10 {
+ width: 82.87292817100001%;
+ *width: 82.8197366816383%;
+ }
+ .row-fluid .span9 {
+ width: 74.30939226%;
+ *width: 74.25620077063829%;
+ }
+ .row-fluid .span8 {
+ width: 65.74585634900001%;
+ *width: 65.6926648596383%;
+ }
+ .row-fluid .span7 {
+ width: 57.182320438000005%;
+ *width: 57.129128948638304%;
+ }
+ .row-fluid .span6 {
+ width: 48.618784527%;
+ *width: 48.5655930376383%;
+ }
+ .row-fluid .span5 {
+ width: 40.055248616%;
+ *width: 40.0020571266383%;
+ }
+ .row-fluid .span4 {
+ width: 31.491712705%;
+ *width: 31.4385212156383%;
+ }
+ .row-fluid .span3 {
+ width: 22.928176794%;
+ *width: 22.874985304638297%;
+ }
+ .row-fluid .span2 {
+ width: 14.364640883%;
+ *width: 14.311449393638298%;
+ }
+ .row-fluid .span1 {
+ width: 5.801104972%;
+ *width: 5.747913482638298%;
+ }
+ input,
+ textarea,
+ .uneditable-input {
+ margin-left: 0;
+ }
+ input.span12,
+ textarea.span12,
+ .uneditable-input.span12 {
+ width: 714px;
+ }
+ input.span11,
+ textarea.span11,
+ .uneditable-input.span11 {
+ width: 652px;
+ }
+ input.span10,
+ textarea.span10,
+ .uneditable-input.span10 {
+ width: 590px;
+ }
+ input.span9,
+ textarea.span9,
+ .uneditable-input.span9 {
+ width: 528px;
+ }
+ input.span8,
+ textarea.span8,
+ .uneditable-input.span8 {
+ width: 466px;
+ }
+ input.span7,
+ textarea.span7,
+ .uneditable-input.span7 {
+ width: 404px;
+ }
+ input.span6,
+ textarea.span6,
+ .uneditable-input.span6 {
+ width: 342px;
+ }
+ input.span5,
+ textarea.span5,
+ .uneditable-input.span5 {
+ width: 280px;
+ }
+ input.span4,
+ textarea.span4,
+ .uneditable-input.span4 {
+ width: 218px;
+ }
+ input.span3,
+ textarea.span3,
+ .uneditable-input.span3 {
+ width: 156px;
+ }
+ input.span2,
+ textarea.span2,
+ .uneditable-input.span2 {
+ width: 94px;
+ }
+ input.span1,
+ textarea.span1,
+ .uneditable-input.span1 {
+ width: 32px;
+ }
+}
+
+@media (min-width: 1200px) {
+ .row {
+ margin-left: -30px;
+ *zoom: 1;
+ }
+ .row:before,
+ .row:after {
+ display: table;
+ content: "";
+ }
+ .row:after {
+ clear: both;
+ }
+ [class*="span"] {
+ float: left;
+ margin-left: 30px;
+ }
+ .container,
+ .navbar-fixed-top .container,
+ .navbar-fixed-bottom .container {
+ width: 1170px;
+ }
+ .span12 {
+ width: 1170px;
+ }
+ .span11 {
+ width: 1070px;
+ }
+ .span10 {
+ width: 970px;
+ }
+ .span9 {
+ width: 870px;
+ }
+ .span8 {
+ width: 770px;
+ }
+ .span7 {
+ width: 670px;
+ }
+ .span6 {
+ width: 570px;
+ }
+ .span5 {
+ width: 470px;
+ }
+ .span4 {
+ width: 370px;
+ }
+ .span3 {
+ width: 270px;
+ }
+ .span2 {
+ width: 170px;
+ }
+ .span1 {
+ width: 70px;
+ }
+ .offset12 {
+ margin-left: 1230px;
+ }
+ .offset11 {
+ margin-left: 1130px;
+ }
+ .offset10 {
+ margin-left: 1030px;
+ }
+ .offset9 {
+ margin-left: 930px;
+ }
+ .offset8 {
+ margin-left: 830px;
+ }
+ .offset7 {
+ margin-left: 730px;
+ }
+ .offset6 {
+ margin-left: 630px;
+ }
+ .offset5 {
+ margin-left: 530px;
+ }
+ .offset4 {
+ margin-left: 430px;
+ }
+ .offset3 {
+ margin-left: 330px;
+ }
+ .offset2 {
+ margin-left: 230px;
+ }
+ .offset1 {
+ margin-left: 130px;
+ }
+ .row-fluid {
+ width: 100%;
+ *zoom: 1;
+ }
+ .row-fluid:before,
+ .row-fluid:after {
+ display: table;
+ content: "";
+ }
+ .row-fluid:after {
+ clear: both;
+ }
+ .row-fluid [class*="span"] {
+ display: block;
+ float: left;
+ width: 100%;
+ min-height: 28px;
+ margin-left: 2.564102564%;
+ *margin-left: 2.510911074638298%;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+ }
+ .row-fluid [class*="span"]:first-child {
+ margin-left: 0;
+ }
+ .row-fluid .span12 {
+ width: 100%;
+ *width: 99.94680851063829%;
+ }
+ .row-fluid .span11 {
+ width: 91.45299145300001%;
+ *width: 91.3997999636383%;
+ }
+ .row-fluid .span10 {
+ width: 82.905982906%;
+ *width: 82.8527914166383%;
+ }
+ .row-fluid .span9 {
+ width: 74.358974359%;
+ *width: 74.30578286963829%;
+ }
+ .row-fluid .span8 {
+ width: 65.81196581200001%;
+ *width: 65.7587743226383%;
+ }
+ .row-fluid .span7 {
+ width: 57.264957265%;
+ *width: 57.2117657756383%;
+ }
+ .row-fluid .span6 {
+ width: 48.717948718%;
+ *width: 48.6647572286383%;
+ }
+ .row-fluid .span5 {
+ width: 40.170940171000005%;
+ *width: 40.117748681638304%;
+ }
+ .row-fluid .span4 {
+ width: 31.623931624%;
+ *width: 31.5707401346383%;
+ }
+ .row-fluid .span3 {
+ width: 23.076923077%;
+ *width: 23.0237315876383%;
+ }
+ .row-fluid .span2 {
+ width: 14.529914530000001%;
+ *width: 14.4767230406383%;
+ }
+ .row-fluid .span1 {
+ width: 5.982905983%;
+ *width: 5.929714493638298%;
+ }
+ input,
+ textarea,
+ .uneditable-input {
+ margin-left: 0;
+ }
+ input.span12,
+ textarea.span12,
+ .uneditable-input.span12 {
+ width: 1160px;
+ }
+ input.span11,
+ textarea.span11,
+ .uneditable-input.span11 {
+ width: 1060px;
+ }
+ input.span10,
+ textarea.span10,
+ .uneditable-input.span10 {
+ width: 960px;
+ }
+ input.span9,
+ textarea.span9,
+ .uneditable-input.span9 {
+ width: 860px;
+ }
+ input.span8,
+ textarea.span8,
+ .uneditable-input.span8 {
+ width: 760px;
+ }
+ input.span7,
+ textarea.span7,
+ .uneditable-input.span7 {
+ width: 660px;
+ }
+ input.span6,
+ textarea.span6,
+ .uneditable-input.span6 {
+ width: 560px;
+ }
+ input.span5,
+ textarea.span5,
+ .uneditable-input.span5 {
+ width: 460px;
+ }
+ input.span4,
+ textarea.span4,
+ .uneditable-input.span4 {
+ width: 360px;
+ }
+ input.span3,
+ textarea.span3,
+ .uneditable-input.span3 {
+ width: 260px;
+ }
+ input.span2,
+ textarea.span2,
+ .uneditable-input.span2 {
+ width: 160px;
+ }
+ input.span1,
+ textarea.span1,
+ .uneditable-input.span1 {
+ width: 60px;
+ }
+ .thumbnails {
+ margin-left: -30px;
+ }
+ .thumbnails > li {
+ margin-left: 30px;
+ }
+ .row-fluid .thumbnails {
+ margin-left: 0;
+ }
+}
+
+@media (max-width: 979px) {
+ body {
+ padding-top: 0;
+ }
+ .navbar-fixed-top,
+ .navbar-fixed-bottom {
+ position: static;
+ }
+ .navbar-fixed-top {
+ margin-bottom: 18px;
+ }
+ .navbar-fixed-bottom {
+ margin-top: 18px;
+ }
+ .navbar-fixed-top .navbar-inner,
+ .navbar-fixed-bottom .navbar-inner {
+ padding: 5px;
+ }
+ .navbar .container {
+ width: auto;
+ padding: 0;
+ }
+ .navbar .brand {
+ padding-right: 10px;
+ padding-left: 10px;
+ margin: 0 0 0 -5px;
+ }
+ .nav-collapse {
+ clear: both;
+ }
+ .nav-collapse .nav {
+ float: none;
+ margin: 0 0 9px;
+ }
+ .nav-collapse .nav > li {
+ float: none;
+ }
+ .nav-collapse .nav > li > a {
+ margin-bottom: 2px;
+ }
+ .nav-collapse .nav > .divider-vertical {
+ display: none;
+ }
+ .nav-collapse .nav .nav-header {
+ color: #999999;
+ text-shadow: none;
+ }
+ .nav-collapse .nav > li > a,
+ .nav-collapse .dropdown-menu a {
+ padding: 6px 15px;
+ font-weight: bold;
+ color: #999999;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+ }
+ .nav-collapse .btn {
+ padding: 4px 10px 4px;
+ font-weight: normal;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ }
+ .nav-collapse .dropdown-menu li + li a {
+ margin-bottom: 2px;
+ }
+ .nav-collapse .nav > li > a:hover,
+ .nav-collapse .dropdown-menu a:hover {
+ background-color: #222222;
+ }
+ .nav-collapse.in .btn-group {
+ padding: 0;
+ margin-top: 5px;
+ }
+ .nav-collapse .dropdown-menu {
+ position: static;
+ top: auto;
+ left: auto;
+ display: block;
+ float: none;
+ max-width: none;
+ padding: 0;
+ margin: 0 15px;
+ background-color: transparent;
+ border: none;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+ -webkit-box-shadow: none;
+ -moz-box-shadow: none;
+ box-shadow: none;
+ }
+ .nav-collapse .dropdown-menu:before,
+ .nav-collapse .dropdown-menu:after {
+ display: none;
+ }
+ .nav-collapse .dropdown-menu .divider {
+ display: none;
+ }
+ .nav-collapse .navbar-form,
+ .nav-collapse .navbar-search {
+ float: none;
+ padding: 9px 15px;
+ margin: 9px 0;
+ border-top: 1px solid #222222;
+ border-bottom: 1px solid #222222;
+ -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1);
+ -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1);
+ box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1);
+ }
+ .navbar .nav-collapse .nav.pull-right {
+ float: none;
+ margin-left: 0;
+ }
+ .nav-collapse,
+ .nav-collapse.collapse {
+ height: 0;
+ overflow: hidden;
+ }
+ .navbar .btn-navbar {
+ display: block;
+ }
+ .navbar-static .navbar-inner {
+ padding-right: 10px;
+ padding-left: 10px;
+ }
+}
+
+@media (min-width: 980px) {
+ .nav-collapse.collapse {
+ height: auto !important;
+ overflow: visible !important;
+ }
+}
diff --git a/inst/web/css/bootstrap-responsive.min.css b/inst/web/css/bootstrap-responsive.min.css
new file mode 100644
index 0000000..1f55036
--- /dev/null
+++ b/inst/web/css/bootstrap-responsive.min.css
@@ -0,0 +1,9 @@
+/*!
+ * Bootstrap Responsive v2.0.4
+ *
+ * Copyright 2012 Twitter, Inc
+ * Licensed under the Apache License v2.0
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
+ */.clearfix{*zoom:1}.clearfix:before,.clearfix:after{display:table;content:""}.clearfix:after{clear:both}.hide-text{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.input-block-level{display:block;width:100%;min-height:28px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.hidden{display:none;visibility:hidden}.visible-phone{display:none!important}.visible-tablet{display:none!important}.hidden-desktop{display:none!important}@media(max-width:767px){.visible-phone{display:inherit!important}.hidden-phone{display:none!important}.hidden-desktop{display:inherit!important}.visible-desktop{display:none!important}}@media(min-width:768px) and (max-width:979px){.visible-tablet{display:inherit!important}.hidden-tablet{display:none!important}.hidden-desktop{display:inherit!important}.visible-desktop{display:none!important}}@media(max-width:480px){.nav-collapse{-webkit-transform:translate3d(0,0,0)}.page-header h1 small{display:block;line-height:18px}input[type="checkbox"],input[type="radio"]{border:1px solid #ccc}.form-horizontal .control-group>label{float:none;width:auto;padding-top:0;text-align:left}.form-horizontal .controls{margin-left:0}.form-horizontal .control-list{padding-top:0}.form-horizontal .form-actions{padding-right:10px;padding-left:10px}.modal{position:absolute;top:10px;right:10px;left:10px;width:auto;margin:0}.modal.fade.in{top:auto}.modal-header .close{padding:10px;margin:-10px}.carousel-caption{position:static}}@media(max-width:767px){body{padding-right:20px;padding-left:20px}.navbar-fixed-top,.navbar-fixed-bottom{margin-right:-20px;margin-left:-20px}.container-fluid{padding:0}.dl-horizontal dt{float:none;width:auto;clear:none;text-align:left}.dl-horizontal dd{margin-left:0}.container{width:auto}.row-fluid{width:100%}.row,.thumbnails{margin-left:0}[class*="span"],.row-fluid [class*="span"]{display:block;float:none;width:auto;margin-left:0}.input-large,.input-xlarge,.input-xxlarge,input[class*="span"],select[class*="span"],textarea[class*="span"],.uneditable-input{display:block;width:100%;min-height:28px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.input-prepend input,.input-append input,.input-prepend input[class*="span"],.input-append input[class*="span"]{display:inline-block;width:auto}}@media(min-width:768px) and (max-width:979px){.row{margin-left:-20px;*zoom:1}.row:before,.row:after{display:table;content:""}.row:after{clear:both}[class*="span"]{float:left;margin-left:20px}.container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:724px}.span12{width:724px}.span11{width:662px}.span10{width:600px}.span9{width:538px}.span8{width:476px}.span7{width:414px}.span6{width:352px}.span5{width:290px}.span4{width:228px}.span3{width:166px}.span2{width:104px}.span1{width:42px}.offset12{margin-left:764px}.offset11{margin-left:702px}.offset10{margin-left:640px}.offset9{margin-left:578px}.offset8{margin-left:516px}.offset7{margin-left:454px}.offset6{margin-left:392px}.offset5{margin-left:330px}.offset4{margin-left:268px}.offset3{margin-left:206px}.offset2{margin-left:144px}.offset1{margin-left:82px}.row-fluid{width:100%;*zoom:1}.row-fluid:before,.row-fluid:after{display:table;content:""}.row-fluid:after{clear:both}.row-fluid [class*="span"]{display:block;float:left;width:100%;min-height:28px;margin-left:2.762430939%;*margin-left:2.709239449638298%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="span"]:first-child{margin-left:0}.row-fluid .span12{width:99.999999993%;*width:99.9468085036383%}.row-fluid .span11{width:91.436464082%;*width:91.38327259263829%}.row-fluid .span10{width:82.87292817100001%;*width:82.8197366816383%}.row-fluid .span9{width:74.30939226%;*width:74.25620077063829%}.row-fluid .span8{width:65.74585634900001%;*width:65.6926648596383%}.row-fluid .span7{width:57.182320438000005%;*width:57.129128948638304%}.row-fluid .span6{width:48.618784527%;*width:48.5655930376383%}.row-fluid .span5{width:40.055248616%;*width:40.0020571266383%}.row-fluid .span4{width:31.491712705%;*width:31.4385212156383%}.row-fluid .span3{width:22.928176794%;*width:22.874985304638297%}.row-fluid .span2{width:14.364640883%;*width:14.311449393638298%}.row-fluid .span1{width:5.801104972%;*width:5.747913482638298%}input,textarea,.uneditable-input{margin-left:0}input.span12,textarea.span12,.uneditable-input.span12{width:714px}input.span11,textarea.span11,.uneditable-input.span11{width:652px}input.span10,textarea.span10,.uneditable-input.span10{width:590px}input.span9,textarea.span9,.uneditable-input.span9{width:528px}input.span8,textarea.span8,.uneditable-input.span8{width:466px}input.span7,textarea.span7,.uneditable-input.span7{width:404px}input.span6,textarea.span6,.uneditable-input.span6{width:342px}input.span5,textarea.span5,.uneditable-input.span5{width:280px}input.span4,textarea.span4,.uneditable-input.span4{width:218px}input.span3,textarea.span3,.uneditable-input.span3{width:156px}input.span2,textarea.span2,.uneditable-input.span2{width:94px}input.span1,textarea.span1,.uneditable-input.span1{width:32px}}@media(min-width:1200px){.row{margin-left:-30px;*zoom:1}.row:before,.row:after{display:table;content:""}.row:after{clear:both}[class*="span"]{float:left;margin-left:30px}.container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:1170px}.span12{width:1170px}.span11{width:1070px}.span10{width:970px}.span9{width:870px}.span8{width:770px}.span7{width:670px}.span6{width:570px}.span5{width:470px}.span4{width:370px}.span3{width:270px}.span2{width:170px}.span1{width:70px}.offset12{margin-left:1230px}.offset11{margin-left:1130px}.offset10{margin-left:1030px}.offset9{margin-left:930px}.offset8{margin-left:830px}.offset7{margin-left:730px}.offset6{margin-left:630px}.offset5{margin-left:530px}.offset4{margin-left:430px}.offset3{margin-left:330px}.offset2{margin-left:230px}.offset1{margin-left:130px}.row-fluid{width:100%;*zoom:1}.row-fluid:before,.row-fluid:after{display:table;content:""}.row-fluid:after{clear:both}.row-fluid [class*="span"]{display:block;float:left;width:100%;min-height:28px;margin-left:2.564102564%;*margin-left:2.510911074638298%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="span"]:first-child{margin-left:0}.row-fluid .span12{width:100%;*width:99.94680851063829%}.row-fluid .span11{width:91.45299145300001%;*width:91.3997999636383%}.row-fluid .span10{width:82.905982906%;*width:82.8527914166383%}.row-fluid .span9{width:74.358974359%;*width:74.30578286963829%}.row-fluid .span8{width:65.81196581200001%;*width:65.7587743226383%}.row-fluid .span7{width:57.264957265%;*width:57.2117657756383%}.row-fluid .span6{width:48.717948718%;*width:48.6647572286383%}.row-fluid .span5{width:40.170940171000005%;*width:40.117748681638304%}.row-fluid .span4{width:31.623931624%;*width:31.5707401346383%}.row-fluid .span3{width:23.076923077%;*width:23.0237315876383%}.row-fluid .span2{width:14.529914530000001%;*width:14.4767230406383%}.row-fluid .span1{width:5.982905983%;*width:5.929714493638298%}input,textarea,.uneditable-input{margin-left:0}input.span12,textarea.span12,.uneditable-input.span12{width:1160px}input.span11,textarea.span11,.uneditable-input.span11{width:1060px}input.span10,textarea.span10,.uneditable-input.span10{width:960px}input.span9,textarea.span9,.uneditable-input.span9{width:860px}input.span8,textarea.span8,.uneditable-input.span8{width:760px}input.span7,textarea.span7,.uneditable-input.span7{width:660px}input.span6,textarea.span6,.uneditable-input.span6{width:560px}input.span5,textarea.span5,.uneditable-input.span5{width:460px}input.span4,textarea.span4,.uneditable-input.span4{width:360px}input.span3,textarea.span3,.uneditable-input.span3{width:260px}input.span2,textarea.span2,.uneditable-input.span2{width:160px}input.span1,textarea.span1,.uneditable-input.span1{width:60px}.thumbnails{margin-left:-30px}.thumbnails>li{margin-left:30px}.row-fluid .thumbnails{margin-left:0}}@media(max-width:979px){body{padding-top:0}.navbar-fixed-top,.navbar-fixed-bottom{position:static}.navbar-fixed-top{margin-bottom:18px}.navbar-fixed-bottom{margin-top:18px}.navbar-fixed-top .navbar-inner,.navbar-fixed-bottom .navbar-inner{padding:5px}.navbar .container{width:auto;padding:0}.navbar .brand{padding-right:10px;padding-left:10px;margin:0 0 0 -5px}.nav-collapse{clear:both}.nav-collapse .nav{float:none;margin:0 0 9px}.nav-collapse .nav>li{float:none}.nav-collapse .nav>li>a{margin-bottom:2px}.nav-collapse .nav>.divider-vertical{display:none}.nav-collapse .nav .nav-header{color:#999;text-shadow:none}.nav-collapse .nav>li>a,.nav-collapse .dropdown-menu a{padding:6px 15px;font-weight:bold;color:#999;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.nav-collapse .btn{padding:4px 10px 4px;font-weight:normal;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.nav-collapse .dropdown-menu li+li a{margin-bottom:2px}.nav-collapse .nav>li>a:hover,.nav-collapse .dropdown-menu a:hover{background-color:#222}.nav-collapse.in .btn-group{padding:0;margin-top:5px}.nav-collapse .dropdown-menu{position:static;top:auto;left:auto;display:block;float:none;max-width:none;padding:0;margin:0 15px;background-color:transparent;border:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.nav-collapse .dropdown-menu:before,.nav-collapse .dropdown-menu:after{display:none}.nav-collapse .dropdown-menu .divider{display:none}.nav-collapse .navbar-form,.nav-collapse .navbar-search{float:none;padding:9px 15px;margin:9px 0;border-top:1px solid #222;border-bottom:1px solid #222;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1);-moz-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1);box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.1)}.navbar .nav-collapse .nav.pull-right{float:none;margin-left:0}.nav-collapse,.nav-collapse.collapse{height:0;overflow:hidden}.navbar .btn-navbar{display:block}.navbar-static .navbar-inner{padding-right:10px;padding-left:10px}}@media(min-width:980px){.nav-collapse.collapse{height:auto!important;overflow:visible!important}}
diff --git a/inst/web/css/bootstrap.css b/inst/web/css/bootstrap.css
new file mode 100644
index 0000000..bb40c85
--- /dev/null
+++ b/inst/web/css/bootstrap.css
@@ -0,0 +1,4983 @@
+/*!
+ * Bootstrap v2.0.4
+ *
+ * Copyright 2012 Twitter, Inc
+ * Licensed under the Apache License v2.0
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
+ */
+
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+nav,
+section {
+ display: block;
+}
+
+audio,
+canvas,
+video {
+ display: inline-block;
+ *display: inline;
+ *zoom: 1;
+}
+
+audio:not([controls]) {
+ display: none;
+}
+
+html {
+ font-size: 100%;
+ -webkit-text-size-adjust: 100%;
+ -ms-text-size-adjust: 100%;
+}
+
+a:focus {
+ outline: thin dotted #333;
+ outline: 5px auto -webkit-focus-ring-color;
+ outline-offset: -2px;
+}
+
+a:hover,
+a:active {
+ outline: 0;
+}
+
+sub,
+sup {
+ position: relative;
+ font-size: 75%;
+ line-height: 0;
+ vertical-align: baseline;
+}
+
+sup {
+ top: -0.5em;
+}
+
+sub {
+ bottom: -0.25em;
+}
+
+img {
+ max-width: 100%;
+ vertical-align: middle;
+ border: 0;
+ -ms-interpolation-mode: bicubic;
+}
+
+#map_canvas img {
+ max-width: none;
+}
+
+button,
+input,
+select,
+textarea {
+ margin: 0;
+ font-size: 100%;
+ vertical-align: middle;
+}
+
+button,
+input {
+ *overflow: visible;
+ line-height: normal;
+}
+
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+ padding: 0;
+ border: 0;
+}
+
+button,
+input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+ cursor: pointer;
+ -webkit-appearance: button;
+}
+
+input[type="search"] {
+ -webkit-box-sizing: content-box;
+ -moz-box-sizing: content-box;
+ box-sizing: content-box;
+ -webkit-appearance: textfield;
+}
+
+input[type="search"]::-webkit-search-decoration,
+input[type="search"]::-webkit-search-cancel-button {
+ -webkit-appearance: none;
+}
+
+textarea {
+ overflow: auto;
+ vertical-align: top;
+}
+
+.clearfix {
+ *zoom: 1;
+}
+
+.clearfix:before,
+.clearfix:after {
+ display: table;
+ content: "";
+}
+
+.clearfix:after {
+ clear: both;
+}
+
+.hide-text {
+ font: 0/0 a;
+ color: transparent;
+ text-shadow: none;
+ background-color: transparent;
+ border: 0;
+}
+
+.input-block-level {
+ display: block;
+ width: 100%;
+ min-height: 28px;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+body {
+ margin: 0;
+ font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+ font-size: 13px;
+ line-height: 18px;
+ color: #333333;
+ background-color: #ffffff;
+}
+
+a {
+ color: #0088cc;
+ text-decoration: none;
+}
+
+a:hover {
+ color: #005580;
+ text-decoration: underline;
+}
+
+.row {
+ margin-left: -20px;
+ *zoom: 1;
+}
+
+.row:before,
+.row:after {
+ display: table;
+ content: "";
+}
+
+.row:after {
+ clear: both;
+}
+
+[class*="span"] {
+ float: left;
+ margin-left: 20px;
+}
+
+.container,
+.navbar-fixed-top .container,
+.navbar-fixed-bottom .container {
+ width: 940px;
+}
+
+.span12 {
+ width: 940px;
+}
+
+.span11 {
+ width: 860px;
+}
+
+.span10 {
+ width: 780px;
+}
+
+.span9 {
+ width: 700px;
+}
+
+.span8 {
+ width: 620px;
+}
+
+.span7 {
+ width: 540px;
+}
+
+.span6 {
+ width: 460px;
+}
+
+.span5 {
+ width: 380px;
+}
+
+.span4 {
+ width: 300px;
+}
+
+.span3 {
+ width: 220px;
+}
+
+.span2 {
+ width: 140px;
+}
+
+.span1 {
+ width: 60px;
+}
+
+.offset12 {
+ margin-left: 980px;
+}
+
+.offset11 {
+ margin-left: 900px;
+}
+
+.offset10 {
+ margin-left: 820px;
+}
+
+.offset9 {
+ margin-left: 740px;
+}
+
+.offset8 {
+ margin-left: 660px;
+}
+
+.offset7 {
+ margin-left: 580px;
+}
+
+.offset6 {
+ margin-left: 500px;
+}
+
+.offset5 {
+ margin-left: 420px;
+}
+
+.offset4 {
+ margin-left: 340px;
+}
+
+.offset3 {
+ margin-left: 260px;
+}
+
+.offset2 {
+ margin-left: 180px;
+}
+
+.offset1 {
+ margin-left: 100px;
+}
+
+.row-fluid {
+ width: 100%;
+ *zoom: 1;
+}
+
+.row-fluid:before,
+.row-fluid:after {
+ display: table;
+ content: "";
+}
+
+.row-fluid:after {
+ clear: both;
+}
+
+.row-fluid [class*="span"] {
+ display: block;
+ float: left;
+ width: 100%;
+ min-height: 28px;
+ margin-left: 2.127659574%;
+ *margin-left: 2.0744680846382977%;
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+}
+
+.row-fluid [class*="span"]:first-child {
+ margin-left: 0;
+}
+
+.row-fluid .span12 {
+ width: 99.99999998999999%;
+ *width: 99.94680850063828%;
+}
+
+.row-fluid .span11 {
+ width: 91.489361693%;
+ *width: 91.4361702036383%;
+}
+
+.row-fluid .span10 {
+ width: 82.97872339599999%;
+ *width: 82.92553190663828%;
+}
+
+.row-fluid .span9 {
+ width: 74.468085099%;
+ *width: 74.4148936096383%;
+}
+
+.row-fluid .span8 {
+ width: 65.95744680199999%;
+ *width: 65.90425531263828%;
+}
+
+.row-fluid .span7 {
+ width: 57.446808505%;
+ *width: 57.3936170156383%;
+}
+
+.row-fluid .span6 {
+ width: 48.93617020799999%;
+ *width: 48.88297871863829%;
+}
+
+.row-fluid .span5 {
+ width: 40.425531911%;
+ *width: 40.3723404216383%;
+}
+
+.row-fluid .span4 {
+ width: 31.914893614%;
+ *width: 31.8617021246383%;
+}
+
+.row-fluid .span3 {
+ width: 23.404255317%;
+ *width: 23.3510638276383%;
+}
+
+.row-fluid .span2 {
+ width: 14.89361702%;
+ *width: 14.8404255306383%;
+}
+
+.row-fluid .span1 {
+ width: 6.382978723%;
+ *width: 6.329787233638298%;
+}
+
+.container {
+ margin-right: auto;
+ margin-left: auto;
+ *zoom: 1;
+}
+
+.container:before,
+.container:after {
+ display: table;
+ content: "";
+}
+
+.container:after {
+ clear: both;
+}
+
+.container-fluid {
+ padding-right: 20px;
+ padding-left: 20px;
+ *zoom: 1;
+}
+
+.container-fluid:before,
+.container-fluid:after {
+ display: table;
+ content: "";
+}
+
+.container-fluid:after {
+ clear: both;
+}
+
+p {
+ margin: 0 0 9px;
+}
+
+p small {
+ font-size: 11px;
+ color: #999999;
+}
+
+.lead {
+ margin-bottom: 18px;
+ font-size: 20px;
+ font-weight: 200;
+ line-height: 27px;
+}
+
+h1,
+h2,
+h3,
+h4,
+h5,
+h6 {
+ margin: 0;
+ font-family: inherit;
+ font-weight: bold;
+ color: inherit;
+ text-rendering: optimizelegibility;
+}
+
+h1 small,
+h2 small,
+h3 small,
+h4 small,
+h5 small,
+h6 small {
+ font-weight: normal;
+ color: #999999;
+}
+
+h1 {
+ font-size: 30px;
+ line-height: 36px;
+}
+
+h1 small {
+ font-size: 18px;
+}
+
+h2 {
+ font-size: 24px;
+ line-height: 36px;
+}
+
+h2 small {
+ font-size: 18px;
+}
+
+h3 {
+ font-size: 18px;
+ line-height: 27px;
+}
+
+h3 small {
+ font-size: 14px;
+}
+
+h4,
+h5,
+h6 {
+ line-height: 18px;
+}
+
+h4 {
+ font-size: 14px;
+}
+
+h4 small {
+ font-size: 12px;
+}
+
+h5 {
+ font-size: 12px;
+}
+
+h6 {
+ font-size: 11px;
+ color: #999999;
+ text-transform: uppercase;
+}
+
+.page-header {
+ padding-bottom: 17px;
+ margin: 18px 0;
+ border-bottom: 1px solid #eeeeee;
+}
+
+.page-header h1 {
+ line-height: 1;
+}
+
+ul,
+ol {
+ padding: 0;
+ margin: 0 0 9px 25px;
+}
+
+ul ul,
+ul ol,
+ol ol,
+ol ul {
+ margin-bottom: 0;
+}
+
+ul {
+ list-style: disc;
+}
+
+ol {
+ list-style: decimal;
+}
+
+li {
+ line-height: 18px;
+}
+
+ul.unstyled,
+ol.unstyled {
+ margin-left: 0;
+ list-style: none;
+}
+
+dl {
+ margin-bottom: 18px;
+}
+
+dt,
+dd {
+ line-height: 18px;
+}
+
+dt {
+ font-weight: bold;
+ line-height: 17px;
+}
+
+dd {
+ margin-left: 9px;
+}
+
+.dl-horizontal dt {
+ float: left;
+ width: 120px;
+ overflow: hidden;
+ clear: left;
+ text-align: right;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+}
+
+.dl-horizontal dd {
+ margin-left: 130px;
+}
+
+hr {
+ margin: 18px 0;
+ border: 0;
+ border-top: 1px solid #eeeeee;
+ border-bottom: 1px solid #ffffff;
+}
+
+strong {
+ font-weight: bold;
+}
+
+em {
+ font-style: italic;
+}
+
+.muted {
+ color: #999999;
+}
+
+abbr[title] {
+ cursor: help;
+ border-bottom: 1px dotted #999999;
+}
+
+abbr.initialism {
+ font-size: 90%;
+ text-transform: uppercase;
+}
+
+blockquote {
+ padding: 0 0 0 15px;
+ margin: 0 0 18px;
+ border-left: 5px solid #eeeeee;
+}
+
+blockquote p {
+ margin-bottom: 0;
+ font-size: 16px;
+ font-weight: 300;
+ line-height: 22.5px;
+}
+
+blockquote small {
+ display: block;
+ line-height: 18px;
+ color: #999999;
+}
+
+blockquote small:before {
+ content: '\2014 \00A0';
+}
+
+blockquote.pull-right {
+ float: right;
+ padding-right: 15px;
+ padding-left: 0;
+ border-right: 5px solid #eeeeee;
+ border-left: 0;
+}
+
+blockquote.pull-right p,
+blockquote.pull-right small {
+ text-align: right;
+}
+
+q:before,
+q:after,
+blockquote:before,
+blockquote:after {
+ content: "";
+}
+
+address {
+ display: block;
+ margin-bottom: 18px;
+ font-style: normal;
+ line-height: 18px;
+}
+
+small {
+ font-size: 100%;
+}
+
+cite {
+ font-style: normal;
+}
+
+code,
+pre {
+ padding: 0 3px 2px;
+ font-family: Menlo, Monaco, Consolas, "Courier New", monospace;
+ font-size: 12px;
+ color: #333333;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+code {
+ padding: 2px 4px;
+ color: #d14;
+ background-color: #f7f7f9;
+ border: 1px solid #e1e1e8;
+}
+
+pre {
+ display: block;
+ padding: 8.5px;
+ margin: 0 0 9px;
+ font-size: 12.025px;
+ line-height: 18px;
+ word-break: break-all;
+ word-wrap: break-word;
+ white-space: pre;
+ white-space: pre-wrap;
+ background-color: #f5f5f5;
+ border: 1px solid #ccc;
+ border: 1px solid rgba(0, 0, 0, 0.15);
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+pre.prettyprint {
+ margin-bottom: 18px;
+}
+
+pre code {
+ padding: 0;
+ color: inherit;
+ background-color: transparent;
+ border: 0;
+}
+
+.pre-scrollable {
+ max-height: 340px;
+ overflow-y: scroll;
+}
+
+form {
+ margin: 0 0 18px;
+}
+
+fieldset {
+ padding: 0;
+ margin: 0;
+ border: 0;
+}
+
+legend {
+ display: block;
+ width: 100%;
+ padding: 0;
+ margin-bottom: 27px;
+ font-size: 19.5px;
+ line-height: 36px;
+ color: #333333;
+ border: 0;
+ border-bottom: 1px solid #e5e5e5;
+}
+
+legend small {
+ font-size: 13.5px;
+ color: #999999;
+}
+
+label,
+input,
+button,
+select,
+textarea {
+ font-size: 13px;
+ font-weight: normal;
+ line-height: 18px;
+}
+
+input,
+button,
+select,
+textarea {
+ font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+}
+
+label {
+ display: block;
+ margin-bottom: 5px;
+}
+
+select,
+textarea,
+input[type="text"],
+input[type="password"],
+input[type="datetime"],
+input[type="datetime-local"],
+input[type="date"],
+input[type="month"],
+input[type="time"],
+input[type="week"],
+input[type="number"],
+input[type="email"],
+input[type="url"],
+input[type="search"],
+input[type="tel"],
+input[type="color"],
+.uneditable-input {
+ display: inline-block;
+ height: 18px;
+ padding: 4px;
+ margin-bottom: 9px;
+ font-size: 13px;
+ line-height: 18px;
+ color: #555555;
+}
+
+input,
+textarea {
+ width: 210px;
+}
+
+textarea {
+ height: auto;
+}
+
+textarea,
+input[type="text"],
+input[type="password"],
+input[type="datetime"],
+input[type="datetime-local"],
+input[type="date"],
+input[type="month"],
+input[type="time"],
+input[type="week"],
+input[type="number"],
+input[type="email"],
+input[type="url"],
+input[type="search"],
+input[type="tel"],
+input[type="color"],
+.uneditable-input {
+ background-color: #ffffff;
+ border: 1px solid #cccccc;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+ -webkit-transition: border linear 0.2s, box-shadow linear 0.2s;
+ -moz-transition: border linear 0.2s, box-shadow linear 0.2s;
+ -ms-transition: border linear 0.2s, box-shadow linear 0.2s;
+ -o-transition: border linear 0.2s, box-shadow linear 0.2s;
+ transition: border linear 0.2s, box-shadow linear 0.2s;
+}
+
+textarea:focus,
+input[type="text"]:focus,
+input[type="password"]:focus,
+input[type="datetime"]:focus,
+input[type="datetime-local"]:focus,
+input[type="date"]:focus,
+input[type="month"]:focus,
+input[type="time"]:focus,
+input[type="week"]:focus,
+input[type="number"]:focus,
+input[type="email"]:focus,
+input[type="url"]:focus,
+input[type="search"]:focus,
+input[type="tel"]:focus,
+input[type="color"]:focus,
+.uneditable-input:focus {
+ border-color: rgba(82, 168, 236, 0.8);
+ outline: 0;
+ outline: thin dotted \9;
+ /* IE6-9 */
+
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6);
+}
+
+input[type="radio"],
+input[type="checkbox"] {
+ margin: 3px 0;
+ *margin-top: 0;
+ /* IE7 */
+
+ line-height: normal;
+ cursor: pointer;
+}
+
+input[type="submit"],
+input[type="reset"],
+input[type="button"],
+input[type="radio"],
+input[type="checkbox"] {
+ width: auto;
+}
+
+.uneditable-textarea {
+ width: auto;
+ height: auto;
+}
+
+select,
+input[type="file"] {
+ height: 28px;
+ /* In IE7, the height of the select element cannot be changed by height, only font-size */
+
+ *margin-top: 4px;
+ /* For IE7, add top margin to align select with labels */
+
+ line-height: 28px;
+}
+
+select {
+ width: 220px;
+ border: 1px solid #bbb;
+}
+
+select[multiple],
+select[size] {
+ height: auto;
+}
+
+select:focus,
+input[type="file"]:focus,
+input[type="radio"]:focus,
+input[type="checkbox"]:focus {
+ outline: thin dotted #333;
+ outline: 5px auto -webkit-focus-ring-color;
+ outline-offset: -2px;
+}
+
+.radio,
+.checkbox {
+ min-height: 18px;
+ padding-left: 18px;
+}
+
+.radio input[type="radio"],
+.checkbox input[type="checkbox"] {
+ float: left;
+ margin-left: -18px;
+}
+
+.controls > .radio:first-child,
+.controls > .checkbox:first-child {
+ padding-top: 5px;
+}
+
+.radio.inline,
+.checkbox.inline {
+ display: inline-block;
+ padding-top: 5px;
+ margin-bottom: 0;
+ vertical-align: middle;
+}
+
+.radio.inline + .radio.inline,
+.checkbox.inline + .checkbox.inline {
+ margin-left: 10px;
+}
+
+.input-mini {
+ width: 60px;
+}
+
+.input-small {
+ width: 90px;
+}
+
+.input-medium {
+ width: 150px;
+}
+
+.input-large {
+ width: 210px;
+}
+
+.input-xlarge {
+ width: 270px;
+}
+
+.input-xxlarge {
+ width: 530px;
+}
+
+input[class*="span"],
+select[class*="span"],
+textarea[class*="span"],
+.uneditable-input[class*="span"],
+.row-fluid input[class*="span"],
+.row-fluid select[class*="span"],
+.row-fluid textarea[class*="span"],
+.row-fluid .uneditable-input[class*="span"] {
+ float: none;
+ margin-left: 0;
+}
+
+.input-append input[class*="span"],
+.input-append .uneditable-input[class*="span"],
+.input-prepend input[class*="span"],
+.input-prepend .uneditable-input[class*="span"],
+.row-fluid .input-prepend [class*="span"],
+.row-fluid .input-append [class*="span"] {
+ display: inline-block;
+}
+
+input,
+textarea,
+.uneditable-input {
+ margin-left: 0;
+}
+
+input.span12,
+textarea.span12,
+.uneditable-input.span12 {
+ width: 930px;
+}
+
+input.span11,
+textarea.span11,
+.uneditable-input.span11 {
+ width: 850px;
+}
+
+input.span10,
+textarea.span10,
+.uneditable-input.span10 {
+ width: 770px;
+}
+
+input.span9,
+textarea.span9,
+.uneditable-input.span9 {
+ width: 690px;
+}
+
+input.span8,
+textarea.span8,
+.uneditable-input.span8 {
+ width: 610px;
+}
+
+input.span7,
+textarea.span7,
+.uneditable-input.span7 {
+ width: 530px;
+}
+
+input.span6,
+textarea.span6,
+.uneditable-input.span6 {
+ width: 450px;
+}
+
+input.span5,
+textarea.span5,
+.uneditable-input.span5 {
+ width: 370px;
+}
+
+input.span4,
+textarea.span4,
+.uneditable-input.span4 {
+ width: 290px;
+}
+
+input.span3,
+textarea.span3,
+.uneditable-input.span3 {
+ width: 210px;
+}
+
+input.span2,
+textarea.span2,
+.uneditable-input.span2 {
+ width: 130px;
+}
+
+input.span1,
+textarea.span1,
+.uneditable-input.span1 {
+ width: 50px;
+}
+
+input[disabled],
+select[disabled],
+textarea[disabled],
+input[readonly],
+select[readonly],
+textarea[readonly] {
+ cursor: not-allowed;
+ background-color: #eeeeee;
+ border-color: #ddd;
+}
+
+input[type="radio"][disabled],
+input[type="checkbox"][disabled],
+input[type="radio"][readonly],
+input[type="checkbox"][readonly] {
+ background-color: transparent;
+}
+
+.control-group.warning > label,
+.control-group.warning .help-block,
+.control-group.warning .help-inline {
+ color: #c09853;
+}
+
+.control-group.warning .checkbox,
+.control-group.warning .radio,
+.control-group.warning input,
+.control-group.warning select,
+.control-group.warning textarea {
+ color: #c09853;
+ border-color: #c09853;
+}
+
+.control-group.warning .checkbox:focus,
+.control-group.warning .radio:focus,
+.control-group.warning input:focus,
+.control-group.warning select:focus,
+.control-group.warning textarea:focus {
+ border-color: #a47e3c;
+ -webkit-box-shadow: 0 0 6px #dbc59e;
+ -moz-box-shadow: 0 0 6px #dbc59e;
+ box-shadow: 0 0 6px #dbc59e;
+}
+
+.control-group.warning .input-prepend .add-on,
+.control-group.warning .input-append .add-on {
+ color: #c09853;
+ background-color: #fcf8e3;
+ border-color: #c09853;
+}
+
+.control-group.error > label,
+.control-group.error .help-block,
+.control-group.error .help-inline {
+ color: #b94a48;
+}
+
+.control-group.error .checkbox,
+.control-group.error .radio,
+.control-group.error input,
+.control-group.error select,
+.control-group.error textarea {
+ color: #b94a48;
+ border-color: #b94a48;
+}
+
+.control-group.error .checkbox:focus,
+.control-group.error .radio:focus,
+.control-group.error input:focus,
+.control-group.error select:focus,
+.control-group.error textarea:focus {
+ border-color: #953b39;
+ -webkit-box-shadow: 0 0 6px #d59392;
+ -moz-box-shadow: 0 0 6px #d59392;
+ box-shadow: 0 0 6px #d59392;
+}
+
+.control-group.error .input-prepend .add-on,
+.control-group.error .input-append .add-on {
+ color: #b94a48;
+ background-color: #f2dede;
+ border-color: #b94a48;
+}
+
+.control-group.success > label,
+.control-group.success .help-block,
+.control-group.success .help-inline {
+ color: #468847;
+}
+
+.control-group.success .checkbox,
+.control-group.success .radio,
+.control-group.success input,
+.control-group.success select,
+.control-group.success textarea {
+ color: #468847;
+ border-color: #468847;
+}
+
+.control-group.success .checkbox:focus,
+.control-group.success .radio:focus,
+.control-group.success input:focus,
+.control-group.success select:focus,
+.control-group.success textarea:focus {
+ border-color: #356635;
+ -webkit-box-shadow: 0 0 6px #7aba7b;
+ -moz-box-shadow: 0 0 6px #7aba7b;
+ box-shadow: 0 0 6px #7aba7b;
+}
+
+.control-group.success .input-prepend .add-on,
+.control-group.success .input-append .add-on {
+ color: #468847;
+ background-color: #dff0d8;
+ border-color: #468847;
+}
+
+input:focus:required:invalid,
+textarea:focus:required:invalid,
+select:focus:required:invalid {
+ color: #b94a48;
+ border-color: #ee5f5b;
+}
+
+input:focus:required:invalid:focus,
+textarea:focus:required:invalid:focus,
+select:focus:required:invalid:focus {
+ border-color: #e9322d;
+ -webkit-box-shadow: 0 0 6px #f8b9b7;
+ -moz-box-shadow: 0 0 6px #f8b9b7;
+ box-shadow: 0 0 6px #f8b9b7;
+}
+
+.form-actions {
+ padding: 17px 20px 18px;
+ margin-top: 18px;
+ margin-bottom: 18px;
+ background-color: #f5f5f5;
+ border-top: 1px solid #e5e5e5;
+ *zoom: 1;
+}
+
+.form-actions:before,
+.form-actions:after {
+ display: table;
+ content: "";
+}
+
+.form-actions:after {
+ clear: both;
+}
+
+.uneditable-input {
+ overflow: hidden;
+ white-space: nowrap;
+ cursor: not-allowed;
+ background-color: #ffffff;
+ border-color: #eee;
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025);
+ -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025);
+}
+
+:-moz-placeholder {
+ color: #999999;
+}
+
+:-ms-input-placeholder {
+ color: #999999;
+}
+
+::-webkit-input-placeholder {
+ color: #999999;
+}
+
+.help-block,
+.help-inline {
+ color: #555555;
+}
+
+.help-block {
+ display: block;
+ margin-bottom: 9px;
+}
+
+.help-inline {
+ display: inline-block;
+ *display: inline;
+ padding-left: 5px;
+ vertical-align: middle;
+ *zoom: 1;
+}
+
+.input-prepend,
+.input-append {
+ margin-bottom: 5px;
+}
+
+.input-prepend input,
+.input-append input,
+.input-prepend select,
+.input-append select,
+.input-prepend .uneditable-input,
+.input-append .uneditable-input {
+ position: relative;
+ margin-bottom: 0;
+ *margin-left: 0;
+ vertical-align: middle;
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.input-prepend input:focus,
+.input-append input:focus,
+.input-prepend select:focus,
+.input-append select:focus,
+.input-prepend .uneditable-input:focus,
+.input-append .uneditable-input:focus {
+ z-index: 2;
+}
+
+.input-prepend .uneditable-input,
+.input-append .uneditable-input {
+ border-left-color: #ccc;
+}
+
+.input-prepend .add-on,
+.input-append .add-on {
+ display: inline-block;
+ width: auto;
+ height: 18px;
+ min-width: 16px;
+ padding: 4px 5px;
+ font-weight: normal;
+ line-height: 18px;
+ text-align: center;
+ text-shadow: 0 1px 0 #ffffff;
+ vertical-align: middle;
+ background-color: #eeeeee;
+ border: 1px solid #ccc;
+}
+
+.input-prepend .add-on,
+.input-append .add-on,
+.input-prepend .btn,
+.input-append .btn {
+ margin-left: -1px;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.input-prepend .active,
+.input-append .active {
+ background-color: #a9dba9;
+ border-color: #46a546;
+}
+
+.input-prepend .add-on,
+.input-prepend .btn {
+ margin-right: -1px;
+}
+
+.input-prepend .add-on:first-child,
+.input-prepend .btn:first-child {
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.input-append input,
+.input-append select,
+.input-append .uneditable-input {
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.input-append .uneditable-input {
+ border-right-color: #ccc;
+ border-left-color: #eee;
+}
+
+.input-append .add-on:last-child,
+.input-append .btn:last-child {
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.input-prepend.input-append input,
+.input-prepend.input-append select,
+.input-prepend.input-append .uneditable-input {
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.input-prepend.input-append .add-on:first-child,
+.input-prepend.input-append .btn:first-child {
+ margin-right: -1px;
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.input-prepend.input-append .add-on:last-child,
+.input-prepend.input-append .btn:last-child {
+ margin-left: -1px;
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.search-query {
+ padding-right: 14px;
+ padding-right: 4px \9;
+ padding-left: 14px;
+ padding-left: 4px \9;
+ /* IE7-8 doesn't have border-radius, so don't indent the padding */
+
+ margin-bottom: 0;
+ -webkit-border-radius: 14px;
+ -moz-border-radius: 14px;
+ border-radius: 14px;
+}
+
+.form-search input,
+.form-inline input,
+.form-horizontal input,
+.form-search textarea,
+.form-inline textarea,
+.form-horizontal textarea,
+.form-search select,
+.form-inline select,
+.form-horizontal select,
+.form-search .help-inline,
+.form-inline .help-inline,
+.form-horizontal .help-inline,
+.form-search .uneditable-input,
+.form-inline .uneditable-input,
+.form-horizontal .uneditable-input,
+.form-search .input-prepend,
+.form-inline .input-prepend,
+.form-horizontal .input-prepend,
+.form-search .input-append,
+.form-inline .input-append,
+.form-horizontal .input-append {
+ display: inline-block;
+ *display: inline;
+ margin-bottom: 0;
+ *zoom: 1;
+}
+
+.form-search .hide,
+.form-inline .hide,
+.form-horizontal .hide {
+ display: none;
+}
+
+.form-search label,
+.form-inline label {
+ display: inline-block;
+}
+
+.form-search .input-append,
+.form-inline .input-append,
+.form-search .input-prepend,
+.form-inline .input-prepend {
+ margin-bottom: 0;
+}
+
+.form-search .radio,
+.form-search .checkbox,
+.form-inline .radio,
+.form-inline .checkbox {
+ padding-left: 0;
+ margin-bottom: 0;
+ vertical-align: middle;
+}
+
+.form-search .radio input[type="radio"],
+.form-search .checkbox input[type="checkbox"],
+.form-inline .radio input[type="radio"],
+.form-inline .checkbox input[type="checkbox"] {
+ float: left;
+ margin-right: 3px;
+ margin-left: 0;
+}
+
+.control-group {
+ margin-bottom: 9px;
+}
+
+legend + .control-group {
+ margin-top: 18px;
+ -webkit-margin-top-collapse: separate;
+}
+
+.form-horizontal .control-group {
+ margin-bottom: 18px;
+ *zoom: 1;
+}
+
+.form-horizontal .control-group:before,
+.form-horizontal .control-group:after {
+ display: table;
+ content: "";
+}
+
+.form-horizontal .control-group:after {
+ clear: both;
+}
+
+.form-horizontal .control-label {
+ float: left;
+ width: 140px;
+ padding-top: 5px;
+ text-align: right;
+}
+
+.form-horizontal .controls {
+ *display: inline-block;
+ *padding-left: 20px;
+ margin-left: 160px;
+ *margin-left: 0;
+}
+
+.form-horizontal .controls:first-child {
+ *padding-left: 160px;
+}
+
+.form-horizontal .help-block {
+ margin-top: 9px;
+ margin-bottom: 0;
+}
+
+.form-horizontal .form-actions {
+ padding-left: 160px;
+}
+
+table {
+ max-width: 100%;
+ background-color: transparent;
+ border-collapse: collapse;
+ border-spacing: 0;
+}
+
+.table {
+ width: 100%;
+ margin-bottom: 18px;
+}
+
+.table th,
+.table td {
+ padding: 8px;
+ line-height: 18px;
+ text-align: left;
+ vertical-align: top;
+ border-top: 1px solid #dddddd;
+}
+
+.table th {
+ font-weight: bold;
+}
+
+.table thead th {
+ vertical-align: bottom;
+}
+
+.table caption + thead tr:first-child th,
+.table caption + thead tr:first-child td,
+.table colgroup + thead tr:first-child th,
+.table colgroup + thead tr:first-child td,
+.table thead:first-child tr:first-child th,
+.table thead:first-child tr:first-child td {
+ border-top: 0;
+}
+
+.table tbody + tbody {
+ border-top: 2px solid #dddddd;
+}
+
+.table-condensed th,
+.table-condensed td {
+ padding: 4px 5px;
+}
+
+.table-bordered {
+ border: 1px solid #dddddd;
+ border-collapse: separate;
+ *border-collapse: collapsed;
+ border-left: 0;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.table-bordered th,
+.table-bordered td {
+ border-left: 1px solid #dddddd;
+}
+
+.table-bordered caption + thead tr:first-child th,
+.table-bordered caption + tbody tr:first-child th,
+.table-bordered caption + tbody tr:first-child td,
+.table-bordered colgroup + thead tr:first-child th,
+.table-bordered colgroup + tbody tr:first-child th,
+.table-bordered colgroup + tbody tr:first-child td,
+.table-bordered thead:first-child tr:first-child th,
+.table-bordered tbody:first-child tr:first-child th,
+.table-bordered tbody:first-child tr:first-child td {
+ border-top: 0;
+}
+
+.table-bordered thead:first-child tr:first-child th:first-child,
+.table-bordered tbody:first-child tr:first-child td:first-child {
+ -webkit-border-top-left-radius: 4px;
+ border-top-left-radius: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.table-bordered thead:first-child tr:first-child th:last-child,
+.table-bordered tbody:first-child tr:first-child td:last-child {
+ -webkit-border-top-right-radius: 4px;
+ border-top-right-radius: 4px;
+ -moz-border-radius-topright: 4px;
+}
+
+.table-bordered thead:last-child tr:last-child th:first-child,
+.table-bordered tbody:last-child tr:last-child td:first-child {
+ -webkit-border-radius: 0 0 0 4px;
+ -moz-border-radius: 0 0 0 4px;
+ border-radius: 0 0 0 4px;
+ -webkit-border-bottom-left-radius: 4px;
+ border-bottom-left-radius: 4px;
+ -moz-border-radius-bottomleft: 4px;
+}
+
+.table-bordered thead:last-child tr:last-child th:last-child,
+.table-bordered tbody:last-child tr:last-child td:last-child {
+ -webkit-border-bottom-right-radius: 4px;
+ border-bottom-right-radius: 4px;
+ -moz-border-radius-bottomright: 4px;
+}
+
+.table-striped tbody tr:nth-child(odd) td,
+.table-striped tbody tr:nth-child(odd) th {
+ background-color: #f9f9f9;
+}
+
+.table tbody tr:hover td,
+.table tbody tr:hover th {
+ background-color: #f5f5f5;
+}
+
+table .span1 {
+ float: none;
+ width: 44px;
+ margin-left: 0;
+}
+
+table .span2 {
+ float: none;
+ width: 124px;
+ margin-left: 0;
+}
+
+table .span3 {
+ float: none;
+ width: 204px;
+ margin-left: 0;
+}
+
+table .span4 {
+ float: none;
+ width: 284px;
+ margin-left: 0;
+}
+
+table .span5 {
+ float: none;
+ width: 364px;
+ margin-left: 0;
+}
+
+table .span6 {
+ float: none;
+ width: 444px;
+ margin-left: 0;
+}
+
+table .span7 {
+ float: none;
+ width: 524px;
+ margin-left: 0;
+}
+
+table .span8 {
+ float: none;
+ width: 604px;
+ margin-left: 0;
+}
+
+table .span9 {
+ float: none;
+ width: 684px;
+ margin-left: 0;
+}
+
+table .span10 {
+ float: none;
+ width: 764px;
+ margin-left: 0;
+}
+
+table .span11 {
+ float: none;
+ width: 844px;
+ margin-left: 0;
+}
+
+table .span12 {
+ float: none;
+ width: 924px;
+ margin-left: 0;
+}
+
+table .span13 {
+ float: none;
+ width: 1004px;
+ margin-left: 0;
+}
+
+table .span14 {
+ float: none;
+ width: 1084px;
+ margin-left: 0;
+}
+
+table .span15 {
+ float: none;
+ width: 1164px;
+ margin-left: 0;
+}
+
+table .span16 {
+ float: none;
+ width: 1244px;
+ margin-left: 0;
+}
+
+table .span17 {
+ float: none;
+ width: 1324px;
+ margin-left: 0;
+}
+
+table .span18 {
+ float: none;
+ width: 1404px;
+ margin-left: 0;
+}
+
+table .span19 {
+ float: none;
+ width: 1484px;
+ margin-left: 0;
+}
+
+table .span20 {
+ float: none;
+ width: 1564px;
+ margin-left: 0;
+}
+
+table .span21 {
+ float: none;
+ width: 1644px;
+ margin-left: 0;
+}
+
+table .span22 {
+ float: none;
+ width: 1724px;
+ margin-left: 0;
+}
+
+table .span23 {
+ float: none;
+ width: 1804px;
+ margin-left: 0;
+}
+
+table .span24 {
+ float: none;
+ width: 1884px;
+ margin-left: 0;
+}
+
+[class^="icon-"],
+[class*=" icon-"] {
+ display: inline-block;
+ width: 14px;
+ height: 14px;
+ *margin-right: .3em;
+ line-height: 14px;
+ vertical-align: text-top;
+ background-image: url("../img/glyphicons-halflings.png");
+ background-position: 14px 14px;
+ background-repeat: no-repeat;
+}
+
+[class^="icon-"]:last-child,
+[class*=" icon-"]:last-child {
+ *margin-left: 0;
+}
+
+.icon-white {
+ background-image: url("../img/glyphicons-halflings-white.png");
+}
+
+.icon-glass {
+ background-position: 0 0;
+}
+
+.icon-music {
+ background-position: -24px 0;
+}
+
+.icon-search {
+ background-position: -48px 0;
+}
+
+.icon-envelope {
+ background-position: -72px 0;
+}
+
+.icon-heart {
+ background-position: -96px 0;
+}
+
+.icon-star {
+ background-position: -120px 0;
+}
+
+.icon-star-empty {
+ background-position: -144px 0;
+}
+
+.icon-user {
+ background-position: -168px 0;
+}
+
+.icon-film {
+ background-position: -192px 0;
+}
+
+.icon-th-large {
+ background-position: -216px 0;
+}
+
+.icon-th {
+ background-position: -240px 0;
+}
+
+.icon-th-list {
+ background-position: -264px 0;
+}
+
+.icon-ok {
+ background-position: -288px 0;
+}
+
+.icon-remove {
+ background-position: -312px 0;
+}
+
+.icon-zoom-in {
+ background-position: -336px 0;
+}
+
+.icon-zoom-out {
+ background-position: -360px 0;
+}
+
+.icon-off {
+ background-position: -384px 0;
+}
+
+.icon-signal {
+ background-position: -408px 0;
+}
+
+.icon-cog {
+ background-position: -432px 0;
+}
+
+.icon-trash {
+ background-position: -456px 0;
+}
+
+.icon-home {
+ background-position: 0 -24px;
+}
+
+.icon-file {
+ background-position: -24px -24px;
+}
+
+.icon-time {
+ background-position: -48px -24px;
+}
+
+.icon-road {
+ background-position: -72px -24px;
+}
+
+.icon-download-alt {
+ background-position: -96px -24px;
+}
+
+.icon-download {
+ background-position: -120px -24px;
+}
+
+.icon-upload {
+ background-position: -144px -24px;
+}
+
+.icon-inbox {
+ background-position: -168px -24px;
+}
+
+.icon-play-circle {
+ background-position: -192px -24px;
+}
+
+.icon-repeat {
+ background-position: -216px -24px;
+}
+
+.icon-refresh {
+ background-position: -240px -24px;
+}
+
+.icon-list-alt {
+ background-position: -264px -24px;
+}
+
+.icon-lock {
+ background-position: -287px -24px;
+}
+
+.icon-flag {
+ background-position: -312px -24px;
+}
+
+.icon-headphones {
+ background-position: -336px -24px;
+}
+
+.icon-volume-off {
+ background-position: -360px -24px;
+}
+
+.icon-volume-down {
+ background-position: -384px -24px;
+}
+
+.icon-volume-up {
+ background-position: -408px -24px;
+}
+
+.icon-qrcode {
+ background-position: -432px -24px;
+}
+
+.icon-barcode {
+ background-position: -456px -24px;
+}
+
+.icon-tag {
+ background-position: 0 -48px;
+}
+
+.icon-tags {
+ background-position: -25px -48px;
+}
+
+.icon-book {
+ background-position: -48px -48px;
+}
+
+.icon-bookmark {
+ background-position: -72px -48px;
+}
+
+.icon-print {
+ background-position: -96px -48px;
+}
+
+.icon-camera {
+ background-position: -120px -48px;
+}
+
+.icon-font {
+ background-position: -144px -48px;
+}
+
+.icon-bold {
+ background-position: -167px -48px;
+}
+
+.icon-italic {
+ background-position: -192px -48px;
+}
+
+.icon-text-height {
+ background-position: -216px -48px;
+}
+
+.icon-text-width {
+ background-position: -240px -48px;
+}
+
+.icon-align-left {
+ background-position: -264px -48px;
+}
+
+.icon-align-center {
+ background-position: -288px -48px;
+}
+
+.icon-align-right {
+ background-position: -312px -48px;
+}
+
+.icon-align-justify {
+ background-position: -336px -48px;
+}
+
+.icon-list {
+ background-position: -360px -48px;
+}
+
+.icon-indent-left {
+ background-position: -384px -48px;
+}
+
+.icon-indent-right {
+ background-position: -408px -48px;
+}
+
+.icon-facetime-video {
+ background-position: -432px -48px;
+}
+
+.icon-picture {
+ background-position: -456px -48px;
+}
+
+.icon-pencil {
+ background-position: 0 -72px;
+}
+
+.icon-map-marker {
+ background-position: -24px -72px;
+}
+
+.icon-adjust {
+ background-position: -48px -72px;
+}
+
+.icon-tint {
+ background-position: -72px -72px;
+}
+
+.icon-edit {
+ background-position: -96px -72px;
+}
+
+.icon-share {
+ background-position: -120px -72px;
+}
+
+.icon-check {
+ background-position: -144px -72px;
+}
+
+.icon-move {
+ background-position: -168px -72px;
+}
+
+.icon-step-backward {
+ background-position: -192px -72px;
+}
+
+.icon-fast-backward {
+ background-position: -216px -72px;
+}
+
+.icon-backward {
+ background-position: -240px -72px;
+}
+
+.icon-play {
+ background-position: -264px -72px;
+}
+
+.icon-pause {
+ background-position: -288px -72px;
+}
+
+.icon-stop {
+ background-position: -312px -72px;
+}
+
+.icon-forward {
+ background-position: -336px -72px;
+}
+
+.icon-fast-forward {
+ background-position: -360px -72px;
+}
+
+.icon-step-forward {
+ background-position: -384px -72px;
+}
+
+.icon-eject {
+ background-position: -408px -72px;
+}
+
+.icon-chevron-left {
+ background-position: -432px -72px;
+}
+
+.icon-chevron-right {
+ background-position: -456px -72px;
+}
+
+.icon-plus-sign {
+ background-position: 0 -96px;
+}
+
+.icon-minus-sign {
+ background-position: -24px -96px;
+}
+
+.icon-remove-sign {
+ background-position: -48px -96px;
+}
+
+.icon-ok-sign {
+ background-position: -72px -96px;
+}
+
+.icon-question-sign {
+ background-position: -96px -96px;
+}
+
+.icon-info-sign {
+ background-position: -120px -96px;
+}
+
+.icon-screenshot {
+ background-position: -144px -96px;
+}
+
+.icon-remove-circle {
+ background-position: -168px -96px;
+}
+
+.icon-ok-circle {
+ background-position: -192px -96px;
+}
+
+.icon-ban-circle {
+ background-position: -216px -96px;
+}
+
+.icon-arrow-left {
+ background-position: -240px -96px;
+}
+
+.icon-arrow-right {
+ background-position: -264px -96px;
+}
+
+.icon-arrow-up {
+ background-position: -289px -96px;
+}
+
+.icon-arrow-down {
+ background-position: -312px -96px;
+}
+
+.icon-share-alt {
+ background-position: -336px -96px;
+}
+
+.icon-resize-full {
+ background-position: -360px -96px;
+}
+
+.icon-resize-small {
+ background-position: -384px -96px;
+}
+
+.icon-plus {
+ background-position: -408px -96px;
+}
+
+.icon-minus {
+ background-position: -433px -96px;
+}
+
+.icon-asterisk {
+ background-position: -456px -96px;
+}
+
+.icon-exclamation-sign {
+ background-position: 0 -120px;
+}
+
+.icon-gift {
+ background-position: -24px -120px;
+}
+
+.icon-leaf {
+ background-position: -48px -120px;
+}
+
+.icon-fire {
+ background-position: -72px -120px;
+}
+
+.icon-eye-open {
+ background-position: -96px -120px;
+}
+
+.icon-eye-close {
+ background-position: -120px -120px;
+}
+
+.icon-warning-sign {
+ background-position: -144px -120px;
+}
+
+.icon-plane {
+ background-position: -168px -120px;
+}
+
+.icon-calendar {
+ background-position: -192px -120px;
+}
+
+.icon-random {
+ background-position: -216px -120px;
+}
+
+.icon-comment {
+ background-position: -240px -120px;
+}
+
+.icon-magnet {
+ background-position: -264px -120px;
+}
+
+.icon-chevron-up {
+ background-position: -288px -120px;
+}
+
+.icon-chevron-down {
+ background-position: -313px -119px;
+}
+
+.icon-retweet {
+ background-position: -336px -120px;
+}
+
+.icon-shopping-cart {
+ background-position: -360px -120px;
+}
+
+.icon-folder-close {
+ background-position: -384px -120px;
+}
+
+.icon-folder-open {
+ background-position: -408px -120px;
+}
+
+.icon-resize-vertical {
+ background-position: -432px -119px;
+}
+
+.icon-resize-horizontal {
+ background-position: -456px -118px;
+}
+
+.icon-hdd {
+ background-position: 0 -144px;
+}
+
+.icon-bullhorn {
+ background-position: -24px -144px;
+}
+
+.icon-bell {
+ background-position: -48px -144px;
+}
+
+.icon-certificate {
+ background-position: -72px -144px;
+}
+
+.icon-thumbs-up {
+ background-position: -96px -144px;
+}
+
+.icon-thumbs-down {
+ background-position: -120px -144px;
+}
+
+.icon-hand-right {
+ background-position: -144px -144px;
+}
+
+.icon-hand-left {
+ background-position: -168px -144px;
+}
+
+.icon-hand-up {
+ background-position: -192px -144px;
+}
+
+.icon-hand-down {
+ background-position: -216px -144px;
+}
+
+.icon-circle-arrow-right {
+ background-position: -240px -144px;
+}
+
+.icon-circle-arrow-left {
+ background-position: -264px -144px;
+}
+
+.icon-circle-arrow-up {
+ background-position: -288px -144px;
+}
+
+.icon-circle-arrow-down {
+ background-position: -312px -144px;
+}
+
+.icon-globe {
+ background-position: -336px -144px;
+}
+
+.icon-wrench {
+ background-position: -360px -144px;
+}
+
+.icon-tasks {
+ background-position: -384px -144px;
+}
+
+.icon-filter {
+ background-position: -408px -144px;
+}
+
+.icon-briefcase {
+ background-position: -432px -144px;
+}
+
+.icon-fullscreen {
+ background-position: -456px -144px;
+}
+
+.dropup,
+.dropdown {
+ position: relative;
+}
+
+.dropdown-toggle {
+ *margin-bottom: -3px;
+}
+
+.dropdown-toggle:active,
+.open .dropdown-toggle {
+ outline: 0;
+}
+
+.caret {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ vertical-align: top;
+ border-top: 4px solid #000000;
+ border-right: 4px solid transparent;
+ border-left: 4px solid transparent;
+ content: "";
+ opacity: 0.3;
+ filter: alpha(opacity=30);
+}
+
+.dropdown .caret {
+ margin-top: 8px;
+ margin-left: 2px;
+}
+
+.dropdown:hover .caret,
+.open .caret {
+ opacity: 1;
+ filter: alpha(opacity=100);
+}
+
+.dropdown-menu {
+ position: absolute;
+ top: 100%;
+ left: 0;
+ z-index: 1000;
+ display: none;
+ float: left;
+ min-width: 160px;
+ padding: 4px 0;
+ margin: 1px 0 0;
+ list-style: none;
+ background-color: #ffffff;
+ border: 1px solid #ccc;
+ border: 1px solid rgba(0, 0, 0, 0.2);
+ *border-right-width: 2px;
+ *border-bottom-width: 2px;
+ -webkit-border-radius: 5px;
+ -moz-border-radius: 5px;
+ border-radius: 5px;
+ -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ -moz-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding;
+ background-clip: padding-box;
+}
+
+.dropdown-menu.pull-right {
+ right: 0;
+ left: auto;
+}
+
+.dropdown-menu .divider {
+ *width: 100%;
+ height: 1px;
+ margin: 8px 1px;
+ *margin: -5px 0 5px;
+ overflow: hidden;
+ background-color: #e5e5e5;
+ border-bottom: 1px solid #ffffff;
+}
+
+.dropdown-menu a {
+ display: block;
+ padding: 3px 15px;
+ clear: both;
+ font-weight: normal;
+ line-height: 18px;
+ color: #333333;
+ white-space: nowrap;
+}
+
+.dropdown-menu li > a:hover,
+.dropdown-menu .active > a,
+.dropdown-menu .active > a:hover {
+ color: #ffffff;
+ text-decoration: none;
+ background-color: #0088cc;
+}
+
+.open {
+ *z-index: 1000;
+}
+
+.open > .dropdown-menu {
+ display: block;
+}
+
+.pull-right > .dropdown-menu {
+ right: 0;
+ left: auto;
+}
+
+.dropup .caret,
+.navbar-fixed-bottom .dropdown .caret {
+ border-top: 0;
+ border-bottom: 4px solid #000000;
+ content: "\2191";
+}
+
+.dropup .dropdown-menu,
+.navbar-fixed-bottom .dropdown .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+ margin-bottom: 1px;
+}
+
+.typeahead {
+ margin-top: 2px;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.well {
+ min-height: 20px;
+ padding: 19px;
+ margin-bottom: 20px;
+ background-color: #f5f5f5;
+ border: 1px solid #eee;
+ border: 1px solid rgba(0, 0, 0, 0.05);
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+}
+
+.well blockquote {
+ border-color: #ddd;
+ border-color: rgba(0, 0, 0, 0.15);
+}
+
+.well-large {
+ padding: 24px;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+}
+
+.well-small {
+ padding: 9px;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+.fade {
+ opacity: 0;
+ -webkit-transition: opacity 0.15s linear;
+ -moz-transition: opacity 0.15s linear;
+ -ms-transition: opacity 0.15s linear;
+ -o-transition: opacity 0.15s linear;
+ transition: opacity 0.15s linear;
+}
+
+.fade.in {
+ opacity: 1;
+}
+
+.collapse {
+ position: relative;
+ height: 0;
+ overflow: hidden;
+ -webkit-transition: height 0.35s ease;
+ -moz-transition: height 0.35s ease;
+ -ms-transition: height 0.35s ease;
+ -o-transition: height 0.35s ease;
+ transition: height 0.35s ease;
+}
+
+.collapse.in {
+ height: auto;
+}
+
+.close {
+ float: right;
+ font-size: 20px;
+ font-weight: bold;
+ line-height: 18px;
+ color: #000000;
+ text-shadow: 0 1px 0 #ffffff;
+ opacity: 0.2;
+ filter: alpha(opacity=20);
+}
+
+.close:hover {
+ color: #000000;
+ text-decoration: none;
+ cursor: pointer;
+ opacity: 0.4;
+ filter: alpha(opacity=40);
+}
+
+button.close {
+ padding: 0;
+ cursor: pointer;
+ background: transparent;
+ border: 0;
+ -webkit-appearance: none;
+}
+
+.btn {
+ display: inline-block;
+ *display: inline;
+ padding: 4px 10px 4px;
+ margin-bottom: 0;
+ *margin-left: .3em;
+ font-size: 13px;
+ line-height: 18px;
+ *line-height: 20px;
+ color: #333333;
+ text-align: center;
+ text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75);
+ vertical-align: middle;
+ cursor: pointer;
+ background-color: #f5f5f5;
+ *background-color: #e6e6e6;
+ background-image: -ms-linear-gradient(top, #ffffff, #e6e6e6);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6));
+ background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6);
+ background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
+ background-image: linear-gradient(top, #ffffff, #e6e6e6);
+ background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6);
+ background-repeat: repeat-x;
+ border: 1px solid #cccccc;
+ *border: 0;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ border-color: #e6e6e6 #e6e6e6 #bfbfbf;
+ border-bottom-color: #b3b3b3;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+ *zoom: 1;
+ -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn:hover,
+.btn:active,
+.btn.active,
+.btn.disabled,
+.btn[disabled] {
+ background-color: #e6e6e6;
+ *background-color: #d9d9d9;
+}
+
+.btn:active,
+.btn.active {
+ background-color: #cccccc \9;
+}
+
+.btn:first-child {
+ *margin-left: 0;
+}
+
+.btn:hover {
+ color: #333333;
+ text-decoration: none;
+ background-color: #e6e6e6;
+ *background-color: #d9d9d9;
+ /* Buttons in IE7 don't get borders, so darken on hover */
+
+ background-position: 0 -15px;
+ -webkit-transition: background-position 0.1s linear;
+ -moz-transition: background-position 0.1s linear;
+ -ms-transition: background-position 0.1s linear;
+ -o-transition: background-position 0.1s linear;
+ transition: background-position 0.1s linear;
+}
+
+.btn:focus {
+ outline: thin dotted #333;
+ outline: 5px auto -webkit-focus-ring-color;
+ outline-offset: -2px;
+}
+
+.btn.active,
+.btn:active {
+ background-color: #e6e6e6;
+ background-color: #d9d9d9 \9;
+ background-image: none;
+ outline: 0;
+ -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn.disabled,
+.btn[disabled] {
+ cursor: default;
+ background-color: #e6e6e6;
+ background-image: none;
+ opacity: 0.65;
+ filter: alpha(opacity=65);
+ -webkit-box-shadow: none;
+ -moz-box-shadow: none;
+ box-shadow: none;
+}
+
+.btn-large {
+ padding: 9px 14px;
+ font-size: 15px;
+ line-height: normal;
+ -webkit-border-radius: 5px;
+ -moz-border-radius: 5px;
+ border-radius: 5px;
+}
+
+.btn-large [class^="icon-"] {
+ margin-top: 1px;
+}
+
+.btn-small {
+ padding: 5px 9px;
+ font-size: 11px;
+ line-height: 16px;
+}
+
+.btn-small [class^="icon-"] {
+ margin-top: -1px;
+}
+
+.btn-mini {
+ padding: 2px 6px;
+ font-size: 11px;
+ line-height: 14px;
+}
+
+.btn-primary,
+.btn-primary:hover,
+.btn-warning,
+.btn-warning:hover,
+.btn-danger,
+.btn-danger:hover,
+.btn-success,
+.btn-success:hover,
+.btn-info,
+.btn-info:hover,
+.btn-inverse,
+.btn-inverse:hover {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.btn-primary.active,
+.btn-warning.active,
+.btn-danger.active,
+.btn-success.active,
+.btn-info.active,
+.btn-inverse.active {
+ color: rgba(255, 255, 255, 0.75);
+}
+
+.btn {
+ border-color: #ccc;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+}
+
+.btn-primary {
+ background-color: #0074cc;
+ *background-color: #0055cc;
+ background-image: -ms-linear-gradient(top, #0088cc, #0055cc);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0055cc));
+ background-image: -webkit-linear-gradient(top, #0088cc, #0055cc);
+ background-image: -o-linear-gradient(top, #0088cc, #0055cc);
+ background-image: -moz-linear-gradient(top, #0088cc, #0055cc);
+ background-image: linear-gradient(top, #0088cc, #0055cc);
+ background-repeat: repeat-x;
+ border-color: #0055cc #0055cc #003580;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#0088cc', endColorstr='#0055cc', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-primary:hover,
+.btn-primary:active,
+.btn-primary.active,
+.btn-primary.disabled,
+.btn-primary[disabled] {
+ background-color: #0055cc;
+ *background-color: #004ab3;
+}
+
+.btn-primary:active,
+.btn-primary.active {
+ background-color: #004099 \9;
+}
+
+.btn-warning {
+ background-color: #faa732;
+ *background-color: #f89406;
+ background-image: -ms-linear-gradient(top, #fbb450, #f89406);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
+ background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
+ background-image: -o-linear-gradient(top, #fbb450, #f89406);
+ background-image: -moz-linear-gradient(top, #fbb450, #f89406);
+ background-image: linear-gradient(top, #fbb450, #f89406);
+ background-repeat: repeat-x;
+ border-color: #f89406 #f89406 #ad6704;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#fbb450', endColorstr='#f89406', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-warning:hover,
+.btn-warning:active,
+.btn-warning.active,
+.btn-warning.disabled,
+.btn-warning[disabled] {
+ background-color: #f89406;
+ *background-color: #df8505;
+}
+
+.btn-warning:active,
+.btn-warning.active {
+ background-color: #c67605 \9;
+}
+
+.btn-danger {
+ background-color: #da4f49;
+ *background-color: #bd362f;
+ background-image: -ms-linear-gradient(top, #ee5f5b, #bd362f);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f));
+ background-image: -webkit-linear-gradient(top, #ee5f5b, #bd362f);
+ background-image: -o-linear-gradient(top, #ee5f5b, #bd362f);
+ background-image: -moz-linear-gradient(top, #ee5f5b, #bd362f);
+ background-image: linear-gradient(top, #ee5f5b, #bd362f);
+ background-repeat: repeat-x;
+ border-color: #bd362f #bd362f #802420;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#bd362f', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-danger:hover,
+.btn-danger:active,
+.btn-danger.active,
+.btn-danger.disabled,
+.btn-danger[disabled] {
+ background-color: #bd362f;
+ *background-color: #a9302a;
+}
+
+.btn-danger:active,
+.btn-danger.active {
+ background-color: #942a25 \9;
+}
+
+.btn-success {
+ background-color: #5bb75b;
+ *background-color: #51a351;
+ background-image: -ms-linear-gradient(top, #62c462, #51a351);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351));
+ background-image: -webkit-linear-gradient(top, #62c462, #51a351);
+ background-image: -o-linear-gradient(top, #62c462, #51a351);
+ background-image: -moz-linear-gradient(top, #62c462, #51a351);
+ background-image: linear-gradient(top, #62c462, #51a351);
+ background-repeat: repeat-x;
+ border-color: #51a351 #51a351 #387038;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#62c462', endColorstr='#51a351', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-success:hover,
+.btn-success:active,
+.btn-success.active,
+.btn-success.disabled,
+.btn-success[disabled] {
+ background-color: #51a351;
+ *background-color: #499249;
+}
+
+.btn-success:active,
+.btn-success.active {
+ background-color: #408140 \9;
+}
+
+.btn-info {
+ background-color: #49afcd;
+ *background-color: #2f96b4;
+ background-image: -ms-linear-gradient(top, #5bc0de, #2f96b4);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4));
+ background-image: -webkit-linear-gradient(top, #5bc0de, #2f96b4);
+ background-image: -o-linear-gradient(top, #5bc0de, #2f96b4);
+ background-image: -moz-linear-gradient(top, #5bc0de, #2f96b4);
+ background-image: linear-gradient(top, #5bc0de, #2f96b4);
+ background-repeat: repeat-x;
+ border-color: #2f96b4 #2f96b4 #1f6377;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#5bc0de', endColorstr='#2f96b4', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-info:hover,
+.btn-info:active,
+.btn-info.active,
+.btn-info.disabled,
+.btn-info[disabled] {
+ background-color: #2f96b4;
+ *background-color: #2a85a0;
+}
+
+.btn-info:active,
+.btn-info.active {
+ background-color: #24748c \9;
+}
+
+.btn-inverse {
+ background-color: #414141;
+ *background-color: #222222;
+ background-image: -ms-linear-gradient(top, #555555, #222222);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#555555), to(#222222));
+ background-image: -webkit-linear-gradient(top, #555555, #222222);
+ background-image: -o-linear-gradient(top, #555555, #222222);
+ background-image: -moz-linear-gradient(top, #555555, #222222);
+ background-image: linear-gradient(top, #555555, #222222);
+ background-repeat: repeat-x;
+ border-color: #222222 #222222 #000000;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#555555', endColorstr='#222222', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+}
+
+.btn-inverse:hover,
+.btn-inverse:active,
+.btn-inverse.active,
+.btn-inverse.disabled,
+.btn-inverse[disabled] {
+ background-color: #222222;
+ *background-color: #151515;
+}
+
+.btn-inverse:active,
+.btn-inverse.active {
+ background-color: #080808 \9;
+}
+
+button.btn,
+input[type="submit"].btn {
+ *padding-top: 2px;
+ *padding-bottom: 2px;
+}
+
+button.btn::-moz-focus-inner,
+input[type="submit"].btn::-moz-focus-inner {
+ padding: 0;
+ border: 0;
+}
+
+button.btn.btn-large,
+input[type="submit"].btn.btn-large {
+ *padding-top: 7px;
+ *padding-bottom: 7px;
+}
+
+button.btn.btn-small,
+input[type="submit"].btn.btn-small {
+ *padding-top: 3px;
+ *padding-bottom: 3px;
+}
+
+button.btn.btn-mini,
+input[type="submit"].btn.btn-mini {
+ *padding-top: 1px;
+ *padding-bottom: 1px;
+}
+
+.btn-group {
+ position: relative;
+ *margin-left: .3em;
+ *zoom: 1;
+}
+
+.btn-group:before,
+.btn-group:after {
+ display: table;
+ content: "";
+}
+
+.btn-group:after {
+ clear: both;
+}
+
+.btn-group:first-child {
+ *margin-left: 0;
+}
+
+.btn-group + .btn-group {
+ margin-left: 5px;
+}
+
+.btn-toolbar {
+ margin-top: 9px;
+ margin-bottom: 9px;
+}
+
+.btn-toolbar .btn-group {
+ display: inline-block;
+ *display: inline;
+ /* IE7 inline-block hack */
+
+ *zoom: 1;
+}
+
+.btn-group > .btn {
+ position: relative;
+ float: left;
+ margin-left: -1px;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.btn-group > .btn:first-child {
+ margin-left: 0;
+ -webkit-border-bottom-left-radius: 4px;
+ border-bottom-left-radius: 4px;
+ -webkit-border-top-left-radius: 4px;
+ border-top-left-radius: 4px;
+ -moz-border-radius-bottomleft: 4px;
+ -moz-border-radius-topleft: 4px;
+}
+
+.btn-group > .btn:last-child,
+.btn-group > .dropdown-toggle {
+ -webkit-border-top-right-radius: 4px;
+ border-top-right-radius: 4px;
+ -webkit-border-bottom-right-radius: 4px;
+ border-bottom-right-radius: 4px;
+ -moz-border-radius-topright: 4px;
+ -moz-border-radius-bottomright: 4px;
+}
+
+.btn-group > .btn.large:first-child {
+ margin-left: 0;
+ -webkit-border-bottom-left-radius: 6px;
+ border-bottom-left-radius: 6px;
+ -webkit-border-top-left-radius: 6px;
+ border-top-left-radius: 6px;
+ -moz-border-radius-bottomleft: 6px;
+ -moz-border-radius-topleft: 6px;
+}
+
+.btn-group > .btn.large:last-child,
+.btn-group > .large.dropdown-toggle {
+ -webkit-border-top-right-radius: 6px;
+ border-top-right-radius: 6px;
+ -webkit-border-bottom-right-radius: 6px;
+ border-bottom-right-radius: 6px;
+ -moz-border-radius-topright: 6px;
+ -moz-border-radius-bottomright: 6px;
+}
+
+.btn-group > .btn:hover,
+.btn-group > .btn:focus,
+.btn-group > .btn:active,
+.btn-group > .btn.active {
+ z-index: 2;
+}
+
+.btn-group .dropdown-toggle:active,
+.btn-group.open .dropdown-toggle {
+ outline: 0;
+}
+
+.btn-group > .dropdown-toggle {
+ *padding-top: 4px;
+ padding-right: 8px;
+ *padding-bottom: 4px;
+ padding-left: 8px;
+ -webkit-box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn-group > .btn-mini.dropdown-toggle {
+ padding-right: 5px;
+ padding-left: 5px;
+}
+
+.btn-group > .btn-small.dropdown-toggle {
+ *padding-top: 4px;
+ *padding-bottom: 4px;
+}
+
+.btn-group > .btn-large.dropdown-toggle {
+ padding-right: 12px;
+ padding-left: 12px;
+}
+
+.btn-group.open .dropdown-toggle {
+ background-image: none;
+ -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.btn-group.open .btn.dropdown-toggle {
+ background-color: #e6e6e6;
+}
+
+.btn-group.open .btn-primary.dropdown-toggle {
+ background-color: #0055cc;
+}
+
+.btn-group.open .btn-warning.dropdown-toggle {
+ background-color: #f89406;
+}
+
+.btn-group.open .btn-danger.dropdown-toggle {
+ background-color: #bd362f;
+}
+
+.btn-group.open .btn-success.dropdown-toggle {
+ background-color: #51a351;
+}
+
+.btn-group.open .btn-info.dropdown-toggle {
+ background-color: #2f96b4;
+}
+
+.btn-group.open .btn-inverse.dropdown-toggle {
+ background-color: #222222;
+}
+
+.btn .caret {
+ margin-top: 7px;
+ margin-left: 0;
+}
+
+.btn:hover .caret,
+.open.btn-group .caret {
+ opacity: 1;
+ filter: alpha(opacity=100);
+}
+
+.btn-mini .caret {
+ margin-top: 5px;
+}
+
+.btn-small .caret {
+ margin-top: 6px;
+}
+
+.btn-large .caret {
+ margin-top: 6px;
+ border-top-width: 5px;
+ border-right-width: 5px;
+ border-left-width: 5px;
+}
+
+.dropup .btn-large .caret {
+ border-top: 0;
+ border-bottom: 5px solid #000000;
+}
+
+.btn-primary .caret,
+.btn-warning .caret,
+.btn-danger .caret,
+.btn-info .caret,
+.btn-success .caret,
+.btn-inverse .caret {
+ border-top-color: #ffffff;
+ border-bottom-color: #ffffff;
+ opacity: 0.75;
+ filter: alpha(opacity=75);
+}
+
+.alert {
+ padding: 8px 35px 8px 14px;
+ margin-bottom: 18px;
+ color: #c09853;
+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
+ background-color: #fcf8e3;
+ border: 1px solid #fbeed5;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.alert-heading {
+ color: inherit;
+}
+
+.alert .close {
+ position: relative;
+ top: -2px;
+ right: -21px;
+ line-height: 18px;
+}
+
+.alert-success {
+ color: #468847;
+ background-color: #dff0d8;
+ border-color: #d6e9c6;
+}
+
+.alert-danger,
+.alert-error {
+ color: #b94a48;
+ background-color: #f2dede;
+ border-color: #eed3d7;
+}
+
+.alert-info {
+ color: #3a87ad;
+ background-color: #d9edf7;
+ border-color: #bce8f1;
+}
+
+.alert-block {
+ padding-top: 14px;
+ padding-bottom: 14px;
+}
+
+.alert-block > p,
+.alert-block > ul {
+ margin-bottom: 0;
+}
+
+.alert-block p + p {
+ margin-top: 5px;
+}
+
+.nav {
+ margin-bottom: 18px;
+ margin-left: 0;
+ list-style: none;
+}
+
+.nav > li > a {
+ display: block;
+}
+
+.nav > li > a:hover {
+ text-decoration: none;
+ background-color: #eeeeee;
+}
+
+.nav > .pull-right {
+ float: right;
+}
+
+.nav .nav-header {
+ display: block;
+ padding: 3px 15px;
+ font-size: 11px;
+ font-weight: bold;
+ line-height: 18px;
+ color: #999999;
+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
+ text-transform: uppercase;
+}
+
+.nav li + .nav-header {
+ margin-top: 9px;
+}
+
+.nav-list {
+ padding-right: 15px;
+ padding-left: 15px;
+ margin-bottom: 0;
+}
+
+.nav-list > li > a,
+.nav-list .nav-header {
+ margin-right: -15px;
+ margin-left: -15px;
+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
+}
+
+.nav-list > li > a {
+ padding: 3px 15px;
+}
+
+.nav-list > .active > a,
+.nav-list > .active > a:hover {
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.2);
+ background-color: #0088cc;
+}
+
+.nav-list [class^="icon-"] {
+ margin-right: 2px;
+}
+
+.nav-list .divider {
+ *width: 100%;
+ height: 1px;
+ margin: 8px 1px;
+ *margin: -5px 0 5px;
+ overflow: hidden;
+ background-color: #e5e5e5;
+ border-bottom: 1px solid #ffffff;
+}
+
+.nav-tabs,
+.nav-pills {
+ *zoom: 1;
+}
+
+.nav-tabs:before,
+.nav-pills:before,
+.nav-tabs:after,
+.nav-pills:after {
+ display: table;
+ content: "";
+}
+
+.nav-tabs:after,
+.nav-pills:after {
+ clear: both;
+}
+
+.nav-tabs > li,
+.nav-pills > li {
+ float: left;
+}
+
+.nav-tabs > li > a,
+.nav-pills > li > a {
+ padding-right: 12px;
+ padding-left: 12px;
+ margin-right: 2px;
+ line-height: 14px;
+}
+
+.nav-tabs {
+ border-bottom: 1px solid #ddd;
+}
+
+.nav-tabs > li {
+ margin-bottom: -1px;
+}
+
+.nav-tabs > li > a {
+ padding-top: 8px;
+ padding-bottom: 8px;
+ line-height: 18px;
+ border: 1px solid transparent;
+ -webkit-border-radius: 4px 4px 0 0;
+ -moz-border-radius: 4px 4px 0 0;
+ border-radius: 4px 4px 0 0;
+}
+
+.nav-tabs > li > a:hover {
+ border-color: #eeeeee #eeeeee #dddddd;
+}
+
+.nav-tabs > .active > a,
+.nav-tabs > .active > a:hover {
+ color: #555555;
+ cursor: default;
+ background-color: #ffffff;
+ border: 1px solid #ddd;
+ border-bottom-color: transparent;
+}
+
+.nav-pills > li > a {
+ padding-top: 8px;
+ padding-bottom: 8px;
+ margin-top: 2px;
+ margin-bottom: 2px;
+ -webkit-border-radius: 5px;
+ -moz-border-radius: 5px;
+ border-radius: 5px;
+}
+
+.nav-pills > .active > a,
+.nav-pills > .active > a:hover {
+ color: #ffffff;
+ background-color: #0088cc;
+}
+
+.nav-stacked > li {
+ float: none;
+}
+
+.nav-stacked > li > a {
+ margin-right: 0;
+}
+
+.nav-tabs.nav-stacked {
+ border-bottom: 0;
+}
+
+.nav-tabs.nav-stacked > li > a {
+ border: 1px solid #ddd;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.nav-tabs.nav-stacked > li:first-child > a {
+ -webkit-border-radius: 4px 4px 0 0;
+ -moz-border-radius: 4px 4px 0 0;
+ border-radius: 4px 4px 0 0;
+}
+
+.nav-tabs.nav-stacked > li:last-child > a {
+ -webkit-border-radius: 0 0 4px 4px;
+ -moz-border-radius: 0 0 4px 4px;
+ border-radius: 0 0 4px 4px;
+}
+
+.nav-tabs.nav-stacked > li > a:hover {
+ z-index: 2;
+ border-color: #ddd;
+}
+
+.nav-pills.nav-stacked > li > a {
+ margin-bottom: 3px;
+}
+
+.nav-pills.nav-stacked > li:last-child > a {
+ margin-bottom: 1px;
+}
+
+.nav-tabs .dropdown-menu {
+ -webkit-border-radius: 0 0 5px 5px;
+ -moz-border-radius: 0 0 5px 5px;
+ border-radius: 0 0 5px 5px;
+}
+
+.nav-pills .dropdown-menu {
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.nav-tabs .dropdown-toggle .caret,
+.nav-pills .dropdown-toggle .caret {
+ margin-top: 6px;
+ border-top-color: #0088cc;
+ border-bottom-color: #0088cc;
+}
+
+.nav-tabs .dropdown-toggle:hover .caret,
+.nav-pills .dropdown-toggle:hover .caret {
+ border-top-color: #005580;
+ border-bottom-color: #005580;
+}
+
+.nav-tabs .active .dropdown-toggle .caret,
+.nav-pills .active .dropdown-toggle .caret {
+ border-top-color: #333333;
+ border-bottom-color: #333333;
+}
+
+.nav > .dropdown.active > a:hover {
+ color: #000000;
+ cursor: pointer;
+}
+
+.nav-tabs .open .dropdown-toggle,
+.nav-pills .open .dropdown-toggle,
+.nav > li.dropdown.open.active > a:hover {
+ color: #ffffff;
+ background-color: #999999;
+ border-color: #999999;
+}
+
+.nav li.dropdown.open .caret,
+.nav li.dropdown.open.active .caret,
+.nav li.dropdown.open a:hover .caret {
+ border-top-color: #ffffff;
+ border-bottom-color: #ffffff;
+ opacity: 1;
+ filter: alpha(opacity=100);
+}
+
+.tabs-stacked .open > a:hover {
+ border-color: #999999;
+}
+
+.tabbable {
+ *zoom: 1;
+}
+
+.tabbable:before,
+.tabbable:after {
+ display: table;
+ content: "";
+}
+
+.tabbable:after {
+ clear: both;
+}
+
+.tab-content {
+ overflow: auto;
+}
+
+.tabs-below > .nav-tabs,
+.tabs-right > .nav-tabs,
+.tabs-left > .nav-tabs {
+ border-bottom: 0;
+}
+
+.tab-content > .tab-pane,
+.pill-content > .pill-pane {
+ display: none;
+}
+
+.tab-content > .active,
+.pill-content > .active {
+ display: block;
+}
+
+.tabs-below > .nav-tabs {
+ border-top: 1px solid #ddd;
+}
+
+.tabs-below > .nav-tabs > li {
+ margin-top: -1px;
+ margin-bottom: 0;
+}
+
+.tabs-below > .nav-tabs > li > a {
+ -webkit-border-radius: 0 0 4px 4px;
+ -moz-border-radius: 0 0 4px 4px;
+ border-radius: 0 0 4px 4px;
+}
+
+.tabs-below > .nav-tabs > li > a:hover {
+ border-top-color: #ddd;
+ border-bottom-color: transparent;
+}
+
+.tabs-below > .nav-tabs > .active > a,
+.tabs-below > .nav-tabs > .active > a:hover {
+ border-color: transparent #ddd #ddd #ddd;
+}
+
+.tabs-left > .nav-tabs > li,
+.tabs-right > .nav-tabs > li {
+ float: none;
+}
+
+.tabs-left > .nav-tabs > li > a,
+.tabs-right > .nav-tabs > li > a {
+ min-width: 74px;
+ margin-right: 0;
+ margin-bottom: 3px;
+}
+
+.tabs-left > .nav-tabs {
+ float: left;
+ margin-right: 19px;
+ border-right: 1px solid #ddd;
+}
+
+.tabs-left > .nav-tabs > li > a {
+ margin-right: -1px;
+ -webkit-border-radius: 4px 0 0 4px;
+ -moz-border-radius: 4px 0 0 4px;
+ border-radius: 4px 0 0 4px;
+}
+
+.tabs-left > .nav-tabs > li > a:hover {
+ border-color: #eeeeee #dddddd #eeeeee #eeeeee;
+}
+
+.tabs-left > .nav-tabs .active > a,
+.tabs-left > .nav-tabs .active > a:hover {
+ border-color: #ddd transparent #ddd #ddd;
+ *border-right-color: #ffffff;
+}
+
+.tabs-right > .nav-tabs {
+ float: right;
+ margin-left: 19px;
+ border-left: 1px solid #ddd;
+}
+
+.tabs-right > .nav-tabs > li > a {
+ margin-left: -1px;
+ -webkit-border-radius: 0 4px 4px 0;
+ -moz-border-radius: 0 4px 4px 0;
+ border-radius: 0 4px 4px 0;
+}
+
+.tabs-right > .nav-tabs > li > a:hover {
+ border-color: #eeeeee #eeeeee #eeeeee #dddddd;
+}
+
+.tabs-right > .nav-tabs .active > a,
+.tabs-right > .nav-tabs .active > a:hover {
+ border-color: #ddd #ddd #ddd transparent;
+ *border-left-color: #ffffff;
+}
+
+.navbar {
+ *position: relative;
+ *z-index: 2;
+ margin-bottom: 18px;
+ overflow: visible;
+}
+
+.navbar-inner {
+ min-height: 40px;
+ padding-right: 20px;
+ padding-left: 20px;
+ background-color: #2c2c2c;
+ background-image: -moz-linear-gradient(top, #333333, #222222);
+ background-image: -ms-linear-gradient(top, #333333, #222222);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#333333), to(#222222));
+ background-image: -webkit-linear-gradient(top, #333333, #222222);
+ background-image: -o-linear-gradient(top, #333333, #222222);
+ background-image: linear-gradient(top, #333333, #222222);
+ background-repeat: repeat-x;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0);
+ -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1);
+ -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1);
+ box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1);
+}
+
+.navbar .container {
+ width: auto;
+}
+
+.nav-collapse.collapse {
+ height: auto;
+}
+
+.navbar {
+ color: #999999;
+}
+
+.navbar .brand:hover {
+ text-decoration: none;
+}
+
+.navbar .brand {
+ display: block;
+ float: left;
+ padding: 8px 20px 12px;
+ margin-left: -20px;
+ font-size: 20px;
+ font-weight: 200;
+ line-height: 1;
+ color: #999999;
+}
+
+.navbar .navbar-text {
+ margin-bottom: 0;
+ line-height: 40px;
+}
+
+.navbar .navbar-link {
+ color: #999999;
+}
+
+.navbar .navbar-link:hover {
+ color: #ffffff;
+}
+
+.navbar .btn,
+.navbar .btn-group {
+ margin-top: 5px;
+}
+
+.navbar .btn-group .btn {
+ margin: 0;
+}
+
+.navbar-form {
+ margin-bottom: 0;
+ *zoom: 1;
+}
+
+.navbar-form:before,
+.navbar-form:after {
+ display: table;
+ content: "";
+}
+
+.navbar-form:after {
+ clear: both;
+}
+
+.navbar-form input,
+.navbar-form select,
+.navbar-form .radio,
+.navbar-form .checkbox {
+ margin-top: 5px;
+}
+
+.navbar-form input,
+.navbar-form select {
+ display: inline-block;
+ margin-bottom: 0;
+}
+
+.navbar-form input[type="image"],
+.navbar-form input[type="checkbox"],
+.navbar-form input[type="radio"] {
+ margin-top: 3px;
+}
+
+.navbar-form .input-append,
+.navbar-form .input-prepend {
+ margin-top: 6px;
+ white-space: nowrap;
+}
+
+.navbar-form .input-append input,
+.navbar-form .input-prepend input {
+ margin-top: 0;
+}
+
+.navbar-search {
+ position: relative;
+ float: left;
+ margin-top: 6px;
+ margin-bottom: 0;
+}
+
+.navbar-search .search-query {
+ padding: 4px 9px;
+ font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+ font-size: 13px;
+ font-weight: normal;
+ line-height: 1;
+ color: #ffffff;
+ background-color: #626262;
+ border: 1px solid #151515;
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0 rgba(255, 255, 255, 0.15);
+ -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0 rgba(255, 255, 255, 0.15);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0 rgba(255, 255, 255, 0.15);
+ -webkit-transition: none;
+ -moz-transition: none;
+ -ms-transition: none;
+ -o-transition: none;
+ transition: none;
+}
+
+.navbar-search .search-query:-moz-placeholder {
+ color: #cccccc;
+}
+
+.navbar-search .search-query:-ms-input-placeholder {
+ color: #cccccc;
+}
+
+.navbar-search .search-query::-webkit-input-placeholder {
+ color: #cccccc;
+}
+
+.navbar-search .search-query:focus,
+.navbar-search .search-query.focused {
+ padding: 5px 10px;
+ color: #333333;
+ text-shadow: 0 1px 0 #ffffff;
+ background-color: #ffffff;
+ border: 0;
+ outline: 0;
+ -webkit-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15);
+ -moz-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15);
+ box-shadow: 0 0 3px rgba(0, 0, 0, 0.15);
+}
+
+.navbar-fixed-top,
+.navbar-fixed-bottom {
+ position: fixed;
+ right: 0;
+ left: 0;
+ z-index: 1030;
+ margin-bottom: 0;
+}
+
+.navbar-fixed-top .navbar-inner,
+.navbar-fixed-bottom .navbar-inner {
+ padding-right: 0;
+ padding-left: 0;
+ -webkit-border-radius: 0;
+ -moz-border-radius: 0;
+ border-radius: 0;
+}
+
+.navbar-fixed-top .container,
+.navbar-fixed-bottom .container {
+ width: 940px;
+}
+
+.navbar-fixed-top {
+ top: 0;
+}
+
+.navbar-fixed-bottom {
+ bottom: 0;
+}
+
+.navbar .nav {
+ position: relative;
+ left: 0;
+ display: block;
+ float: left;
+ margin: 0 10px 0 0;
+}
+
+.navbar .nav.pull-right {
+ float: right;
+}
+
+.navbar .nav > li {
+ display: block;
+ float: left;
+}
+
+.navbar .nav > li > a {
+ float: none;
+ padding: 9px 10px 11px;
+ line-height: 19px;
+ color: #999999;
+ text-decoration: none;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.navbar .btn {
+ display: inline-block;
+ padding: 4px 10px 4px;
+ margin: 5px 5px 6px;
+ line-height: 18px;
+}
+
+.navbar .btn-group {
+ padding: 5px 5px 6px;
+ margin: 0;
+}
+
+.navbar .nav > li > a:hover {
+ color: #ffffff;
+ text-decoration: none;
+ background-color: transparent;
+}
+
+.navbar .nav .active > a,
+.navbar .nav .active > a:hover {
+ color: #ffffff;
+ text-decoration: none;
+ background-color: #222222;
+}
+
+.navbar .divider-vertical {
+ width: 1px;
+ height: 40px;
+ margin: 0 9px;
+ overflow: hidden;
+ background-color: #222222;
+ border-right: 1px solid #333333;
+}
+
+.navbar .nav.pull-right {
+ margin-right: 0;
+ margin-left: 10px;
+}
+
+.navbar .btn-navbar {
+ display: none;
+ float: right;
+ padding: 7px 10px;
+ margin-right: 5px;
+ margin-left: 5px;
+ background-color: #2c2c2c;
+ *background-color: #222222;
+ background-image: -ms-linear-gradient(top, #333333, #222222);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#333333), to(#222222));
+ background-image: -webkit-linear-gradient(top, #333333, #222222);
+ background-image: -o-linear-gradient(top, #333333, #222222);
+ background-image: linear-gradient(top, #333333, #222222);
+ background-image: -moz-linear-gradient(top, #333333, #222222);
+ background-repeat: repeat-x;
+ border-color: #222222 #222222 #000000;
+ border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0);
+ filter: progid:dximagetransform.microsoft.gradient(enabled=false);
+ -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075);
+ -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075);
+ box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075);
+}
+
+.navbar .btn-navbar:hover,
+.navbar .btn-navbar:active,
+.navbar .btn-navbar.active,
+.navbar .btn-navbar.disabled,
+.navbar .btn-navbar[disabled] {
+ background-color: #222222;
+ *background-color: #151515;
+}
+
+.navbar .btn-navbar:active,
+.navbar .btn-navbar.active {
+ background-color: #080808 \9;
+}
+
+.navbar .btn-navbar .icon-bar {
+ display: block;
+ width: 18px;
+ height: 2px;
+ background-color: #f5f5f5;
+ -webkit-border-radius: 1px;
+ -moz-border-radius: 1px;
+ border-radius: 1px;
+ -webkit-box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25);
+ -moz-box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25);
+ box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.btn-navbar .icon-bar + .icon-bar {
+ margin-top: 3px;
+}
+
+.navbar .dropdown-menu:before {
+ position: absolute;
+ top: -7px;
+ left: 9px;
+ display: inline-block;
+ border-right: 7px solid transparent;
+ border-bottom: 7px solid #ccc;
+ border-left: 7px solid transparent;
+ border-bottom-color: rgba(0, 0, 0, 0.2);
+ content: '';
+}
+
+.navbar .dropdown-menu:after {
+ position: absolute;
+ top: -6px;
+ left: 10px;
+ display: inline-block;
+ border-right: 6px solid transparent;
+ border-bottom: 6px solid #ffffff;
+ border-left: 6px solid transparent;
+ content: '';
+}
+
+.navbar-fixed-bottom .dropdown-menu:before {
+ top: auto;
+ bottom: -7px;
+ border-top: 7px solid #ccc;
+ border-bottom: 0;
+ border-top-color: rgba(0, 0, 0, 0.2);
+}
+
+.navbar-fixed-bottom .dropdown-menu:after {
+ top: auto;
+ bottom: -6px;
+ border-top: 6px solid #ffffff;
+ border-bottom: 0;
+}
+
+.navbar .nav li.dropdown .dropdown-toggle .caret,
+.navbar .nav li.dropdown.open .caret {
+ border-top-color: #ffffff;
+ border-bottom-color: #ffffff;
+}
+
+.navbar .nav li.dropdown.active .caret {
+ opacity: 1;
+ filter: alpha(opacity=100);
+}
+
+.navbar .nav li.dropdown.open > .dropdown-toggle,
+.navbar .nav li.dropdown.active > .dropdown-toggle,
+.navbar .nav li.dropdown.open.active > .dropdown-toggle {
+ background-color: transparent;
+}
+
+.navbar .nav li.dropdown.active > .dropdown-toggle:hover {
+ color: #ffffff;
+}
+
+.navbar .pull-right .dropdown-menu,
+.navbar .dropdown-menu.pull-right {
+ right: 0;
+ left: auto;
+}
+
+.navbar .pull-right .dropdown-menu:before,
+.navbar .dropdown-menu.pull-right:before {
+ right: 12px;
+ left: auto;
+}
+
+.navbar .pull-right .dropdown-menu:after,
+.navbar .dropdown-menu.pull-right:after {
+ right: 13px;
+ left: auto;
+}
+
+.breadcrumb {
+ padding: 7px 14px;
+ margin: 0 0 18px;
+ list-style: none;
+ background-color: #fbfbfb;
+ background-image: -moz-linear-gradient(top, #ffffff, #f5f5f5);
+ background-image: -ms-linear-gradient(top, #ffffff, #f5f5f5);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#f5f5f5));
+ background-image: -webkit-linear-gradient(top, #ffffff, #f5f5f5);
+ background-image: -o-linear-gradient(top, #ffffff, #f5f5f5);
+ background-image: linear-gradient(top, #ffffff, #f5f5f5);
+ background-repeat: repeat-x;
+ border: 1px solid #ddd;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ffffff', endColorstr='#f5f5f5', GradientType=0);
+ -webkit-box-shadow: inset 0 1px 0 #ffffff;
+ -moz-box-shadow: inset 0 1px 0 #ffffff;
+ box-shadow: inset 0 1px 0 #ffffff;
+}
+
+.breadcrumb li {
+ display: inline-block;
+ *display: inline;
+ text-shadow: 0 1px 0 #ffffff;
+ *zoom: 1;
+}
+
+.breadcrumb .divider {
+ padding: 0 5px;
+ color: #999999;
+}
+
+.breadcrumb .active a {
+ color: #333333;
+}
+
+.pagination {
+ height: 36px;
+ margin: 18px 0;
+}
+
+.pagination ul {
+ display: inline-block;
+ *display: inline;
+ margin-bottom: 0;
+ margin-left: 0;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+ *zoom: 1;
+ -webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
+ -moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
+ box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05);
+}
+
+.pagination li {
+ display: inline;
+}
+
+.pagination a {
+ float: left;
+ padding: 0 14px;
+ line-height: 34px;
+ text-decoration: none;
+ border: 1px solid #ddd;
+ border-left-width: 0;
+}
+
+.pagination a:hover,
+.pagination .active a {
+ background-color: #f5f5f5;
+}
+
+.pagination .active a {
+ color: #999999;
+ cursor: default;
+}
+
+.pagination .disabled span,
+.pagination .disabled a,
+.pagination .disabled a:hover {
+ color: #999999;
+ cursor: default;
+ background-color: transparent;
+}
+
+.pagination li:first-child a {
+ border-left-width: 1px;
+ -webkit-border-radius: 3px 0 0 3px;
+ -moz-border-radius: 3px 0 0 3px;
+ border-radius: 3px 0 0 3px;
+}
+
+.pagination li:last-child a {
+ -webkit-border-radius: 0 3px 3px 0;
+ -moz-border-radius: 0 3px 3px 0;
+ border-radius: 0 3px 3px 0;
+}
+
+.pagination-centered {
+ text-align: center;
+}
+
+.pagination-right {
+ text-align: right;
+}
+
+.pager {
+ margin-bottom: 18px;
+ margin-left: 0;
+ text-align: center;
+ list-style: none;
+ *zoom: 1;
+}
+
+.pager:before,
+.pager:after {
+ display: table;
+ content: "";
+}
+
+.pager:after {
+ clear: both;
+}
+
+.pager li {
+ display: inline;
+}
+
+.pager a {
+ display: inline-block;
+ padding: 5px 14px;
+ background-color: #fff;
+ border: 1px solid #ddd;
+ -webkit-border-radius: 15px;
+ -moz-border-radius: 15px;
+ border-radius: 15px;
+}
+
+.pager a:hover {
+ text-decoration: none;
+ background-color: #f5f5f5;
+}
+
+.pager .next a {
+ float: right;
+}
+
+.pager .previous a {
+ float: left;
+}
+
+.pager .disabled a,
+.pager .disabled a:hover {
+ color: #999999;
+ cursor: default;
+ background-color: #fff;
+}
+
+.modal-open .dropdown-menu {
+ z-index: 2050;
+}
+
+.modal-open .dropdown.open {
+ *z-index: 2050;
+}
+
+.modal-open .popover {
+ z-index: 2060;
+}
+
+.modal-open .tooltip {
+ z-index: 2070;
+}
+
+.modal-backdrop {
+ position: fixed;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: 1040;
+ background-color: #000000;
+}
+
+.modal-backdrop.fade {
+ opacity: 0;
+}
+
+.modal-backdrop,
+.modal-backdrop.fade.in {
+ opacity: 0.8;
+ filter: alpha(opacity=80);
+}
+
+.modal {
+ position: fixed;
+ top: 50%;
+ left: 50%;
+ z-index: 1050;
+ width: 560px;
+ margin: -250px 0 0 -280px;
+ overflow: auto;
+ background-color: #ffffff;
+ border: 1px solid #999;
+ border: 1px solid rgba(0, 0, 0, 0.3);
+ *border: 1px solid #999;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+ -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding-box;
+ background-clip: padding-box;
+}
+
+.modal.fade {
+ top: -25%;
+ -webkit-transition: opacity 0.3s linear, top 0.3s ease-out;
+ -moz-transition: opacity 0.3s linear, top 0.3s ease-out;
+ -ms-transition: opacity 0.3s linear, top 0.3s ease-out;
+ -o-transition: opacity 0.3s linear, top 0.3s ease-out;
+ transition: opacity 0.3s linear, top 0.3s ease-out;
+}
+
+.modal.fade.in {
+ top: 50%;
+}
+
+.modal-header {
+ padding: 9px 15px;
+ border-bottom: 1px solid #eee;
+}
+
+.modal-header .close {
+ margin-top: 2px;
+}
+
+.modal-body {
+ max-height: 400px;
+ padding: 15px;
+ overflow-y: auto;
+}
+
+.modal-form {
+ margin-bottom: 0;
+}
+
+.modal-footer {
+ padding: 14px 15px 15px;
+ margin-bottom: 0;
+ text-align: right;
+ background-color: #f5f5f5;
+ border-top: 1px solid #ddd;
+ -webkit-border-radius: 0 0 6px 6px;
+ -moz-border-radius: 0 0 6px 6px;
+ border-radius: 0 0 6px 6px;
+ *zoom: 1;
+ -webkit-box-shadow: inset 0 1px 0 #ffffff;
+ -moz-box-shadow: inset 0 1px 0 #ffffff;
+ box-shadow: inset 0 1px 0 #ffffff;
+}
+
+.modal-footer:before,
+.modal-footer:after {
+ display: table;
+ content: "";
+}
+
+.modal-footer:after {
+ clear: both;
+}
+
+.modal-footer .btn + .btn {
+ margin-bottom: 0;
+ margin-left: 5px;
+}
+
+.modal-footer .btn-group .btn + .btn {
+ margin-left: -1px;
+}
+
+.tooltip {
+ position: absolute;
+ z-index: 1020;
+ display: block;
+ padding: 5px;
+ font-size: 11px;
+ opacity: 0;
+ filter: alpha(opacity=0);
+ visibility: visible;
+}
+
+.tooltip.in {
+ opacity: 0.8;
+ filter: alpha(opacity=80);
+}
+
+.tooltip.top {
+ margin-top: -2px;
+}
+
+.tooltip.right {
+ margin-left: 2px;
+}
+
+.tooltip.bottom {
+ margin-top: 2px;
+}
+
+.tooltip.left {
+ margin-left: -2px;
+}
+
+.tooltip.top .tooltip-arrow {
+ bottom: 0;
+ left: 50%;
+ margin-left: -5px;
+ border-top: 5px solid #000000;
+ border-right: 5px solid transparent;
+ border-left: 5px solid transparent;
+}
+
+.tooltip.left .tooltip-arrow {
+ top: 50%;
+ right: 0;
+ margin-top: -5px;
+ border-top: 5px solid transparent;
+ border-bottom: 5px solid transparent;
+ border-left: 5px solid #000000;
+}
+
+.tooltip.bottom .tooltip-arrow {
+ top: 0;
+ left: 50%;
+ margin-left: -5px;
+ border-right: 5px solid transparent;
+ border-bottom: 5px solid #000000;
+ border-left: 5px solid transparent;
+}
+
+.tooltip.right .tooltip-arrow {
+ top: 50%;
+ left: 0;
+ margin-top: -5px;
+ border-top: 5px solid transparent;
+ border-right: 5px solid #000000;
+ border-bottom: 5px solid transparent;
+}
+
+.tooltip-inner {
+ max-width: 200px;
+ padding: 3px 8px;
+ color: #ffffff;
+ text-align: center;
+ text-decoration: none;
+ background-color: #000000;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.tooltip-arrow {
+ position: absolute;
+ width: 0;
+ height: 0;
+}
+
+.popover {
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: 1010;
+ display: none;
+ padding: 5px;
+}
+
+.popover.top {
+ margin-top: -5px;
+}
+
+.popover.right {
+ margin-left: 5px;
+}
+
+.popover.bottom {
+ margin-top: 5px;
+}
+
+.popover.left {
+ margin-left: -5px;
+}
+
+.popover.top .arrow {
+ bottom: 0;
+ left: 50%;
+ margin-left: -5px;
+ border-top: 5px solid #000000;
+ border-right: 5px solid transparent;
+ border-left: 5px solid transparent;
+}
+
+.popover.right .arrow {
+ top: 50%;
+ left: 0;
+ margin-top: -5px;
+ border-top: 5px solid transparent;
+ border-right: 5px solid #000000;
+ border-bottom: 5px solid transparent;
+}
+
+.popover.bottom .arrow {
+ top: 0;
+ left: 50%;
+ margin-left: -5px;
+ border-right: 5px solid transparent;
+ border-bottom: 5px solid #000000;
+ border-left: 5px solid transparent;
+}
+
+.popover.left .arrow {
+ top: 50%;
+ right: 0;
+ margin-top: -5px;
+ border-top: 5px solid transparent;
+ border-bottom: 5px solid transparent;
+ border-left: 5px solid #000000;
+}
+
+.popover .arrow {
+ position: absolute;
+ width: 0;
+ height: 0;
+}
+
+.popover-inner {
+ width: 280px;
+ padding: 3px;
+ overflow: hidden;
+ background: #000000;
+ background: rgba(0, 0, 0, 0.8);
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+ -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+ box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3);
+}
+
+.popover-title {
+ padding: 9px 15px;
+ line-height: 1;
+ background-color: #f5f5f5;
+ border-bottom: 1px solid #eee;
+ -webkit-border-radius: 3px 3px 0 0;
+ -moz-border-radius: 3px 3px 0 0;
+ border-radius: 3px 3px 0 0;
+}
+
+.popover-content {
+ padding: 14px;
+ background-color: #ffffff;
+ -webkit-border-radius: 0 0 3px 3px;
+ -moz-border-radius: 0 0 3px 3px;
+ border-radius: 0 0 3px 3px;
+ -webkit-background-clip: padding-box;
+ -moz-background-clip: padding-box;
+ background-clip: padding-box;
+}
+
+.popover-content p,
+.popover-content ul,
+.popover-content ol {
+ margin-bottom: 0;
+}
+
+.thumbnails {
+ margin-left: -20px;
+ list-style: none;
+ *zoom: 1;
+}
+
+.thumbnails:before,
+.thumbnails:after {
+ display: table;
+ content: "";
+}
+
+.thumbnails:after {
+ clear: both;
+}
+
+.row-fluid .thumbnails {
+ margin-left: 0;
+}
+
+.thumbnails > li {
+ float: left;
+ margin-bottom: 18px;
+ margin-left: 20px;
+}
+
+.thumbnail {
+ display: block;
+ padding: 4px;
+ line-height: 1;
+ border: 1px solid #ddd;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075);
+ -moz-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075);
+ box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075);
+}
+
+a.thumbnail:hover {
+ border-color: #0088cc;
+ -webkit-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25);
+ -moz-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25);
+ box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25);
+}
+
+.thumbnail > img {
+ display: block;
+ max-width: 100%;
+ margin-right: auto;
+ margin-left: auto;
+}
+
+.thumbnail .caption {
+ padding: 9px;
+}
+
+.label,
+.badge {
+ font-size: 10.998px;
+ font-weight: bold;
+ line-height: 14px;
+ color: #ffffff;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ white-space: nowrap;
+ vertical-align: baseline;
+ background-color: #999999;
+}
+
+.label {
+ padding: 1px 4px 2px;
+ -webkit-border-radius: 3px;
+ -moz-border-radius: 3px;
+ border-radius: 3px;
+}
+
+.badge {
+ padding: 1px 9px 2px;
+ -webkit-border-radius: 9px;
+ -moz-border-radius: 9px;
+ border-radius: 9px;
+}
+
+a.label:hover,
+a.badge:hover {
+ color: #ffffff;
+ text-decoration: none;
+ cursor: pointer;
+}
+
+.label-important,
+.badge-important {
+ background-color: #b94a48;
+}
+
+.label-important[href],
+.badge-important[href] {
+ background-color: #953b39;
+}
+
+.label-warning,
+.badge-warning {
+ background-color: #f89406;
+}
+
+.label-warning[href],
+.badge-warning[href] {
+ background-color: #c67605;
+}
+
+.label-success,
+.badge-success {
+ background-color: #468847;
+}
+
+.label-success[href],
+.badge-success[href] {
+ background-color: #356635;
+}
+
+.label-info,
+.badge-info {
+ background-color: #3a87ad;
+}
+
+.label-info[href],
+.badge-info[href] {
+ background-color: #2d6987;
+}
+
+.label-inverse,
+.badge-inverse {
+ background-color: #333333;
+}
+
+.label-inverse[href],
+.badge-inverse[href] {
+ background-color: #1a1a1a;
+}
+
+@-webkit-keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@-moz-keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@-ms-keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@-o-keyframes progress-bar-stripes {
+ from {
+ background-position: 0 0;
+ }
+ to {
+ background-position: 40px 0;
+ }
+}
+
+@keyframes progress-bar-stripes {
+ from {
+ background-position: 40px 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+.progress {
+ height: 18px;
+ margin-bottom: 18px;
+ overflow: hidden;
+ background-color: #f7f7f7;
+ background-image: -moz-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: -ms-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#f5f5f5), to(#f9f9f9));
+ background-image: -webkit-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: -o-linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-image: linear-gradient(top, #f5f5f5, #f9f9f9);
+ background-repeat: repeat-x;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#f5f5f5', endColorstr='#f9f9f9', GradientType=0);
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+ -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+}
+
+.progress .bar {
+ width: 0;
+ height: 18px;
+ font-size: 12px;
+ color: #ffffff;
+ text-align: center;
+ text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+ background-color: #0e90d2;
+ background-image: -moz-linear-gradient(top, #149bdf, #0480be);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#149bdf), to(#0480be));
+ background-image: -webkit-linear-gradient(top, #149bdf, #0480be);
+ background-image: -o-linear-gradient(top, #149bdf, #0480be);
+ background-image: linear-gradient(top, #149bdf, #0480be);
+ background-image: -ms-linear-gradient(top, #149bdf, #0480be);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#149bdf', endColorstr='#0480be', GradientType=0);
+ -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ -moz-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
+ -webkit-box-sizing: border-box;
+ -moz-box-sizing: border-box;
+ -ms-box-sizing: border-box;
+ box-sizing: border-box;
+ -webkit-transition: width 0.6s ease;
+ -moz-transition: width 0.6s ease;
+ -ms-transition: width 0.6s ease;
+ -o-transition: width 0.6s ease;
+ transition: width 0.6s ease;
+}
+
+.progress-striped .bar {
+ background-color: #149bdf;
+ background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ -webkit-background-size: 40px 40px;
+ -moz-background-size: 40px 40px;
+ -o-background-size: 40px 40px;
+ background-size: 40px 40px;
+}
+
+.progress.active .bar {
+ -webkit-animation: progress-bar-stripes 2s linear infinite;
+ -moz-animation: progress-bar-stripes 2s linear infinite;
+ -ms-animation: progress-bar-stripes 2s linear infinite;
+ -o-animation: progress-bar-stripes 2s linear infinite;
+ animation: progress-bar-stripes 2s linear infinite;
+}
+
+.progress-danger .bar {
+ background-color: #dd514c;
+ background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#c43c35));
+ background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: -o-linear-gradient(top, #ee5f5b, #c43c35);
+ background-image: linear-gradient(top, #ee5f5b, #c43c35);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0);
+}
+
+.progress-danger.progress-striped .bar {
+ background-color: #ee5f5b;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.progress-success .bar {
+ background-color: #5eb95e;
+ background-image: -moz-linear-gradient(top, #62c462, #57a957);
+ background-image: -ms-linear-gradient(top, #62c462, #57a957);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#57a957));
+ background-image: -webkit-linear-gradient(top, #62c462, #57a957);
+ background-image: -o-linear-gradient(top, #62c462, #57a957);
+ background-image: linear-gradient(top, #62c462, #57a957);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#62c462', endColorstr='#57a957', GradientType=0);
+}
+
+.progress-success.progress-striped .bar {
+ background-color: #62c462;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.progress-info .bar {
+ background-color: #4bb1cf;
+ background-image: -moz-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: -ms-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#339bb9));
+ background-image: -webkit-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: -o-linear-gradient(top, #5bc0de, #339bb9);
+ background-image: linear-gradient(top, #5bc0de, #339bb9);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#5bc0de', endColorstr='#339bb9', GradientType=0);
+}
+
+.progress-info.progress-striped .bar {
+ background-color: #5bc0de;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.progress-warning .bar {
+ background-color: #faa732;
+ background-image: -moz-linear-gradient(top, #fbb450, #f89406);
+ background-image: -ms-linear-gradient(top, #fbb450, #f89406);
+ background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));
+ background-image: -webkit-linear-gradient(top, #fbb450, #f89406);
+ background-image: -o-linear-gradient(top, #fbb450, #f89406);
+ background-image: linear-gradient(top, #fbb450, #f89406);
+ background-repeat: repeat-x;
+ filter: progid:dximagetransform.microsoft.gradient(startColorstr='#fbb450', endColorstr='#f89406', GradientType=0);
+}
+
+.progress-warning.progress-striped .bar {
+ background-color: #fbb450;
+ background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));
+ background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+}
+
+.accordion {
+ margin-bottom: 18px;
+}
+
+.accordion-group {
+ margin-bottom: 2px;
+ border: 1px solid #e5e5e5;
+ -webkit-border-radius: 4px;
+ -moz-border-radius: 4px;
+ border-radius: 4px;
+}
+
+.accordion-heading {
+ border-bottom: 0;
+}
+
+.accordion-heading .accordion-toggle {
+ display: block;
+ padding: 8px 15px;
+}
+
+.accordion-toggle {
+ cursor: pointer;
+}
+
+.accordion-inner {
+ padding: 9px 15px;
+ border-top: 1px solid #e5e5e5;
+}
+
+.carousel {
+ position: relative;
+ margin-bottom: 18px;
+ line-height: 1;
+}
+
+.carousel-inner {
+ position: relative;
+ width: 100%;
+ overflow: hidden;
+}
+
+.carousel .item {
+ position: relative;
+ display: none;
+ -webkit-transition: 0.6s ease-in-out left;
+ -moz-transition: 0.6s ease-in-out left;
+ -ms-transition: 0.6s ease-in-out left;
+ -o-transition: 0.6s ease-in-out left;
+ transition: 0.6s ease-in-out left;
+}
+
+.carousel .item > img {
+ display: block;
+ line-height: 1;
+}
+
+.carousel .active,
+.carousel .next,
+.carousel .prev {
+ display: block;
+}
+
+.carousel .active {
+ left: 0;
+}
+
+.carousel .next,
+.carousel .prev {
+ position: absolute;
+ top: 0;
+ width: 100%;
+}
+
+.carousel .next {
+ left: 100%;
+}
+
+.carousel .prev {
+ left: -100%;
+}
+
+.carousel .next.left,
+.carousel .prev.right {
+ left: 0;
+}
+
+.carousel .active.left {
+ left: -100%;
+}
+
+.carousel .active.right {
+ left: 100%;
+}
+
+.carousel-control {
+ position: absolute;
+ top: 40%;
+ left: 15px;
+ width: 40px;
+ height: 40px;
+ margin-top: -20px;
+ font-size: 60px;
+ font-weight: 100;
+ line-height: 30px;
+ color: #ffffff;
+ text-align: center;
+ background: #222222;
+ border: 3px solid #ffffff;
+ -webkit-border-radius: 23px;
+ -moz-border-radius: 23px;
+ border-radius: 23px;
+ opacity: 0.5;
+ filter: alpha(opacity=50);
+}
+
+.carousel-control.right {
+ right: 15px;
+ left: auto;
+}
+
+.carousel-control:hover {
+ color: #ffffff;
+ text-decoration: none;
+ opacity: 0.9;
+ filter: alpha(opacity=90);
+}
+
+.carousel-caption {
+ position: absolute;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ padding: 10px 15px 5px;
+ background: #333333;
+ background: rgba(0, 0, 0, 0.75);
+}
+
+.carousel-caption h4,
+.carousel-caption p {
+ color: #ffffff;
+}
+
+.hero-unit {
+ padding: 60px;
+ margin-bottom: 30px;
+ background-color: #eeeeee;
+ -webkit-border-radius: 6px;
+ -moz-border-radius: 6px;
+ border-radius: 6px;
+}
+
+.hero-unit h1 {
+ margin-bottom: 0;
+ font-size: 60px;
+ line-height: 1;
+ letter-spacing: -1px;
+ color: inherit;
+}
+
+.hero-unit p {
+ font-size: 18px;
+ font-weight: 200;
+ line-height: 27px;
+ color: inherit;
+}
+
+.pull-right {
+ float: right;
+}
+
+.pull-left {
+ float: left;
+}
+
+.hide {
+ display: none;
+}
+
+.show {
+ display: block;
+}
+
+.invisible {
+ visibility: hidden;
+}
diff --git a/inst/web/css/bootstrap.min.css b/inst/web/css/bootstrap.min.css
new file mode 100644
index 0000000..b74b454
--- /dev/null
+++ b/inst/web/css/bootstrap.min.css
@@ -0,0 +1,9 @@
+/*!
+ * Bootstrap v2.0.4
+ *
+ * Copyright 2012 Twitter, Inc
+ * Licensed under the Apache License v2.0
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Designed and built with all the love in the world @twitter by @mdo and @fat.
+ */article,aside,details,figcaption,figure,footer,header,hgroup,nav,section{display:block}audio,canvas,video{display:inline-block;*display:inline;*zoom:1}audio:not([controls]){display:none}html{font-size:100%;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}a:focus{outline:thin dotted #333;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}a:hover,a:active{outline:0}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{max-width:100%;vertical-align:middle;border:0;-ms-interpolation-mode:bicubic}#map_canvas img{max-width:none}button,input,select,textarea{margin:0;font-size:100%;vertical-align:middle}button,input{*overflow:visible;line-height:normal}button::-moz-focus-inner,input::-moz-focus-inner{padding:0;border:0}button,input[type="button"],input[type="reset"],input[type="submit"]{cursor:pointer;-webkit-appearance:button}input[type="search"]{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;-webkit-appearance:textfield}input[type="search"]::-webkit-search-decoration,input[type="search"]::-webkit-search-cancel-button{-webkit-appearance:none}textarea{overflow:auto;vertical-align:top}.clearfix{*zoom:1}.clearfix:before,.clearfix:after{display:table;content:""}.clearfix:after{clear:both}.hide-text{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.input-block-level{display:block;width:100%;min-height:28px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}body{margin:0;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:13px;line-height:18px;color:#333;background-color:#fff}a{color:#08c;text-decoration:none}a:hover{color:#005580;text-decoration:underline}.row{margin-left:-20px;*zoom:1}.row:before,.row:after{display:table;content:""}.row:after{clear:both}[class*="span"]{float:left;margin-left:20px}.container,.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:940px}.span12{width:940px}.span11{width:860px}.span10{width:780px}.span9{width:700px}.span8{width:620px}.span7{width:540px}.span6{width:460px}.span5{width:380px}.span4{width:300px}.span3{width:220px}.span2{width:140px}.span1{width:60px}.offset12{margin-left:980px}.offset11{margin-left:900px}.offset10{margin-left:820px}.offset9{margin-left:740px}.offset8{margin-left:660px}.offset7{margin-left:580px}.offset6{margin-left:500px}.offset5{margin-left:420px}.offset4{margin-left:340px}.offset3{margin-left:260px}.offset2{margin-left:180px}.offset1{margin-left:100px}.row-fluid{width:100%;*zoom:1}.row-fluid:before,.row-fluid:after{display:table;content:""}.row-fluid:after{clear:both}.row-fluid [class*="span"]{display:block;float:left;width:100%;min-height:28px;margin-left:2.127659574%;*margin-left:2.0744680846382977%;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box}.row-fluid [class*="span"]:first-child{margin-left:0}.row-fluid .span12{width:99.99999998999999%;*width:99.94680850063828%}.row-fluid .span11{width:91.489361693%;*width:91.4361702036383%}.row-fluid .span10{width:82.97872339599999%;*width:82.92553190663828%}.row-fluid .span9{width:74.468085099%;*width:74.4148936096383%}.row-fluid .span8{width:65.95744680199999%;*width:65.90425531263828%}.row-fluid .span7{width:57.446808505%;*width:57.3936170156383%}.row-fluid .span6{width:48.93617020799999%;*width:48.88297871863829%}.row-fluid .span5{width:40.425531911%;*width:40.3723404216383%}.row-fluid .span4{width:31.914893614%;*width:31.8617021246383%}.row-fluid .span3{width:23.404255317%;*width:23.3510638276383%}.row-fluid .span2{width:14.89361702%;*width:14.8404255306383%}.row-fluid .span1{width:6.382978723%;*width:6.329787233638298%}.container{margin-right:auto;margin-left:auto;*zoom:1}.container:before,.container:after{display:table;content:""}.container:after{clear:both}.container-fluid{padding-right:20px;padding-left:20px;*zoom:1}.container-fluid:before,.container-fluid:after{display:table;content:""}.container-fluid:after{clear:both}p{margin:0 0 9px}p small{font-size:11px;color:#999}.lead{margin-bottom:18px;font-size:20px;font-weight:200;line-height:27px}h1,h2,h3,h4,h5,h6{margin:0;font-family:inherit;font-weight:bold;color:inherit;text-rendering:optimizelegibility}h1 small,h2 small,h3 small,h4 small,h5 small,h6 small{font-weight:normal;color:#999}h1{font-size:30px;line-height:36px}h1 small{font-size:18px}h2{font-size:24px;line-height:36px}h2 small{font-size:18px}h3{font-size:18px;line-height:27px}h3 small{font-size:14px}h4,h5,h6{line-height:18px}h4{font-size:14px}h4 small{font-size:12px}h5{font-size:12px}h6{font-size:11px;color:#999;text-transform:uppercase}.page-header{padding-bottom:17px;margin:18px 0;border-bottom:1px solid #eee}.page-header h1{line-height:1}ul,ol{padding:0;margin:0 0 9px 25px}ul ul,ul ol,ol ol,ol ul{margin-bottom:0}ul{list-style:disc}ol{list-style:decimal}li{line-height:18px}ul.unstyled,ol.unstyled{margin-left:0;list-style:none}dl{margin-bottom:18px}dt,dd{line-height:18px}dt{font-weight:bold;line-height:17px}dd{margin-left:9px}.dl-horizontal dt{float:left;width:120px;overflow:hidden;clear:left;text-align:right;text-overflow:ellipsis;white-space:nowrap}.dl-horizontal dd{margin-left:130px}hr{margin:18px 0;border:0;border-top:1px solid #eee;border-bottom:1px solid #fff}strong{font-weight:bold}em{font-style:italic}.muted{color:#999}abbr[title]{cursor:help;border-bottom:1px dotted #999}abbr.initialism{font-size:90%;text-transform:uppercase}blockquote{padding:0 0 0 15px;margin:0 0 18px;border-left:5px solid #eee}blockquote p{margin-bottom:0;font-size:16px;font-weight:300;line-height:22.5px}blockquote small{display:block;line-height:18px;color:#999}blockquote small:before{content:'\2014 \00A0'}blockquote.pull-right{float:right;padding-right:15px;padding-left:0;border-right:5px solid #eee;border-left:0}blockquote.pull-right p,blockquote.pull-right small{text-align:right}q:before,q:after,blockquote:before,blockquote:after{content:""}address{display:block;margin-bottom:18px;font-style:normal;line-height:18px}small{font-size:100%}cite{font-style:normal}code,pre{padding:0 3px 2px;font-family:Menlo,Monaco,Consolas,"Courier New",monospace;font-size:12px;color:#333;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}code{padding:2px 4px;color:#d14;background-color:#f7f7f9;border:1px solid #e1e1e8}pre{display:block;padding:8.5px;margin:0 0 9px;font-size:12.025px;line-height:18px;word-break:break-all;word-wrap:break-word;white-space:pre;white-space:pre-wrap;background-color:#f5f5f5;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.15);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}pre.prettyprint{margin-bottom:18px}pre code{padding:0;color:inherit;background-color:transparent;border:0}.pre-scrollable{max-height:340px;overflow-y:scroll}form{margin:0 0 18px}fieldset{padding:0;margin:0;border:0}legend{display:block;width:100%;padding:0;margin-bottom:27px;font-size:19.5px;line-height:36px;color:#333;border:0;border-bottom:1px solid #e5e5e5}legend small{font-size:13.5px;color:#999}label,input,button,select,textarea{font-size:13px;font-weight:normal;line-height:18px}input,button,select,textarea{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif}label{display:block;margin-bottom:5px}select,textarea,input[type="text"],input[type="password"],input[type="datetime"],input[type="datetime-local"],input[type="date"],input[type="month"],input[type="time"],input[type="week"],input[type="number"],input[type="email"],input[type="url"],input[type="search"],input[type="tel"],input[type="color"],.uneditable-input{display:inline-block;height:18px;padding:4px;margin-bottom:9px;font-size:13px;line-height:18px;color:#555}input,textarea{width:210px}textarea{height:auto}textarea,input[type="text"],input[type="password"],input[type="datetime"],input[type="datetime-local"],input[type="date"],input[type="month"],input[type="time"],input[type="week"],input[type="number"],input[type="email"],input[type="url"],input[type="search"],input[type="tel"],input[type="color"],.uneditable-input{background-color:#fff;border:1px solid #ccc;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075);-webkit-transition:border linear .2s,box-shadow linear .2s;-moz-transition:border linear .2s,box-shadow linear .2s;-ms-transition:border linear .2s,box-shadow linear .2s;-o-transition:border linear .2s,box-shadow linear .2s;transition:border linear .2s,box-shadow linear .2s}textarea:focus,input[type="text"]:focus,input[type="password"]:focus,input[type="datetime"]:focus,input[type="datetime-local"]:focus,input[type="date"]:focus,input[type="month"]:focus,input[type="time"]:focus,input[type="week"]:focus,input[type="number"]:focus,input[type="email"]:focus,input[type="url"]:focus,input[type="search"]:focus,input[type="tel"]:focus,input[type="color"]:focus,.uneditable-input:focus{border-color:rgba(82,168,236,0.8);outline:0;outline:thin dotted \9;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(82,168,236,0.6);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(82,168,236,0.6);box-shadow:inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(82,168,236,0.6)}input[type="radio"],input[type="checkbox"]{margin:3px 0;*margin-top:0;line-height:normal;cursor:pointer}input[type="submit"],input[type="reset"],input[type="button"],input[type="radio"],input[type="checkbox"]{width:auto}.uneditable-textarea{width:auto;height:auto}select,input[type="file"]{height:28px;*margin-top:4px;line-height:28px}select{width:220px;border:1px solid #bbb}select[multiple],select[size]{height:auto}select:focus,input[type="file"]:focus,input[type="radio"]:focus,input[type="checkbox"]:focus{outline:thin dotted #333;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.radio,.checkbox{min-height:18px;padding-left:18px}.radio input[type="radio"],.checkbox input[type="checkbox"]{float:left;margin-left:-18px}.controls>.radio:first-child,.controls>.checkbox:first-child{padding-top:5px}.radio.inline,.checkbox.inline{display:inline-block;padding-top:5px;margin-bottom:0;vertical-align:middle}.radio.inline+.radio.inline,.checkbox.inline+.checkbox.inline{margin-left:10px}.input-mini{width:60px}.input-small{width:90px}.input-medium{width:150px}.input-large{width:210px}.input-xlarge{width:270px}.input-xxlarge{width:530px}input[class*="span"],select[class*="span"],textarea[class*="span"],.uneditable-input[class*="span"],.row-fluid input[class*="span"],.row-fluid select[class*="span"],.row-fluid textarea[class*="span"],.row-fluid .uneditable-input[class*="span"]{float:none;margin-left:0}.input-append input[class*="span"],.input-append .uneditable-input[class*="span"],.input-prepend input[class*="span"],.input-prepend .uneditable-input[class*="span"],.row-fluid .input-prepend [class*="span"],.row-fluid .input-append [class*="span"]{display:inline-block}input,textarea,.uneditable-input{margin-left:0}input.span12,textarea.span12,.uneditable-input.span12{width:930px}input.span11,textarea.span11,.uneditable-input.span11{width:850px}input.span10,textarea.span10,.uneditable-input.span10{width:770px}input.span9,textarea.span9,.uneditable-input.span9{width:690px}input.span8,textarea.span8,.uneditable-input.span8{width:610px}input.span7,textarea.span7,.uneditable-input.span7{width:530px}input.span6,textarea.span6,.uneditable-input.span6{width:450px}input.span5,textarea.span5,.uneditable-input.span5{width:370px}input.span4,textarea.span4,.uneditable-input.span4{width:290px}input.span3,textarea.span3,.uneditable-input.span3{width:210px}input.span2,textarea.span2,.uneditable-input.span2{width:130px}input.span1,textarea.span1,.uneditable-input.span1{width:50px}input[disabled],select[disabled],textarea[disabled],input[readonly],select[readonly],textarea[readonly]{cursor:not-allowed;background-color:#eee;border-color:#ddd}input[type="radio"][disabled],input[type="checkbox"][disabled],input[type="radio"][readonly],input[type="checkbox"][readonly]{background-color:transparent}.control-group.warning>label,.control-group.warning .help-block,.control-group.warning .help-inline{color:#c09853}.control-group.warning .checkbox,.control-group.warning .radio,.control-group.warning input,.control-group.warning select,.control-group.warning textarea{color:#c09853;border-color:#c09853}.control-group.warning .checkbox:focus,.control-group.warning .radio:focus,.control-group.warning input:focus,.control-group.warning select:focus,.control-group.warning textarea:focus{border-color:#a47e3c;-webkit-box-shadow:0 0 6px #dbc59e;-moz-box-shadow:0 0 6px #dbc59e;box-shadow:0 0 6px #dbc59e}.control-group.warning .input-prepend .add-on,.control-group.warning .input-append .add-on{color:#c09853;background-color:#fcf8e3;border-color:#c09853}.control-group.error>label,.control-group.error .help-block,.control-group.error .help-inline{color:#b94a48}.control-group.error .checkbox,.control-group.error .radio,.control-group.error input,.control-group.error select,.control-group.error textarea{color:#b94a48;border-color:#b94a48}.control-group.error .checkbox:focus,.control-group.error .radio:focus,.control-group.error input:focus,.control-group.error select:focus,.control-group.error textarea:focus{border-color:#953b39;-webkit-box-shadow:0 0 6px #d59392;-moz-box-shadow:0 0 6px #d59392;box-shadow:0 0 6px #d59392}.control-group.error .input-prepend .add-on,.control-group.error .input-append .add-on{color:#b94a48;background-color:#f2dede;border-color:#b94a48}.control-group.success>label,.control-group.success .help-block,.control-group.success .help-inline{color:#468847}.control-group.success .checkbox,.control-group.success .radio,.control-group.success input,.control-group.success select,.control-group.success textarea{color:#468847;border-color:#468847}.control-group.success .checkbox:focus,.control-group.success .radio:focus,.control-group.success input:focus,.control-group.success select:focus,.control-group.success textarea:focus{border-color:#356635;-webkit-box-shadow:0 0 6px #7aba7b;-moz-box-shadow:0 0 6px #7aba7b;box-shadow:0 0 6px #7aba7b}.control-group.success .input-prepend .add-on,.control-group.success .input-append .add-on{color:#468847;background-color:#dff0d8;border-color:#468847}input:focus:required:invalid,textarea:focus:required:invalid,select:focus:required:invalid{color:#b94a48;border-color:#ee5f5b}input:focus:required:invalid:focus,textarea:focus:required:invalid:focus,select:focus:required:invalid:focus{border-color:#e9322d;-webkit-box-shadow:0 0 6px #f8b9b7;-moz-box-shadow:0 0 6px #f8b9b7;box-shadow:0 0 6px #f8b9b7}.form-actions{padding:17px 20px 18px;margin-top:18px;margin-bottom:18px;background-color:#f5f5f5;border-top:1px solid #e5e5e5;*zoom:1}.form-actions:before,.form-actions:after{display:table;content:""}.form-actions:after{clear:both}.uneditable-input{overflow:hidden;white-space:nowrap;cursor:not-allowed;background-color:#fff;border-color:#eee;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.025);-moz-box-shadow:inset 0 1px 2px rgba(0,0,0,0.025);box-shadow:inset 0 1px 2px rgba(0,0,0,0.025)}:-moz-placeholder{color:#999}:-ms-input-placeholder{color:#999}::-webkit-input-placeholder{color:#999}.help-block,.help-inline{color:#555}.help-block{display:block;margin-bottom:9px}.help-inline{display:inline-block;*display:inline;padding-left:5px;vertical-align:middle;*zoom:1}.input-prepend,.input-append{margin-bottom:5px}.input-prepend input,.input-append input,.input-prepend select,.input-append select,.input-prepend .uneditable-input,.input-append .uneditable-input{position:relative;margin-bottom:0;*margin-left:0;vertical-align:middle;-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0}.input-prepend input:focus,.input-append input:focus,.input-prepend select:focus,.input-append select:focus,.input-prepend .uneditable-input:focus,.input-append .uneditable-input:focus{z-index:2}.input-prepend .uneditable-input,.input-append .uneditable-input{border-left-color:#ccc}.input-prepend .add-on,.input-append .add-on{display:inline-block;width:auto;height:18px;min-width:16px;padding:4px 5px;font-weight:normal;line-height:18px;text-align:center;text-shadow:0 1px 0 #fff;vertical-align:middle;background-color:#eee;border:1px solid #ccc}.input-prepend .add-on,.input-append .add-on,.input-prepend .btn,.input-append .btn{margin-left:-1px;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.input-prepend .active,.input-append .active{background-color:#a9dba9;border-color:#46a546}.input-prepend .add-on,.input-prepend .btn{margin-right:-1px}.input-prepend .add-on:first-child,.input-prepend .btn:first-child{-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px}.input-append input,.input-append select,.input-append .uneditable-input{-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px}.input-append .uneditable-input{border-right-color:#ccc;border-left-color:#eee}.input-append .add-on:last-child,.input-append .btn:last-child{-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0}.input-prepend.input-append input,.input-prepend.input-append select,.input-prepend.input-append .uneditable-input{-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.input-prepend.input-append .add-on:first-child,.input-prepend.input-append .btn:first-child{margin-right:-1px;-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px}.input-prepend.input-append .add-on:last-child,.input-prepend.input-append .btn:last-child{margin-left:-1px;-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0}.search-query{padding-right:14px;padding-right:4px \9;padding-left:14px;padding-left:4px \9;margin-bottom:0;-webkit-border-radius:14px;-moz-border-radius:14px;border-radius:14px}.form-search input,.form-inline input,.form-horizontal input,.form-search textarea,.form-inline textarea,.form-horizontal textarea,.form-search select,.form-inline select,.form-horizontal select,.form-search .help-inline,.form-inline .help-inline,.form-horizontal .help-inline,.form-search .uneditable-input,.form-inline .uneditable-input,.form-horizontal .uneditable-input,.form-search .input-prepend,.form-inline .input-prepend,.form-horizontal .input-prepend,.form-search .input-append,.form-inline .input-append,.form-horizontal .input-append{display:inline-block;*display:inline;margin-bottom:0;*zoom:1}.form-search .hide,.form-inline .hide,.form-horizontal .hide{display:none}.form-search label,.form-inline label{display:inline-block}.form-search .input-append,.form-inline .input-append,.form-search .input-prepend,.form-inline .input-prepend{margin-bottom:0}.form-search .radio,.form-search .checkbox,.form-inline .radio,.form-inline .checkbox{padding-left:0;margin-bottom:0;vertical-align:middle}.form-search .radio input[type="radio"],.form-search .checkbox input[type="checkbox"],.form-inline .radio input[type="radio"],.form-inline .checkbox input[type="checkbox"]{float:left;margin-right:3px;margin-left:0}.control-group{margin-bottom:9px}legend+.control-group{margin-top:18px;-webkit-margin-top-collapse:separate}.form-horizontal .control-group{margin-bottom:18px;*zoom:1}.form-horizontal .control-group:before,.form-horizontal .control-group:after{display:table;content:""}.form-horizontal .control-group:after{clear:both}.form-horizontal .control-label{float:left;width:140px;padding-top:5px;text-align:right}.form-horizontal .controls{*display:inline-block;*padding-left:20px;margin-left:160px;*margin-left:0}.form-horizontal .controls:first-child{*padding-left:160px}.form-horizontal .help-block{margin-top:9px;margin-bottom:0}.form-horizontal .form-actions{padding-left:160px}table{max-width:100%;background-color:transparent;border-collapse:collapse;border-spacing:0}.table{width:100%;margin-bottom:18px}.table th,.table td{padding:8px;line-height:18px;text-align:left;vertical-align:top;border-top:1px solid #ddd}.table th{font-weight:bold}.table thead th{vertical-align:bottom}.table caption+thead tr:first-child th,.table caption+thead tr:first-child td,.table colgroup+thead tr:first-child th,.table colgroup+thead tr:first-child td,.table thead:first-child tr:first-child th,.table thead:first-child tr:first-child td{border-top:0}.table tbody+tbody{border-top:2px solid #ddd}.table-condensed th,.table-condensed td{padding:4px 5px}.table-bordered{border:1px solid #ddd;border-collapse:separate;*border-collapse:collapsed;border-left:0;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.table-bordered th,.table-bordered td{border-left:1px solid #ddd}.table-bordered caption+thead tr:first-child th,.table-bordered caption+tbody tr:first-child th,.table-bordered caption+tbody tr:first-child td,.table-bordered colgroup+thead tr:first-child th,.table-bordered colgroup+tbody tr:first-child th,.table-bordered colgroup+tbody tr:first-child td,.table-bordered thead:first-child tr:first-child th,.table-bordered tbody:first-child tr:first-child th,.table-bordered tbody:first-child tr:first-child td{border-top:0}.table-bordered thead:first-child tr:first-child th:first-child,.table-bordered tbody:first-child tr:first-child td:first-child{-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-topleft:4px}.table-bordered thead:first-child tr:first-child th:last-child,.table-bordered tbody:first-child tr:first-child td:last-child{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-moz-border-radius-topright:4px}.table-bordered thead:last-child tr:last-child th:first-child,.table-bordered tbody:last-child tr:last-child td:first-child{-webkit-border-radius:0 0 0 4px;-moz-border-radius:0 0 0 4px;border-radius:0 0 0 4px;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-moz-border-radius-bottomleft:4px}.table-bordered thead:last-child tr:last-child th:last-child,.table-bordered tbody:last-child tr:last-child td:last-child{-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px;-moz-border-radius-bottomright:4px}.table-striped tbody tr:nth-child(odd) td,.table-striped tbody tr:nth-child(odd) th{background-color:#f9f9f9}.table tbody tr:hover td,.table tbody tr:hover th{background-color:#f5f5f5}table .span1{float:none;width:44px;margin-left:0}table .span2{float:none;width:124px;margin-left:0}table .span3{float:none;width:204px;margin-left:0}table .span4{float:none;width:284px;margin-left:0}table .span5{float:none;width:364px;margin-left:0}table .span6{float:none;width:444px;margin-left:0}table .span7{float:none;width:524px;margin-left:0}table .span8{float:none;width:604px;margin-left:0}table .span9{float:none;width:684px;margin-left:0}table .span10{float:none;width:764px;margin-left:0}table .span11{float:none;width:844px;margin-left:0}table .span12{float:none;width:924px;margin-left:0}table .span13{float:none;width:1004px;margin-left:0}table .span14{float:none;width:1084px;margin-left:0}table .span15{float:none;width:1164px;margin-left:0}table .span16{float:none;width:1244px;margin-left:0}table .span17{float:none;width:1324px;margin-left:0}table .span18{float:none;width:1404px;margin-left:0}table .span19{float:none;width:1484px;margin-left:0}table .span20{float:none;width:1564px;margin-left:0}table .span21{float:none;width:1644px;margin-left:0}table .span22{float:none;width:1724px;margin-left:0}table .span23{float:none;width:1804px;margin-left:0}table .span24{float:none;width:1884px;margin-left:0}[class^="icon-"],[class*=" icon-"]{display:inline-block;width:14px;height:14px;*margin-right:.3em;line-height:14px;vertical-align:text-top;background-image:url("../img/glyphicons-halflings.png");background-position:14px 14px;background-repeat:no-repeat}[class^="icon-"]:last-child,[class*=" icon-"]:last-child{*margin-left:0}.icon-white{background-image:url("../img/glyphicons-halflings-white.png")}.icon-glass{background-position:0 0}.icon-music{background-position:-24px 0}.icon-search{background-position:-48px 0}.icon-envelope{background-position:-72px 0}.icon-heart{background-position:-96px 0}.icon-star{background-position:-120px 0}.icon-star-empty{background-position:-144px 0}.icon-user{background-position:-168px 0}.icon-film{background-position:-192px 0}.icon-th-large{background-position:-216px 0}.icon-th{background-position:-240px 0}.icon-th-list{background-position:-264px 0}.icon-ok{background-position:-288px 0}.icon-remove{background-position:-312px 0}.icon-zoom-in{background-position:-336px 0}.icon-zoom-out{background-position:-360px 0}.icon-off{background-position:-384px 0}.icon-signal{background-position:-408px 0}.icon-cog{background-position:-432px 0}.icon-trash{background-position:-456px 0}.icon-home{background-position:0 -24px}.icon-file{background-position:-24px -24px}.icon-time{background-position:-48px -24px}.icon-road{background-position:-72px -24px}.icon-download-alt{background-position:-96px -24px}.icon-download{background-position:-120px -24px}.icon-upload{background-position:-144px -24px}.icon-inbox{background-position:-168px -24px}.icon-play-circle{background-position:-192px -24px}.icon-repeat{background-position:-216px -24px}.icon-refresh{background-position:-240px -24px}.icon-list-alt{background-position:-264px -24px}.icon-lock{background-position:-287px -24px}.icon-flag{background-position:-312px -24px}.icon-headphones{background-position:-336px -24px}.icon-volume-off{background-position:-360px -24px}.icon-volume-down{background-position:-384px -24px}.icon-volume-up{background-position:-408px -24px}.icon-qrcode{background-position:-432px -24px}.icon-barcode{background-position:-456px -24px}.icon-tag{background-position:0 -48px}.icon-tags{background-position:-25px -48px}.icon-book{background-position:-48px -48px}.icon-bookmark{background-position:-72px -48px}.icon-print{background-position:-96px -48px}.icon-camera{background-position:-120px -48px}.icon-font{background-position:-144px -48px}.icon-bold{background-position:-167px -48px}.icon-italic{background-position:-192px -48px}.icon-text-height{background-position:-216px -48px}.icon-text-width{background-position:-240px -48px}.icon-align-left{background-position:-264px -48px}.icon-align-center{background-position:-288px -48px}.icon-align-right{background-position:-312px -48px}.icon-align-justify{background-position:-336px -48px}.icon-list{background-position:-360px -48px}.icon-indent-left{background-position:-384px -48px}.icon-indent-right{background-position:-408px -48px}.icon-facetime-video{background-position:-432px -48px}.icon-picture{background-position:-456px -48px}.icon-pencil{background-position:0 -72px}.icon-map-marker{background-position:-24px -72px}.icon-adjust{background-position:-48px -72px}.icon-tint{background-position:-72px -72px}.icon-edit{background-position:-96px -72px}.icon-share{background-position:-120px -72px}.icon-check{background-position:-144px -72px}.icon-move{background-position:-168px -72px}.icon-step-backward{background-position:-192px -72px}.icon-fast-backward{background-position:-216px -72px}.icon-backward{background-position:-240px -72px}.icon-play{background-position:-264px -72px}.icon-pause{background-position:-288px -72px}.icon-stop{background-position:-312px -72px}.icon-forward{background-position:-336px -72px}.icon-fast-forward{background-position:-360px -72px}.icon-step-forward{background-position:-384px -72px}.icon-eject{background-position:-408px -72px}.icon-chevron-left{background-position:-432px -72px}.icon-chevron-right{background-position:-456px -72px}.icon-plus-sign{background-position:0 -96px}.icon-minus-sign{background-position:-24px -96px}.icon-remove-sign{background-position:-48px -96px}.icon-ok-sign{background-position:-72px -96px}.icon-question-sign{background-position:-96px -96px}.icon-info-sign{background-position:-120px -96px}.icon-screenshot{background-position:-144px -96px}.icon-remove-circle{background-position:-168px -96px}.icon-ok-circle{background-position:-192px -96px}.icon-ban-circle{background-position:-216px -96px}.icon-arrow-left{background-position:-240px -96px}.icon-arrow-right{background-position:-264px -96px}.icon-arrow-up{background-position:-289px -96px}.icon-arrow-down{background-position:-312px -96px}.icon-share-alt{background-position:-336px -96px}.icon-resize-full{background-position:-360px -96px}.icon-resize-small{background-position:-384px -96px}.icon-plus{background-position:-408px -96px}.icon-minus{background-position:-433px -96px}.icon-asterisk{background-position:-456px -96px}.icon-exclamation-sign{background-position:0 -120px}.icon-gift{background-position:-24px -120px}.icon-leaf{background-position:-48px -120px}.icon-fire{background-position:-72px -120px}.icon-eye-open{background-position:-96px -120px}.icon-eye-close{background-position:-120px -120px}.icon-warning-sign{background-position:-144px -120px}.icon-plane{background-position:-168px -120px}.icon-calendar{background-position:-192px -120px}.icon-random{background-position:-216px -120px}.icon-comment{background-position:-240px -120px}.icon-magnet{background-position:-264px -120px}.icon-chevron-up{background-position:-288px -120px}.icon-chevron-down{background-position:-313px -119px}.icon-retweet{background-position:-336px -120px}.icon-shopping-cart{background-position:-360px -120px}.icon-folder-close{background-position:-384px -120px}.icon-folder-open{background-position:-408px -120px}.icon-resize-vertical{background-position:-432px -119px}.icon-resize-horizontal{background-position:-456px -118px}.icon-hdd{background-position:0 -144px}.icon-bullhorn{background-position:-24px -144px}.icon-bell{background-position:-48px -144px}.icon-certificate{background-position:-72px -144px}.icon-thumbs-up{background-position:-96px -144px}.icon-thumbs-down{background-position:-120px -144px}.icon-hand-right{background-position:-144px -144px}.icon-hand-left{background-position:-168px -144px}.icon-hand-up{background-position:-192px -144px}.icon-hand-down{background-position:-216px -144px}.icon-circle-arrow-right{background-position:-240px -144px}.icon-circle-arrow-left{background-position:-264px -144px}.icon-circle-arrow-up{background-position:-288px -144px}.icon-circle-arrow-down{background-position:-312px -144px}.icon-globe{background-position:-336px -144px}.icon-wrench{background-position:-360px -144px}.icon-tasks{background-position:-384px -144px}.icon-filter{background-position:-408px -144px}.icon-briefcase{background-position:-432px -144px}.icon-fullscreen{background-position:-456px -144px}.dropup,.dropdown{position:relative}.dropdown-toggle{*margin-bottom:-3px}.dropdown-toggle:active,.open .dropdown-toggle{outline:0}.caret{display:inline-block;width:0;height:0;vertical-align:top;border-top:4px solid #000;border-right:4px solid transparent;border-left:4px solid transparent;content:"";opacity:.3;filter:alpha(opacity=30)}.dropdown .caret{margin-top:8px;margin-left:2px}.dropdown:hover .caret,.open .caret{opacity:1;filter:alpha(opacity=100)}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:160px;padding:4px 0;margin:1px 0 0;list-style:none;background-color:#fff;border:1px solid #ccc;border:1px solid rgba(0,0,0,0.2);*border-right-width:2px;*border-bottom-width:2px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,0.2);-moz-box-shadow:0 5px 10px rgba(0,0,0,0.2);box-shadow:0 5px 10px rgba(0,0,0,0.2);-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box}.dropdown-menu.pull-right{right:0;left:auto}.dropdown-menu .divider{*width:100%;height:1px;margin:8px 1px;*margin:-5px 0 5px;overflow:hidden;background-color:#e5e5e5;border-bottom:1px solid #fff}.dropdown-menu a{display:block;padding:3px 15px;clear:both;font-weight:normal;line-height:18px;color:#333;white-space:nowrap}.dropdown-menu li>a:hover,.dropdown-menu .active>a,.dropdown-menu .active>a:hover{color:#fff;text-decoration:none;background-color:#08c}.open{*z-index:1000}.open>.dropdown-menu{display:block}.pull-right>.dropdown-menu{right:0;left:auto}.dropup .caret,.navbar-fixed-bottom .dropdown .caret{border-top:0;border-bottom:4px solid #000;content:"\2191"}.dropup .dropdown-menu,.navbar-fixed-bottom .dropdown .dropdown-menu{top:auto;bottom:100%;margin-bottom:1px}.typeahead{margin-top:2px;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #eee;border:1px solid rgba(0,0,0,0.05);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 1px 1px rgba(0,0,0,0.05);box-shadow:inset 0 1px 1px rgba(0,0,0,0.05)}.well blockquote{border-color:#ddd;border-color:rgba(0,0,0,0.15)}.well-large{padding:24px;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.well-small{padding:9px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.fade{opacity:0;-webkit-transition:opacity .15s linear;-moz-transition:opacity .15s linear;-ms-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.fade.in{opacity:1}.collapse{position:relative;height:0;overflow:hidden;-webkit-transition:height .35s ease;-moz-transition:height .35s ease;-ms-transition:height .35s ease;-o-transition:height .35s ease;transition:height .35s ease}.collapse.in{height:auto}.close{float:right;font-size:20px;font-weight:bold;line-height:18px;color:#000;text-shadow:0 1px 0 #fff;opacity:.2;filter:alpha(opacity=20)}.close:hover{color:#000;text-decoration:none;cursor:pointer;opacity:.4;filter:alpha(opacity=40)}button.close{padding:0;cursor:pointer;background:transparent;border:0;-webkit-appearance:none}.btn{display:inline-block;*display:inline;padding:4px 10px 4px;margin-bottom:0;*margin-left:.3em;font-size:13px;line-height:18px;*line-height:20px;color:#333;text-align:center;text-shadow:0 1px 1px rgba(255,255,255,0.75);vertical-align:middle;cursor:pointer;background-color:#f5f5f5;*background-color:#e6e6e6;background-image:-ms-linear-gradient(top,#fff,#e6e6e6);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fff),to(#e6e6e6));background-image:-webkit-linear-gradient(top,#fff,#e6e6e6);background-image:-o-linear-gradient(top,#fff,#e6e6e6);background-image:linear-gradient(top,#fff,#e6e6e6);background-image:-moz-linear-gradient(top,#fff,#e6e6e6);background-repeat:repeat-x;border:1px solid #ccc;*border:0;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);border-color:#e6e6e6 #e6e6e6 #bfbfbf;border-bottom-color:#b3b3b3;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#ffffff',endColorstr='#e6e6e6',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false);*zoom:1;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05)}.btn:hover,.btn:active,.btn.active,.btn.disabled,.btn[disabled]{background-color:#e6e6e6;*background-color:#d9d9d9}.btn:active,.btn.active{background-color:#ccc \9}.btn:first-child{*margin-left:0}.btn:hover{color:#333;text-decoration:none;background-color:#e6e6e6;*background-color:#d9d9d9;background-position:0 -15px;-webkit-transition:background-position .1s linear;-moz-transition:background-position .1s linear;-ms-transition:background-position .1s linear;-o-transition:background-position .1s linear;transition:background-position .1s linear}.btn:focus{outline:thin dotted #333;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.btn.active,.btn:active{background-color:#e6e6e6;background-color:#d9d9d9 \9;background-image:none;outline:0;-webkit-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05)}.btn.disabled,.btn[disabled]{cursor:default;background-color:#e6e6e6;background-image:none;opacity:.65;filter:alpha(opacity=65);-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.btn-large{padding:9px 14px;font-size:15px;line-height:normal;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px}.btn-large [class^="icon-"]{margin-top:1px}.btn-small{padding:5px 9px;font-size:11px;line-height:16px}.btn-small [class^="icon-"]{margin-top:-1px}.btn-mini{padding:2px 6px;font-size:11px;line-height:14px}.btn-primary,.btn-primary:hover,.btn-warning,.btn-warning:hover,.btn-danger,.btn-danger:hover,.btn-success,.btn-success:hover,.btn-info,.btn-info:hover,.btn-inverse,.btn-inverse:hover{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25)}.btn-primary.active,.btn-warning.active,.btn-danger.active,.btn-success.active,.btn-info.active,.btn-inverse.active{color:rgba(255,255,255,0.75)}.btn{border-color:#ccc;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25)}.btn-primary{background-color:#0074cc;*background-color:#05c;background-image:-ms-linear-gradient(top,#08c,#05c);background-image:-webkit-gradient(linear,0 0,0 100%,from(#08c),to(#05c));background-image:-webkit-linear-gradient(top,#08c,#05c);background-image:-o-linear-gradient(top,#08c,#05c);background-image:-moz-linear-gradient(top,#08c,#05c);background-image:linear-gradient(top,#08c,#05c);background-repeat:repeat-x;border-color:#05c #05c #003580;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#0088cc',endColorstr='#0055cc',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false)}.btn-primary:hover,.btn-primary:active,.btn-primary.active,.btn-primary.disabled,.btn-primary[disabled]{background-color:#05c;*background-color:#004ab3}.btn-primary:active,.btn-primary.active{background-color:#004099 \9}.btn-warning{background-color:#faa732;*background-color:#f89406;background-image:-ms-linear-gradient(top,#fbb450,#f89406);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fbb450),to(#f89406));background-image:-webkit-linear-gradient(top,#fbb450,#f89406);background-image:-o-linear-gradient(top,#fbb450,#f89406);background-image:-moz-linear-gradient(top,#fbb450,#f89406);background-image:linear-gradient(top,#fbb450,#f89406);background-repeat:repeat-x;border-color:#f89406 #f89406 #ad6704;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#fbb450',endColorstr='#f89406',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false)}.btn-warning:hover,.btn-warning:active,.btn-warning.active,.btn-warning.disabled,.btn-warning[disabled]{background-color:#f89406;*background-color:#df8505}.btn-warning:active,.btn-warning.active{background-color:#c67605 \9}.btn-danger{background-color:#da4f49;*background-color:#bd362f;background-image:-ms-linear-gradient(top,#ee5f5b,#bd362f);background-image:-webkit-gradient(linear,0 0,0 100%,from(#ee5f5b),to(#bd362f));background-image:-webkit-linear-gradient(top,#ee5f5b,#bd362f);background-image:-o-linear-gradient(top,#ee5f5b,#bd362f);background-image:-moz-linear-gradient(top,#ee5f5b,#bd362f);background-image:linear-gradient(top,#ee5f5b,#bd362f);background-repeat:repeat-x;border-color:#bd362f #bd362f #802420;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#ee5f5b',endColorstr='#bd362f',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false)}.btn-danger:hover,.btn-danger:active,.btn-danger.active,.btn-danger.disabled,.btn-danger[disabled]{background-color:#bd362f;*background-color:#a9302a}.btn-danger:active,.btn-danger.active{background-color:#942a25 \9}.btn-success{background-color:#5bb75b;*background-color:#51a351;background-image:-ms-linear-gradient(top,#62c462,#51a351);background-image:-webkit-gradient(linear,0 0,0 100%,from(#62c462),to(#51a351));background-image:-webkit-linear-gradient(top,#62c462,#51a351);background-image:-o-linear-gradient(top,#62c462,#51a351);background-image:-moz-linear-gradient(top,#62c462,#51a351);background-image:linear-gradient(top,#62c462,#51a351);background-repeat:repeat-x;border-color:#51a351 #51a351 #387038;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#62c462',endColorstr='#51a351',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false)}.btn-success:hover,.btn-success:active,.btn-success.active,.btn-success.disabled,.btn-success[disabled]{background-color:#51a351;*background-color:#499249}.btn-success:active,.btn-success.active{background-color:#408140 \9}.btn-info{background-color:#49afcd;*background-color:#2f96b4;background-image:-ms-linear-gradient(top,#5bc0de,#2f96b4);background-image:-webkit-gradient(linear,0 0,0 100%,from(#5bc0de),to(#2f96b4));background-image:-webkit-linear-gradient(top,#5bc0de,#2f96b4);background-image:-o-linear-gradient(top,#5bc0de,#2f96b4);background-image:-moz-linear-gradient(top,#5bc0de,#2f96b4);background-image:linear-gradient(top,#5bc0de,#2f96b4);background-repeat:repeat-x;border-color:#2f96b4 #2f96b4 #1f6377;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#5bc0de',endColorstr='#2f96b4',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false)}.btn-info:hover,.btn-info:active,.btn-info.active,.btn-info.disabled,.btn-info[disabled]{background-color:#2f96b4;*background-color:#2a85a0}.btn-info:active,.btn-info.active{background-color:#24748c \9}.btn-inverse{background-color:#414141;*background-color:#222;background-image:-ms-linear-gradient(top,#555,#222);background-image:-webkit-gradient(linear,0 0,0 100%,from(#555),to(#222));background-image:-webkit-linear-gradient(top,#555,#222);background-image:-o-linear-gradient(top,#555,#222);background-image:-moz-linear-gradient(top,#555,#222);background-image:linear-gradient(top,#555,#222);background-repeat:repeat-x;border-color:#222 #222 #000;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#555555',endColorstr='#222222',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false)}.btn-inverse:hover,.btn-inverse:active,.btn-inverse.active,.btn-inverse.disabled,.btn-inverse[disabled]{background-color:#222;*background-color:#151515}.btn-inverse:active,.btn-inverse.active{background-color:#080808 \9}button.btn,input[type="submit"].btn{*padding-top:2px;*padding-bottom:2px}button.btn::-moz-focus-inner,input[type="submit"].btn::-moz-focus-inner{padding:0;border:0}button.btn.btn-large,input[type="submit"].btn.btn-large{*padding-top:7px;*padding-bottom:7px}button.btn.btn-small,input[type="submit"].btn.btn-small{*padding-top:3px;*padding-bottom:3px}button.btn.btn-mini,input[type="submit"].btn.btn-mini{*padding-top:1px;*padding-bottom:1px}.btn-group{position:relative;*margin-left:.3em;*zoom:1}.btn-group:before,.btn-group:after{display:table;content:""}.btn-group:after{clear:both}.btn-group:first-child{*margin-left:0}.btn-group+.btn-group{margin-left:5px}.btn-toolbar{margin-top:9px;margin-bottom:9px}.btn-toolbar .btn-group{display:inline-block;*display:inline;*zoom:1}.btn-group>.btn{position:relative;float:left;margin-left:-1px;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.btn-group>.btn:first-child{margin-left:0;-webkit-border-bottom-left-radius:4px;border-bottom-left-radius:4px;-webkit-border-top-left-radius:4px;border-top-left-radius:4px;-moz-border-radius-bottomleft:4px;-moz-border-radius-topleft:4px}.btn-group>.btn:last-child,.btn-group>.dropdown-toggle{-webkit-border-top-right-radius:4px;border-top-right-radius:4px;-webkit-border-bottom-right-radius:4px;border-bottom-right-radius:4px;-moz-border-radius-topright:4px;-moz-border-radius-bottomright:4px}.btn-group>.btn.large:first-child{margin-left:0;-webkit-border-bottom-left-radius:6px;border-bottom-left-radius:6px;-webkit-border-top-left-radius:6px;border-top-left-radius:6px;-moz-border-radius-bottomleft:6px;-moz-border-radius-topleft:6px}.btn-group>.btn.large:last-child,.btn-group>.large.dropdown-toggle{-webkit-border-top-right-radius:6px;border-top-right-radius:6px;-webkit-border-bottom-right-radius:6px;border-bottom-right-radius:6px;-moz-border-radius-topright:6px;-moz-border-radius-bottomright:6px}.btn-group>.btn:hover,.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active{z-index:2}.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0}.btn-group>.dropdown-toggle{*padding-top:4px;padding-right:8px;*padding-bottom:4px;padding-left:8px;-webkit-box-shadow:inset 1px 0 0 rgba(255,255,255,0.125),inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 1px 0 0 rgba(255,255,255,0.125),inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 1px 0 0 rgba(255,255,255,0.125),inset 0 1px 0 rgba(255,255,255,0.2),0 1px 2px rgba(0,0,0,0.05)}.btn-group>.btn-mini.dropdown-toggle{padding-right:5px;padding-left:5px}.btn-group>.btn-small.dropdown-toggle{*padding-top:4px;*padding-bottom:4px}.btn-group>.btn-large.dropdown-toggle{padding-right:12px;padding-left:12px}.btn-group.open .dropdown-toggle{background-image:none;-webkit-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05);box-shadow:inset 0 2px 4px rgba(0,0,0,0.15),0 1px 2px rgba(0,0,0,0.05)}.btn-group.open .btn.dropdown-toggle{background-color:#e6e6e6}.btn-group.open .btn-primary.dropdown-toggle{background-color:#05c}.btn-group.open .btn-warning.dropdown-toggle{background-color:#f89406}.btn-group.open .btn-danger.dropdown-toggle{background-color:#bd362f}.btn-group.open .btn-success.dropdown-toggle{background-color:#51a351}.btn-group.open .btn-info.dropdown-toggle{background-color:#2f96b4}.btn-group.open .btn-inverse.dropdown-toggle{background-color:#222}.btn .caret{margin-top:7px;margin-left:0}.btn:hover .caret,.open.btn-group .caret{opacity:1;filter:alpha(opacity=100)}.btn-mini .caret{margin-top:5px}.btn-small .caret{margin-top:6px}.btn-large .caret{margin-top:6px;border-top-width:5px;border-right-width:5px;border-left-width:5px}.dropup .btn-large .caret{border-top:0;border-bottom:5px solid #000}.btn-primary .caret,.btn-warning .caret,.btn-danger .caret,.btn-info .caret,.btn-success .caret,.btn-inverse .caret{border-top-color:#fff;border-bottom-color:#fff;opacity:.75;filter:alpha(opacity=75)}.alert{padding:8px 35px 8px 14px;margin-bottom:18px;color:#c09853;text-shadow:0 1px 0 rgba(255,255,255,0.5);background-color:#fcf8e3;border:1px solid #fbeed5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.alert-heading{color:inherit}.alert .close{position:relative;top:-2px;right:-21px;line-height:18px}.alert-success{color:#468847;background-color:#dff0d8;border-color:#d6e9c6}.alert-danger,.alert-error{color:#b94a48;background-color:#f2dede;border-color:#eed3d7}.alert-info{color:#3a87ad;background-color:#d9edf7;border-color:#bce8f1}.alert-block{padding-top:14px;padding-bottom:14px}.alert-block>p,.alert-block>ul{margin-bottom:0}.alert-block p+p{margin-top:5px}.nav{margin-bottom:18px;margin-left:0;list-style:none}.nav>li>a{display:block}.nav>li>a:hover{text-decoration:none;background-color:#eee}.nav>.pull-right{float:right}.nav .nav-header{display:block;padding:3px 15px;font-size:11px;font-weight:bold;line-height:18px;color:#999;text-shadow:0 1px 0 rgba(255,255,255,0.5);text-transform:uppercase}.nav li+.nav-header{margin-top:9px}.nav-list{padding-right:15px;padding-left:15px;margin-bottom:0}.nav-list>li>a,.nav-list .nav-header{margin-right:-15px;margin-left:-15px;text-shadow:0 1px 0 rgba(255,255,255,0.5)}.nav-list>li>a{padding:3px 15px}.nav-list>.active>a,.nav-list>.active>a:hover{color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.2);background-color:#08c}.nav-list [class^="icon-"]{margin-right:2px}.nav-list .divider{*width:100%;height:1px;margin:8px 1px;*margin:-5px 0 5px;overflow:hidden;background-color:#e5e5e5;border-bottom:1px solid #fff}.nav-tabs,.nav-pills{*zoom:1}.nav-tabs:before,.nav-pills:before,.nav-tabs:after,.nav-pills:after{display:table;content:""}.nav-tabs:after,.nav-pills:after{clear:both}.nav-tabs>li,.nav-pills>li{float:left}.nav-tabs>li>a,.nav-pills>li>a{padding-right:12px;padding-left:12px;margin-right:2px;line-height:14px}.nav-tabs{border-bottom:1px solid #ddd}.nav-tabs>li{margin-bottom:-1px}.nav-tabs>li>a{padding-top:8px;padding-bottom:8px;line-height:18px;border:1px solid transparent;-webkit-border-radius:4px 4px 0 0;-moz-border-radius:4px 4px 0 0;border-radius:4px 4px 0 0}.nav-tabs>li>a:hover{border-color:#eee #eee #ddd}.nav-tabs>.active>a,.nav-tabs>.active>a:hover{color:#555;cursor:default;background-color:#fff;border:1px solid #ddd;border-bottom-color:transparent}.nav-pills>li>a{padding-top:8px;padding-bottom:8px;margin-top:2px;margin-bottom:2px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px}.nav-pills>.active>a,.nav-pills>.active>a:hover{color:#fff;background-color:#08c}.nav-stacked>li{float:none}.nav-stacked>li>a{margin-right:0}.nav-tabs.nav-stacked{border-bottom:0}.nav-tabs.nav-stacked>li>a{border:1px solid #ddd;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.nav-tabs.nav-stacked>li:first-child>a{-webkit-border-radius:4px 4px 0 0;-moz-border-radius:4px 4px 0 0;border-radius:4px 4px 0 0}.nav-tabs.nav-stacked>li:last-child>a{-webkit-border-radius:0 0 4px 4px;-moz-border-radius:0 0 4px 4px;border-radius:0 0 4px 4px}.nav-tabs.nav-stacked>li>a:hover{z-index:2;border-color:#ddd}.nav-pills.nav-stacked>li>a{margin-bottom:3px}.nav-pills.nav-stacked>li:last-child>a{margin-bottom:1px}.nav-tabs .dropdown-menu{-webkit-border-radius:0 0 5px 5px;-moz-border-radius:0 0 5px 5px;border-radius:0 0 5px 5px}.nav-pills .dropdown-menu{-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.nav-tabs .dropdown-toggle .caret,.nav-pills .dropdown-toggle .caret{margin-top:6px;border-top-color:#08c;border-bottom-color:#08c}.nav-tabs .dropdown-toggle:hover .caret,.nav-pills .dropdown-toggle:hover .caret{border-top-color:#005580;border-bottom-color:#005580}.nav-tabs .active .dropdown-toggle .caret,.nav-pills .active .dropdown-toggle .caret{border-top-color:#333;border-bottom-color:#333}.nav>.dropdown.active>a:hover{color:#000;cursor:pointer}.nav-tabs .open .dropdown-toggle,.nav-pills .open .dropdown-toggle,.nav>li.dropdown.open.active>a:hover{color:#fff;background-color:#999;border-color:#999}.nav li.dropdown.open .caret,.nav li.dropdown.open.active .caret,.nav li.dropdown.open a:hover .caret{border-top-color:#fff;border-bottom-color:#fff;opacity:1;filter:alpha(opacity=100)}.tabs-stacked .open>a:hover{border-color:#999}.tabbable{*zoom:1}.tabbable:before,.tabbable:after{display:table;content:""}.tabbable:after{clear:both}.tab-content{overflow:auto}.tabs-below>.nav-tabs,.tabs-right>.nav-tabs,.tabs-left>.nav-tabs{border-bottom:0}.tab-content>.tab-pane,.pill-content>.pill-pane{display:none}.tab-content>.active,.pill-content>.active{display:block}.tabs-below>.nav-tabs{border-top:1px solid #ddd}.tabs-below>.nav-tabs>li{margin-top:-1px;margin-bottom:0}.tabs-below>.nav-tabs>li>a{-webkit-border-radius:0 0 4px 4px;-moz-border-radius:0 0 4px 4px;border-radius:0 0 4px 4px}.tabs-below>.nav-tabs>li>a:hover{border-top-color:#ddd;border-bottom-color:transparent}.tabs-below>.nav-tabs>.active>a,.tabs-below>.nav-tabs>.active>a:hover{border-color:transparent #ddd #ddd #ddd}.tabs-left>.nav-tabs>li,.tabs-right>.nav-tabs>li{float:none}.tabs-left>.nav-tabs>li>a,.tabs-right>.nav-tabs>li>a{min-width:74px;margin-right:0;margin-bottom:3px}.tabs-left>.nav-tabs{float:left;margin-right:19px;border-right:1px solid #ddd}.tabs-left>.nav-tabs>li>a{margin-right:-1px;-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.tabs-left>.nav-tabs>li>a:hover{border-color:#eee #ddd #eee #eee}.tabs-left>.nav-tabs .active>a,.tabs-left>.nav-tabs .active>a:hover{border-color:#ddd transparent #ddd #ddd;*border-right-color:#fff}.tabs-right>.nav-tabs{float:right;margin-left:19px;border-left:1px solid #ddd}.tabs-right>.nav-tabs>li>a{margin-left:-1px;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.tabs-right>.nav-tabs>li>a:hover{border-color:#eee #eee #eee #ddd}.tabs-right>.nav-tabs .active>a,.tabs-right>.nav-tabs .active>a:hover{border-color:#ddd #ddd #ddd transparent;*border-left-color:#fff}.navbar{*position:relative;*z-index:2;margin-bottom:18px;overflow:visible}.navbar-inner{min-height:40px;padding-right:20px;padding-left:20px;background-color:#2c2c2c;background-image:-moz-linear-gradient(top,#333,#222);background-image:-ms-linear-gradient(top,#333,#222);background-image:-webkit-gradient(linear,0 0,0 100%,from(#333),to(#222));background-image:-webkit-linear-gradient(top,#333,#222);background-image:-o-linear-gradient(top,#333,#222);background-image:linear-gradient(top,#333,#222);background-repeat:repeat-x;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#333333',endColorstr='#222222',GradientType=0);-webkit-box-shadow:0 1px 3px rgba(0,0,0,0.25),inset 0 -1px 0 rgba(0,0,0,0.1);-moz-box-shadow:0 1px 3px rgba(0,0,0,0.25),inset 0 -1px 0 rgba(0,0,0,0.1);box-shadow:0 1px 3px rgba(0,0,0,0.25),inset 0 -1px 0 rgba(0,0,0,0.1)}.navbar .container{width:auto}.nav-collapse.collapse{height:auto}.navbar{color:#999}.navbar .brand:hover{text-decoration:none}.navbar .brand{display:block;float:left;padding:8px 20px 12px;margin-left:-20px;font-size:20px;font-weight:200;line-height:1;color:#999}.navbar .navbar-text{margin-bottom:0;line-height:40px}.navbar .navbar-link{color:#999}.navbar .navbar-link:hover{color:#fff}.navbar .btn,.navbar .btn-group{margin-top:5px}.navbar .btn-group .btn{margin:0}.navbar-form{margin-bottom:0;*zoom:1}.navbar-form:before,.navbar-form:after{display:table;content:""}.navbar-form:after{clear:both}.navbar-form input,.navbar-form select,.navbar-form .radio,.navbar-form .checkbox{margin-top:5px}.navbar-form input,.navbar-form select{display:inline-block;margin-bottom:0}.navbar-form input[type="image"],.navbar-form input[type="checkbox"],.navbar-form input[type="radio"]{margin-top:3px}.navbar-form .input-append,.navbar-form .input-prepend{margin-top:6px;white-space:nowrap}.navbar-form .input-append input,.navbar-form .input-prepend input{margin-top:0}.navbar-search{position:relative;float:left;margin-top:6px;margin-bottom:0}.navbar-search .search-query{padding:4px 9px;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:13px;font-weight:normal;line-height:1;color:#fff;background-color:#626262;border:1px solid #151515;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1),0 1px 0 rgba(255,255,255,0.15);-moz-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1),0 1px 0 rgba(255,255,255,0.15);box-shadow:inset 0 1px 2px rgba(0,0,0,0.1),0 1px 0 rgba(255,255,255,0.15);-webkit-transition:none;-moz-transition:none;-ms-transition:none;-o-transition:none;transition:none}.navbar-search .search-query:-moz-placeholder{color:#ccc}.navbar-search .search-query:-ms-input-placeholder{color:#ccc}.navbar-search .search-query::-webkit-input-placeholder{color:#ccc}.navbar-search .search-query:focus,.navbar-search .search-query.focused{padding:5px 10px;color:#333;text-shadow:0 1px 0 #fff;background-color:#fff;border:0;outline:0;-webkit-box-shadow:0 0 3px rgba(0,0,0,0.15);-moz-box-shadow:0 0 3px rgba(0,0,0,0.15);box-shadow:0 0 3px rgba(0,0,0,0.15)}.navbar-fixed-top,.navbar-fixed-bottom{position:fixed;right:0;left:0;z-index:1030;margin-bottom:0}.navbar-fixed-top .navbar-inner,.navbar-fixed-bottom .navbar-inner{padding-right:0;padding-left:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.navbar-fixed-top .container,.navbar-fixed-bottom .container{width:940px}.navbar-fixed-top{top:0}.navbar-fixed-bottom{bottom:0}.navbar .nav{position:relative;left:0;display:block;float:left;margin:0 10px 0 0}.navbar .nav.pull-right{float:right}.navbar .nav>li{display:block;float:left}.navbar .nav>li>a{float:none;padding:9px 10px 11px;line-height:19px;color:#999;text-decoration:none;text-shadow:0 -1px 0 rgba(0,0,0,0.25)}.navbar .btn{display:inline-block;padding:4px 10px 4px;margin:5px 5px 6px;line-height:18px}.navbar .btn-group{padding:5px 5px 6px;margin:0}.navbar .nav>li>a:hover{color:#fff;text-decoration:none;background-color:transparent}.navbar .nav .active>a,.navbar .nav .active>a:hover{color:#fff;text-decoration:none;background-color:#222}.navbar .divider-vertical{width:1px;height:40px;margin:0 9px;overflow:hidden;background-color:#222;border-right:1px solid #333}.navbar .nav.pull-right{margin-right:0;margin-left:10px}.navbar .btn-navbar{display:none;float:right;padding:7px 10px;margin-right:5px;margin-left:5px;background-color:#2c2c2c;*background-color:#222;background-image:-ms-linear-gradient(top,#333,#222);background-image:-webkit-gradient(linear,0 0,0 100%,from(#333),to(#222));background-image:-webkit-linear-gradient(top,#333,#222);background-image:-o-linear-gradient(top,#333,#222);background-image:linear-gradient(top,#333,#222);background-image:-moz-linear-gradient(top,#333,#222);background-repeat:repeat-x;border-color:#222 #222 #000;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25);filter:progid:dximagetransform.microsoft.gradient(startColorstr='#333333',endColorstr='#222222',GradientType=0);filter:progid:dximagetransform.microsoft.gradient(enabled=false);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.075);-moz-box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.075);box-shadow:inset 0 1px 0 rgba(255,255,255,0.1),0 1px 0 rgba(255,255,255,0.075)}.navbar .btn-navbar:hover,.navbar .btn-navbar:active,.navbar .btn-navbar.active,.navbar .btn-navbar.disabled,.navbar .btn-navbar[disabled]{background-color:#222;*background-color:#151515}.navbar .btn-navbar:active,.navbar .btn-navbar.active{background-color:#080808 \9}.navbar .btn-navbar .icon-bar{display:block;width:18px;height:2px;background-color:#f5f5f5;-webkit-border-radius:1px;-moz-border-radius:1px;border-radius:1px;-webkit-box-shadow:0 1px 0 rgba(0,0,0,0.25);-moz-box-shadow:0 1px 0 rgba(0,0,0,0.25);box-shadow:0 1px 0 rgba(0,0,0,0.25)}.btn-navbar .icon-bar+.icon-bar{margin-top:3px}.navbar .dropdown-menu:before{position:absolute;top:-7px;left:9px;display:inline-block;border-right:7px solid transparent;border-bottom:7px solid #ccc;border-left:7px solid transparent;border-bottom-color:rgba(0,0,0,0.2);content:''}.navbar .dropdown-menu:after{position:absolute;top:-6px;left:10px;display:inline-block;border-right:6px solid transparent;border-bottom:6px solid #fff;border-left:6px solid transparent;content:''}.navbar-fixed-bottom .dropdown-menu:before{top:auto;bottom:-7px;border-top:7px solid #ccc;border-bottom:0;border-top-color:rgba(0,0,0,0.2)}.navbar-fixed-bottom .dropdown-menu:after{top:auto;bottom:-6px;border-top:6px solid #fff;border-bottom:0}.navbar .nav li.dropdown .dropdown-toggle .caret,.navbar .nav li.dropdown.open .caret{border-top-color:#fff;border-bottom-color:#fff}.navbar .nav li.dropdown.active .caret{opacity:1;filter:alpha(opacity=100)}.navbar .nav li.dropdown.open>.dropdown-toggle,.navbar .nav li.dropdown.active>.dropdown-toggle,.navbar .nav li.dropdown.open.active>.dropdown-toggle{background-color:transparent}.navbar .nav li.dropdown.active>.dropdown-toggle:hover{color:#fff}.navbar .pull-right .dropdown-menu,.navbar .dropdown-menu.pull-right{right:0;left:auto}.navbar .pull-right .dropdown-menu:before,.navbar .dropdown-menu.pull-right:before{right:12px;left:auto}.navbar .pull-right .dropdown-menu:after,.navbar .dropdown-menu.pull-right:after{right:13px;left:auto}.breadcrumb{padding:7px 14px;margin:0 0 18px;list-style:none;background-color:#fbfbfb;background-image:-moz-linear-gradient(top,#fff,#f5f5f5);background-image:-ms-linear-gradient(top,#fff,#f5f5f5);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fff),to(#f5f5f5));background-image:-webkit-linear-gradient(top,#fff,#f5f5f5);background-image:-o-linear-gradient(top,#fff,#f5f5f5);background-image:linear-gradient(top,#fff,#f5f5f5);background-repeat:repeat-x;border:1px solid #ddd;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#ffffff',endColorstr='#f5f5f5',GradientType=0);-webkit-box-shadow:inset 0 1px 0 #fff;-moz-box-shadow:inset 0 1px 0 #fff;box-shadow:inset 0 1px 0 #fff}.breadcrumb li{display:inline-block;*display:inline;text-shadow:0 1px 0 #fff;*zoom:1}.breadcrumb .divider{padding:0 5px;color:#999}.breadcrumb .active a{color:#333}.pagination{height:36px;margin:18px 0}.pagination ul{display:inline-block;*display:inline;margin-bottom:0;margin-left:0;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;*zoom:1;-webkit-box-shadow:0 1px 2px rgba(0,0,0,0.05);-moz-box-shadow:0 1px 2px rgba(0,0,0,0.05);box-shadow:0 1px 2px rgba(0,0,0,0.05)}.pagination li{display:inline}.pagination a{float:left;padding:0 14px;line-height:34px;text-decoration:none;border:1px solid #ddd;border-left-width:0}.pagination a:hover,.pagination .active a{background-color:#f5f5f5}.pagination .active a{color:#999;cursor:default}.pagination .disabled span,.pagination .disabled a,.pagination .disabled a:hover{color:#999;cursor:default;background-color:transparent}.pagination li:first-child a{border-left-width:1px;-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px}.pagination li:last-child a{-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0}.pagination-centered{text-align:center}.pagination-right{text-align:right}.pager{margin-bottom:18px;margin-left:0;text-align:center;list-style:none;*zoom:1}.pager:before,.pager:after{display:table;content:""}.pager:after{clear:both}.pager li{display:inline}.pager a{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;-webkit-border-radius:15px;-moz-border-radius:15px;border-radius:15px}.pager a:hover{text-decoration:none;background-color:#f5f5f5}.pager .next a{float:right}.pager .previous a{float:left}.pager .disabled a,.pager .disabled a:hover{color:#999;cursor:default;background-color:#fff}.modal-open .dropdown-menu{z-index:2050}.modal-open .dropdown.open{*z-index:2050}.modal-open .popover{z-index:2060}.modal-open .tooltip{z-index:2070}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop,.modal-backdrop.fade.in{opacity:.8;filter:alpha(opacity=80)}.modal{position:fixed;top:50%;left:50%;z-index:1050;width:560px;margin:-250px 0 0 -280px;overflow:auto;background-color:#fff;border:1px solid #999;border:1px solid rgba(0,0,0,0.3);*border:1px solid #999;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 3px 7px rgba(0,0,0,0.3);-moz-box-shadow:0 3px 7px rgba(0,0,0,0.3);box-shadow:0 3px 7px rgba(0,0,0,0.3);-webkit-background-clip:padding-box;-moz-background-clip:padding-box;background-clip:padding-box}.modal.fade{top:-25%;-webkit-transition:opacity .3s linear,top .3s ease-out;-moz-transition:opacity .3s linear,top .3s ease-out;-ms-transition:opacity .3s linear,top .3s ease-out;-o-transition:opacity .3s linear,top .3s ease-out;transition:opacity .3s linear,top .3s ease-out}.modal.fade.in{top:50%}.modal-header{padding:9px 15px;border-bottom:1px solid #eee}.modal-header .close{margin-top:2px}.modal-body{max-height:400px;padding:15px;overflow-y:auto}.modal-form{margin-bottom:0}.modal-footer{padding:14px 15px 15px;margin-bottom:0;text-align:right;background-color:#f5f5f5;border-top:1px solid #ddd;-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px;*zoom:1;-webkit-box-shadow:inset 0 1px 0 #fff;-moz-box-shadow:inset 0 1px 0 #fff;box-shadow:inset 0 1px 0 #fff}.modal-footer:before,.modal-footer:after{display:table;content:""}.modal-footer:after{clear:both}.modal-footer .btn+.btn{margin-bottom:0;margin-left:5px}.modal-footer .btn-group .btn+.btn{margin-left:-1px}.tooltip{position:absolute;z-index:1020;display:block;padding:5px;font-size:11px;opacity:0;filter:alpha(opacity=0);visibility:visible}.tooltip.in{opacity:.8;filter:alpha(opacity=80)}.tooltip.top{margin-top:-2px}.tooltip.right{margin-left:2px}.tooltip.bottom{margin-top:2px}.tooltip.left{margin-left:-2px}.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-top:5px solid #000;border-right:5px solid transparent;border-left:5px solid transparent}.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-top:5px solid transparent;border-bottom:5px solid transparent;border-left:5px solid #000}.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-right:5px solid transparent;border-bottom:5px solid #000;border-left:5px solid transparent}.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-top:5px solid transparent;border-right:5px solid #000;border-bottom:5px solid transparent}.tooltip-inner{max-width:200px;padding:3px 8px;color:#fff;text-align:center;text-decoration:none;background-color:#000;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.tooltip-arrow{position:absolute;width:0;height:0}.popover{position:absolute;top:0;left:0;z-index:1010;display:none;padding:5px}.popover.top{margin-top:-5px}.popover.right{margin-left:5px}.popover.bottom{margin-top:5px}.popover.left{margin-left:-5px}.popover.top .arrow{bottom:0;left:50%;margin-left:-5px;border-top:5px solid #000;border-right:5px solid transparent;border-left:5px solid transparent}.popover.right .arrow{top:50%;left:0;margin-top:-5px;border-top:5px solid transparent;border-right:5px solid #000;border-bottom:5px solid transparent}.popover.bottom .arrow{top:0;left:50%;margin-left:-5px;border-right:5px solid transparent;border-bottom:5px solid #000;border-left:5px solid transparent}.popover.left .arrow{top:50%;right:0;margin-top:-5px;border-top:5px solid transparent;border-bottom:5px solid transparent;border-left:5px solid #000}.popover .arrow{position:absolute;width:0;height:0}.popover-inner{width:280px;padding:3px;overflow:hidden;background:#000;background:rgba(0,0,0,0.8);-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 3px 7px rgba(0,0,0,0.3);-moz-box-shadow:0 3px 7px rgba(0,0,0,0.3);box-shadow:0 3px 7px rgba(0,0,0,0.3)}.popover-title{padding:9px 15px;line-height:1;background-color:#f5f5f5;border-bottom:1px solid #eee;-webkit-border-radius:3px 3px 0 0;-moz-border-radius:3px 3px 0 0;border-radius:3px 3px 0 0}.popover-content{padding:14px;background-color:#fff;-webkit-border-radius:0 0 3px 3px;-moz-border-radius:0 0 3px 3px;border-radius:0 0 3px 3px;-webkit-background-clip:padding-box;-moz-background-clip:padding-box;background-clip:padding-box}.popover-content p,.popover-content ul,.popover-content ol{margin-bottom:0}.thumbnails{margin-left:-20px;list-style:none;*zoom:1}.thumbnails:before,.thumbnails:after{display:table;content:""}.thumbnails:after{clear:both}.row-fluid .thumbnails{margin-left:0}.thumbnails>li{float:left;margin-bottom:18px;margin-left:20px}.thumbnail{display:block;padding:4px;line-height:1;border:1px solid #ddd;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:0 1px 1px rgba(0,0,0,0.075);-moz-box-shadow:0 1px 1px rgba(0,0,0,0.075);box-shadow:0 1px 1px rgba(0,0,0,0.075)}a.thumbnail:hover{border-color:#08c;-webkit-box-shadow:0 1px 4px rgba(0,105,214,0.25);-moz-box-shadow:0 1px 4px rgba(0,105,214,0.25);box-shadow:0 1px 4px rgba(0,105,214,0.25)}.thumbnail>img{display:block;max-width:100%;margin-right:auto;margin-left:auto}.thumbnail .caption{padding:9px}.label,.badge{font-size:10.998px;font-weight:bold;line-height:14px;color:#fff;text-shadow:0 -1px 0 rgba(0,0,0,0.25);white-space:nowrap;vertical-align:baseline;background-color:#999}.label{padding:1px 4px 2px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.badge{padding:1px 9px 2px;-webkit-border-radius:9px;-moz-border-radius:9px;border-radius:9px}a.label:hover,a.badge:hover{color:#fff;text-decoration:none;cursor:pointer}.label-important,.badge-important{background-color:#b94a48}.label-important[href],.badge-important[href]{background-color:#953b39}.label-warning,.badge-warning{background-color:#f89406}.label-warning[href],.badge-warning[href]{background-color:#c67605}.label-success,.badge-success{background-color:#468847}.label-success[href],.badge-success[href]{background-color:#356635}.label-info,.badge-info{background-color:#3a87ad}.label-info[href],.badge-info[href]{background-color:#2d6987}.label-inverse,.badge-inverse{background-color:#333}.label-inverse[href],.badge-inverse[href]{background-color:#1a1a1a}@-webkit-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-moz-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-ms-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-o-keyframes progress-bar-stripes{from{background-position:0 0}to{background-position:40px 0}}@keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}.progress{height:18px;margin-bottom:18px;overflow:hidden;background-color:#f7f7f7;background-image:-moz-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:-ms-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:-webkit-gradient(linear,0 0,0 100%,from(#f5f5f5),to(#f9f9f9));background-image:-webkit-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:-o-linear-gradient(top,#f5f5f5,#f9f9f9);background-image:linear-gradient(top,#f5f5f5,#f9f9f9);background-repeat:repeat-x;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#f5f5f5',endColorstr='#f9f9f9',GradientType=0);-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1);-moz-box-shadow:inset 0 1px 2px rgba(0,0,0,0.1);box-shadow:inset 0 1px 2px rgba(0,0,0,0.1)}.progress .bar{width:0;height:18px;font-size:12px;color:#fff;text-align:center;text-shadow:0 -1px 0 rgba(0,0,0,0.25);background-color:#0e90d2;background-image:-moz-linear-gradient(top,#149bdf,#0480be);background-image:-webkit-gradient(linear,0 0,0 100%,from(#149bdf),to(#0480be));background-image:-webkit-linear-gradient(top,#149bdf,#0480be);background-image:-o-linear-gradient(top,#149bdf,#0480be);background-image:linear-gradient(top,#149bdf,#0480be);background-image:-ms-linear-gradient(top,#149bdf,#0480be);background-repeat:repeat-x;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#149bdf',endColorstr='#0480be',GradientType=0);-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);-moz-box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);box-shadow:inset 0 -1px 0 rgba(0,0,0,0.15);-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box;-webkit-transition:width .6s ease;-moz-transition:width .6s ease;-ms-transition:width .6s ease;-o-transition:width .6s ease;transition:width .6s ease}.progress-striped .bar{background-color:#149bdf;background-image:-o-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-webkit-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-ms-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);-webkit-background-size:40px 40px;-moz-background-size:40px 40px;-o-background-size:40px 40px;background-size:40px 40px}.progress.active .bar{-webkit-animation:progress-bar-stripes 2s linear infinite;-moz-animation:progress-bar-stripes 2s linear infinite;-ms-animation:progress-bar-stripes 2s linear infinite;-o-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite}.progress-danger .bar{background-color:#dd514c;background-image:-moz-linear-gradient(top,#ee5f5b,#c43c35);background-image:-ms-linear-gradient(top,#ee5f5b,#c43c35);background-image:-webkit-gradient(linear,0 0,0 100%,from(#ee5f5b),to(#c43c35));background-image:-webkit-linear-gradient(top,#ee5f5b,#c43c35);background-image:-o-linear-gradient(top,#ee5f5b,#c43c35);background-image:linear-gradient(top,#ee5f5b,#c43c35);background-repeat:repeat-x;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#ee5f5b',endColorstr='#c43c35',GradientType=0)}.progress-danger.progress-striped .bar{background-color:#ee5f5b;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-ms-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.progress-success .bar{background-color:#5eb95e;background-image:-moz-linear-gradient(top,#62c462,#57a957);background-image:-ms-linear-gradient(top,#62c462,#57a957);background-image:-webkit-gradient(linear,0 0,0 100%,from(#62c462),to(#57a957));background-image:-webkit-linear-gradient(top,#62c462,#57a957);background-image:-o-linear-gradient(top,#62c462,#57a957);background-image:linear-gradient(top,#62c462,#57a957);background-repeat:repeat-x;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#62c462',endColorstr='#57a957',GradientType=0)}.progress-success.progress-striped .bar{background-color:#62c462;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-ms-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.progress-info .bar{background-color:#4bb1cf;background-image:-moz-linear-gradient(top,#5bc0de,#339bb9);background-image:-ms-linear-gradient(top,#5bc0de,#339bb9);background-image:-webkit-gradient(linear,0 0,0 100%,from(#5bc0de),to(#339bb9));background-image:-webkit-linear-gradient(top,#5bc0de,#339bb9);background-image:-o-linear-gradient(top,#5bc0de,#339bb9);background-image:linear-gradient(top,#5bc0de,#339bb9);background-repeat:repeat-x;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#5bc0de',endColorstr='#339bb9',GradientType=0)}.progress-info.progress-striped .bar{background-color:#5bc0de;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-ms-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.progress-warning .bar{background-color:#faa732;background-image:-moz-linear-gradient(top,#fbb450,#f89406);background-image:-ms-linear-gradient(top,#fbb450,#f89406);background-image:-webkit-gradient(linear,0 0,0 100%,from(#fbb450),to(#f89406));background-image:-webkit-linear-gradient(top,#fbb450,#f89406);background-image:-o-linear-gradient(top,#fbb450,#f89406);background-image:linear-gradient(top,#fbb450,#f89406);background-repeat:repeat-x;filter:progid:dximagetransform.microsoft.gradient(startColorstr='#fbb450',endColorstr='#f89406',GradientType=0)}.progress-warning.progress-striped .bar{background-color:#fbb450;background-image:-webkit-gradient(linear,0 100%,100% 0,color-stop(0.25,rgba(255,255,255,0.15)),color-stop(0.25,transparent),color-stop(0.5,transparent),color-stop(0.5,rgba(255,255,255,0.15)),color-stop(0.75,rgba(255,255,255,0.15)),color-stop(0.75,transparent),to(transparent));background-image:-webkit-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-moz-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-ms-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(-45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent)}.accordion{margin-bottom:18px}.accordion-group{margin-bottom:2px;border:1px solid #e5e5e5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px}.accordion-heading{border-bottom:0}.accordion-heading .accordion-toggle{display:block;padding:8px 15px}.accordion-toggle{cursor:pointer}.accordion-inner{padding:9px 15px;border-top:1px solid #e5e5e5}.carousel{position:relative;margin-bottom:18px;line-height:1}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel .item{position:relative;display:none;-webkit-transition:.6s ease-in-out left;-moz-transition:.6s ease-in-out left;-ms-transition:.6s ease-in-out left;-o-transition:.6s ease-in-out left;transition:.6s ease-in-out left}.carousel .item>img{display:block;line-height:1}.carousel .active,.carousel .next,.carousel .prev{display:block}.carousel .active{left:0}.carousel .next,.carousel .prev{position:absolute;top:0;width:100%}.carousel .next{left:100%}.carousel .prev{left:-100%}.carousel .next.left,.carousel .prev.right{left:0}.carousel .active.left{left:-100%}.carousel .active.right{left:100%}.carousel-control{position:absolute;top:40%;left:15px;width:40px;height:40px;margin-top:-20px;font-size:60px;font-weight:100;line-height:30px;color:#fff;text-align:center;background:#222;border:3px solid #fff;-webkit-border-radius:23px;-moz-border-radius:23px;border-radius:23px;opacity:.5;filter:alpha(opacity=50)}.carousel-control.right{right:15px;left:auto}.carousel-control:hover{color:#fff;text-decoration:none;opacity:.9;filter:alpha(opacity=90)}.carousel-caption{position:absolute;right:0;bottom:0;left:0;padding:10px 15px 5px;background:#333;background:rgba(0,0,0,0.75)}.carousel-caption h4,.carousel-caption p{color:#fff}.hero-unit{padding:60px;margin-bottom:30px;background-color:#eee;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px}.hero-unit h1{margin-bottom:0;font-size:60px;line-height:1;letter-spacing:-1px;color:inherit}.hero-unit p{font-size:18px;font-weight:200;line-height:27px;color:inherit}.pull-right{float:right}.pull-left{float:left}.hide{display:none}.show{display:block}.invisible{visibility:hidden}
diff --git a/inst/web/css/highlight.css b/inst/web/css/highlight.css
new file mode 100644
index 0000000..4b85237
--- /dev/null
+++ b/inst/web/css/highlight.css
@@ -0,0 +1,28 @@
+/* Syntax highlighting ---------------------------------------------------- */
+
+pre .input {
+ border-left: 3px solid #ccc;
+ padding-left: 0.5em;
+}
+pre .output {
+ background-color: #eee;
+}
+
+.number {color:rgb(21,20,181);}
+.functioncall {color:#264D66 ;}
+.string {color:#375D81 ;}
+.keyword {font-weight:bolder ;color:black;}
+.argument {color:#264D66 ;}
+.comment {color: #333;}
+.formalargs {color: #264D66;}
+.eqformalargs {color:#264D66;}
+.slot {font-style:italic;}
+.symbol {color:black ;}
+.prompt {color:black ;}
+
+pre img {
+ background-color: #fff;
+ border: 1px solid #ccc;
+ display: block;
+ margin: 0.5em auto 0.5em auto;
+}
diff --git a/inst/web/css/staticdocs.css b/inst/web/css/staticdocs.css
new file mode 100644
index 0000000..9fee28b
--- /dev/null
+++ b/inst/web/css/staticdocs.css
@@ -0,0 +1,18 @@
+h2 {padding-top: 20px}
+
+.icon img {
+ float: right;
+ border: 1px solid #ccc;
+}
+.index .internal {display: none;}
+ul.index li {margin-bottom: 0.5em; clear: both;}
+
+footer {
+ margin-top: 45px;
+ padding: 35px 0 36px;
+ border-top: 1px solid #e5e5e5;
+}
+footer p {
+ margin-bottom: 0;
+ color: #555;
+}
diff --git a/inst/web/draw_svg.chent.html b/inst/web/draw_svg.chent.html
new file mode 100644
index 0000000..fe485a8
--- /dev/null
+++ b/inst/web/draw_svg.chent.html
@@ -0,0 +1,96 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>draw_svg.chent. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>Draw SVG graph from a chent object using RDKit</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>draw_svg.chent(x, width&nbsp;=&nbsp;300, height&nbsp;=&nbsp;150, filename&nbsp;=&nbsp;paste0(names(x$identifier), ".svg"), subdir&nbsp;=&nbsp;"svg")</div></pre>
+
+ <h2>Arguments</h2>
+ <dl>
+ <dt>x</dt>
+ <dd>The chent object to be plotted</dd>
+ <dt>width</dt>
+ <dd>The desired width in pixels</dd>
+ <dt>height</dt>
+ <dd>The desired height in pixels</dd>
+ <dt>filename</dt>
+ <dd>The filename</dd>
+ <dt>subdir</dt>
+ <dd>The path to which the file should be written</dd>
+ </dl>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>Draw SVG graph from a chent object using RDKit</p>
+
+ </div>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>draw_svg.chent</li>
+ </ul>
+ <ul>
+
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/img/glyphicons-halflings-white.png b/inst/web/img/glyphicons-halflings-white.png
new file mode 100644
index 0000000..3bf6484
--- /dev/null
+++ b/inst/web/img/glyphicons-halflings-white.png
Binary files differ
diff --git a/inst/web/img/glyphicons-halflings.png b/inst/web/img/glyphicons-halflings.png
new file mode 100644
index 0000000..79bc568
--- /dev/null
+++ b/inst/web/img/glyphicons-halflings.png
Binary files differ
diff --git a/inst/web/index.html b/inst/web/index.html
new file mode 100644
index 0000000..ec9bf28
--- /dev/null
+++ b/inst/web/index.html
@@ -0,0 +1,134 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>Index. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <div class="row">
+ <div class="span8">
+ <h1>chents</h1>
+
+<p>The R package <strong>chents</strong> provides some utilities for working with chemical
+entities in R, made available under the GNU public license.
+This means:</p>
+
+<pre><code>This program is free software: you can redistribute it and/or modify it under
+the terms of the GNU General Public License as published by the Free Software
+Foundation, either version 3 of the License, or (at your option) any later
+version.
+
+This program is distributed in the hope that it will be useful, but WITHOUT
+ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
+details.
+
+You should have received a copy of the GNU General Public License along with
+this program. If not, see &lt;http://www.gnu.org/licenses/&gt;
+</code></pre>
+
+
+ <h2>Help topics</h2>
+
+ <h3>Class definitions</h3>
+ <p>R6 classes and their methods</p>
+
+
+ <ul class="index">
+
+ <li>
+ <code><a href="chent.html">chent</a></code><br />An R6 class for chemical entities with associated data</li>
+
+ <li>
+ <code><a href="pai.html">pai</a></code><br />An R6 class for pesticidal active ingredients and associated data</li>
+
+ </ul>
+ <h3>Other</h3>
+
+
+ <ul class="index">
+
+ <li>
+ <code><a href="draw_svg.chent.html">draw_svg.chent</a></code><br />Draw SVG graph from a chent object using RDKit</li>
+
+ <li>
+ <code><a href="plot.chent.html">plot.chent</a></code><br />Plot method for chent objects</li>
+
+ <li>
+ <code><a href="pp.html">pp</a></code><br />R6 class for holding a product with at least one active ingredient</li>
+
+ <li>
+ <code><a href="print.chent.html">print.chent</a></code><br />Printing method for chent objects</li>
+
+ <li>
+ <code><a href="print.pai.html">print.pai</a></code><br />Printing method for pai objects (pesticidal active ingredients)</li>
+
+ </ul>
+ </div>
+
+ <div class="span3 offset1">
+
+ <h2>Dependencies</h2>
+ <ul>
+
+ <li><strong>Imports</strong>: webchem, R6, grImport, PythonInR</li>
+ <li><strong>Suggests</strong>: knitr, testthat</li>
+
+ </ul>
+ <h2>Authors</h2>
+ <ul>
+ <li><a href="mailto:jranke@uni-bremen.de">Johannes Ranke</a> [aut, cre, cph]</li>
+ </ul>
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/js/bootstrap.js b/inst/web/js/bootstrap.js
new file mode 100644
index 0000000..5d6e65b
--- /dev/null
+++ b/inst/web/js/bootstrap.js
@@ -0,0 +1,1825 @@
+/* ===================================================
+ * bootstrap-transition.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#transitions
+ * ===================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ $(function () {
+
+ "use strict"; // jshint ;_;
+
+
+ /* CSS TRANSITION SUPPORT (http://www.modernizr.com/)
+ * ======================================================= */
+
+ $.support.transition = (function () {
+
+ var transitionEnd = (function () {
+
+ var el = document.createElement('bootstrap')
+ , transEndEventNames = {
+ 'WebkitTransition' : 'webkitTransitionEnd'
+ , 'MozTransition' : 'transitionend'
+ , 'OTransition' : 'oTransitionEnd'
+ , 'msTransition' : 'MSTransitionEnd'
+ , 'transition' : 'transitionend'
+ }
+ , name
+
+ for (name in transEndEventNames){
+ if (el.style[name] !== undefined) {
+ return transEndEventNames[name]
+ }
+ }
+
+ }())
+
+ return transitionEnd && {
+ end: transitionEnd
+ }
+
+ })()
+
+ })
+
+}(window.jQuery);/* ==========================================================
+ * bootstrap-alert.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#alerts
+ * ==========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* ALERT CLASS DEFINITION
+ * ====================== */
+
+ var dismiss = '[data-dismiss="alert"]'
+ , Alert = function (el) {
+ $(el).on('click', dismiss, this.close)
+ }
+
+ Alert.prototype.close = function (e) {
+ var $this = $(this)
+ , selector = $this.attr('data-target')
+ , $parent
+
+ if (!selector) {
+ selector = $this.attr('href')
+ selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+ }
+
+ $parent = $(selector)
+
+ e && e.preventDefault()
+
+ $parent.length || ($parent = $this.hasClass('alert') ? $this : $this.parent())
+
+ $parent.trigger(e = $.Event('close'))
+
+ if (e.isDefaultPrevented()) return
+
+ $parent.removeClass('in')
+
+ function removeElement() {
+ $parent
+ .trigger('closed')
+ .remove()
+ }
+
+ $.support.transition && $parent.hasClass('fade') ?
+ $parent.on($.support.transition.end, removeElement) :
+ removeElement()
+ }
+
+
+ /* ALERT PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.alert = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('alert')
+ if (!data) $this.data('alert', (data = new Alert(this)))
+ if (typeof option == 'string') data[option].call($this)
+ })
+ }
+
+ $.fn.alert.Constructor = Alert
+
+
+ /* ALERT DATA-API
+ * ============== */
+
+ $(function () {
+ $('body').on('click.alert.data-api', dismiss, Alert.prototype.close)
+ })
+
+}(window.jQuery);/* ============================================================
+ * bootstrap-button.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#buttons
+ * ============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* BUTTON PUBLIC CLASS DEFINITION
+ * ============================== */
+
+ var Button = function (element, options) {
+ this.$element = $(element)
+ this.options = $.extend({}, $.fn.button.defaults, options)
+ }
+
+ Button.prototype.setState = function (state) {
+ var d = 'disabled'
+ , $el = this.$element
+ , data = $el.data()
+ , val = $el.is('input') ? 'val' : 'html'
+
+ state = state + 'Text'
+ data.resetText || $el.data('resetText', $el[val]())
+
+ $el[val](data[state] || this.options[state])
+
+ // push to event loop to allow forms to submit
+ setTimeout(function () {
+ state == 'loadingText' ?
+ $el.addClass(d).attr(d, d) :
+ $el.removeClass(d).removeAttr(d)
+ }, 0)
+ }
+
+ Button.prototype.toggle = function () {
+ var $parent = this.$element.parent('[data-toggle="buttons-radio"]')
+
+ $parent && $parent
+ .find('.active')
+ .removeClass('active')
+
+ this.$element.toggleClass('active')
+ }
+
+
+ /* BUTTON PLUGIN DEFINITION
+ * ======================== */
+
+ $.fn.button = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('button')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('button', (data = new Button(this, options)))
+ if (option == 'toggle') data.toggle()
+ else if (option) data.setState(option)
+ })
+ }
+
+ $.fn.button.defaults = {
+ loadingText: 'loading...'
+ }
+
+ $.fn.button.Constructor = Button
+
+
+ /* BUTTON DATA-API
+ * =============== */
+
+ $(function () {
+ $('body').on('click.button.data-api', '[data-toggle^=button]', function ( e ) {
+ var $btn = $(e.target)
+ if (!$btn.hasClass('btn')) $btn = $btn.closest('.btn')
+ $btn.button('toggle')
+ })
+ })
+
+}(window.jQuery);/* ==========================================================
+ * bootstrap-carousel.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#carousel
+ * ==========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* CAROUSEL CLASS DEFINITION
+ * ========================= */
+
+ var Carousel = function (element, options) {
+ this.$element = $(element)
+ this.options = options
+ this.options.slide && this.slide(this.options.slide)
+ this.options.pause == 'hover' && this.$element
+ .on('mouseenter', $.proxy(this.pause, this))
+ .on('mouseleave', $.proxy(this.cycle, this))
+ }
+
+ Carousel.prototype = {
+
+ cycle: function (e) {
+ if (!e) this.paused = false
+ this.options.interval
+ && !this.paused
+ && (this.interval = setInterval($.proxy(this.next, this), this.options.interval))
+ return this
+ }
+
+ , to: function (pos) {
+ var $active = this.$element.find('.active')
+ , children = $active.parent().children()
+ , activePos = children.index($active)
+ , that = this
+
+ if (pos > (children.length - 1) || pos < 0) return
+
+ if (this.sliding) {
+ return this.$element.one('slid', function () {
+ that.to(pos)
+ })
+ }
+
+ if (activePos == pos) {
+ return this.pause().cycle()
+ }
+
+ return this.slide(pos > activePos ? 'next' : 'prev', $(children[pos]))
+ }
+
+ , pause: function (e) {
+ if (!e) this.paused = true
+ clearInterval(this.interval)
+ this.interval = null
+ return this
+ }
+
+ , next: function () {
+ if (this.sliding) return
+ return this.slide('next')
+ }
+
+ , prev: function () {
+ if (this.sliding) return
+ return this.slide('prev')
+ }
+
+ , slide: function (type, next) {
+ var $active = this.$element.find('.active')
+ , $next = next || $active[type]()
+ , isCycling = this.interval
+ , direction = type == 'next' ? 'left' : 'right'
+ , fallback = type == 'next' ? 'first' : 'last'
+ , that = this
+ , e = $.Event('slide')
+
+ this.sliding = true
+
+ isCycling && this.pause()
+
+ $next = $next.length ? $next : this.$element.find('.item')[fallback]()
+
+ if ($next.hasClass('active')) return
+
+ if ($.support.transition && this.$element.hasClass('slide')) {
+ this.$element.trigger(e)
+ if (e.isDefaultPrevented()) return
+ $next.addClass(type)
+ $next[0].offsetWidth // force reflow
+ $active.addClass(direction)
+ $next.addClass(direction)
+ this.$element.one($.support.transition.end, function () {
+ $next.removeClass([type, direction].join(' ')).addClass('active')
+ $active.removeClass(['active', direction].join(' '))
+ that.sliding = false
+ setTimeout(function () { that.$element.trigger('slid') }, 0)
+ })
+ } else {
+ this.$element.trigger(e)
+ if (e.isDefaultPrevented()) return
+ $active.removeClass('active')
+ $next.addClass('active')
+ this.sliding = false
+ this.$element.trigger('slid')
+ }
+
+ isCycling && this.cycle()
+
+ return this
+ }
+
+ }
+
+
+ /* CAROUSEL PLUGIN DEFINITION
+ * ========================== */
+
+ $.fn.carousel = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('carousel')
+ , options = $.extend({}, $.fn.carousel.defaults, typeof option == 'object' && option)
+ if (!data) $this.data('carousel', (data = new Carousel(this, options)))
+ if (typeof option == 'number') data.to(option)
+ else if (typeof option == 'string' || (option = options.slide)) data[option]()
+ else if (options.interval) data.cycle()
+ })
+ }
+
+ $.fn.carousel.defaults = {
+ interval: 5000
+ , pause: 'hover'
+ }
+
+ $.fn.carousel.Constructor = Carousel
+
+
+ /* CAROUSEL DATA-API
+ * ================= */
+
+ $(function () {
+ $('body').on('click.carousel.data-api', '[data-slide]', function ( e ) {
+ var $this = $(this), href
+ , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
+ , options = !$target.data('modal') && $.extend({}, $target.data(), $this.data())
+ $target.carousel(options)
+ e.preventDefault()
+ })
+ })
+
+}(window.jQuery);/* =============================================================
+ * bootstrap-collapse.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#collapse
+ * =============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* COLLAPSE PUBLIC CLASS DEFINITION
+ * ================================ */
+
+ var Collapse = function (element, options) {
+ this.$element = $(element)
+ this.options = $.extend({}, $.fn.collapse.defaults, options)
+
+ if (this.options.parent) {
+ this.$parent = $(this.options.parent)
+ }
+
+ this.options.toggle && this.toggle()
+ }
+
+ Collapse.prototype = {
+
+ constructor: Collapse
+
+ , dimension: function () {
+ var hasWidth = this.$element.hasClass('width')
+ return hasWidth ? 'width' : 'height'
+ }
+
+ , show: function () {
+ var dimension
+ , scroll
+ , actives
+ , hasData
+
+ if (this.transitioning) return
+
+ dimension = this.dimension()
+ scroll = $.camelCase(['scroll', dimension].join('-'))
+ actives = this.$parent && this.$parent.find('> .accordion-group > .in')
+
+ if (actives && actives.length) {
+ hasData = actives.data('collapse')
+ if (hasData && hasData.transitioning) return
+ actives.collapse('hide')
+ hasData || actives.data('collapse', null)
+ }
+
+ this.$element[dimension](0)
+ this.transition('addClass', $.Event('show'), 'shown')
+ this.$element[dimension](this.$element[0][scroll])
+ }
+
+ , hide: function () {
+ var dimension
+ if (this.transitioning) return
+ dimension = this.dimension()
+ this.reset(this.$element[dimension]())
+ this.transition('removeClass', $.Event('hide'), 'hidden')
+ this.$element[dimension](0)
+ }
+
+ , reset: function (size) {
+ var dimension = this.dimension()
+
+ this.$element
+ .removeClass('collapse')
+ [dimension](size || 'auto')
+ [0].offsetWidth
+
+ this.$element[size !== null ? 'addClass' : 'removeClass']('collapse')
+
+ return this
+ }
+
+ , transition: function (method, startEvent, completeEvent) {
+ var that = this
+ , complete = function () {
+ if (startEvent.type == 'show') that.reset()
+ that.transitioning = 0
+ that.$element.trigger(completeEvent)
+ }
+
+ this.$element.trigger(startEvent)
+
+ if (startEvent.isDefaultPrevented()) return
+
+ this.transitioning = 1
+
+ this.$element[method]('in')
+
+ $.support.transition && this.$element.hasClass('collapse') ?
+ this.$element.one($.support.transition.end, complete) :
+ complete()
+ }
+
+ , toggle: function () {
+ this[this.$element.hasClass('in') ? 'hide' : 'show']()
+ }
+
+ }
+
+
+ /* COLLAPSIBLE PLUGIN DEFINITION
+ * ============================== */
+
+ $.fn.collapse = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('collapse')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('collapse', (data = new Collapse(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.collapse.defaults = {
+ toggle: true
+ }
+
+ $.fn.collapse.Constructor = Collapse
+
+
+ /* COLLAPSIBLE DATA-API
+ * ==================== */
+
+ $(function () {
+ $('body').on('click.collapse.data-api', '[data-toggle=collapse]', function ( e ) {
+ var $this = $(this), href
+ , target = $this.attr('data-target')
+ || e.preventDefault()
+ || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') //strip for ie7
+ , option = $(target).data('collapse') ? 'toggle' : $this.data()
+ $(target).collapse(option)
+ })
+ })
+
+}(window.jQuery);/* ============================================================
+ * bootstrap-dropdown.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#dropdowns
+ * ============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* DROPDOWN CLASS DEFINITION
+ * ========================= */
+
+ var toggle = '[data-toggle="dropdown"]'
+ , Dropdown = function (element) {
+ var $el = $(element).on('click.dropdown.data-api', this.toggle)
+ $('html').on('click.dropdown.data-api', function () {
+ $el.parent().removeClass('open')
+ })
+ }
+
+ Dropdown.prototype = {
+
+ constructor: Dropdown
+
+ , toggle: function (e) {
+ var $this = $(this)
+ , $parent
+ , selector
+ , isActive
+
+ if ($this.is('.disabled, :disabled')) return
+
+ selector = $this.attr('data-target')
+
+ if (!selector) {
+ selector = $this.attr('href')
+ selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+ }
+
+ $parent = $(selector)
+ $parent.length || ($parent = $this.parent())
+
+ isActive = $parent.hasClass('open')
+
+ clearMenus()
+
+ if (!isActive) $parent.toggleClass('open')
+
+ return false
+ }
+
+ }
+
+ function clearMenus() {
+ $(toggle).parent().removeClass('open')
+ }
+
+
+ /* DROPDOWN PLUGIN DEFINITION
+ * ========================== */
+
+ $.fn.dropdown = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('dropdown')
+ if (!data) $this.data('dropdown', (data = new Dropdown(this)))
+ if (typeof option == 'string') data[option].call($this)
+ })
+ }
+
+ $.fn.dropdown.Constructor = Dropdown
+
+
+ /* APPLY TO STANDARD DROPDOWN ELEMENTS
+ * =================================== */
+
+ $(function () {
+ $('html').on('click.dropdown.data-api', clearMenus)
+ $('body')
+ .on('click.dropdown', '.dropdown form', function (e) { e.stopPropagation() })
+ .on('click.dropdown.data-api', toggle, Dropdown.prototype.toggle)
+ })
+
+}(window.jQuery);/* =========================================================
+ * bootstrap-modal.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#modals
+ * =========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================= */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* MODAL CLASS DEFINITION
+ * ====================== */
+
+ var Modal = function (content, options) {
+ this.options = options
+ this.$element = $(content)
+ .delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this))
+ }
+
+ Modal.prototype = {
+
+ constructor: Modal
+
+ , toggle: function () {
+ return this[!this.isShown ? 'show' : 'hide']()
+ }
+
+ , show: function () {
+ var that = this
+ , e = $.Event('show')
+
+ this.$element.trigger(e)
+
+ if (this.isShown || e.isDefaultPrevented()) return
+
+ $('body').addClass('modal-open')
+
+ this.isShown = true
+
+ escape.call(this)
+ backdrop.call(this, function () {
+ var transition = $.support.transition && that.$element.hasClass('fade')
+
+ if (!that.$element.parent().length) {
+ that.$element.appendTo(document.body) //don't move modals dom position
+ }
+
+ that.$element
+ .show()
+
+ if (transition) {
+ that.$element[0].offsetWidth // force reflow
+ }
+
+ that.$element.addClass('in')
+
+ transition ?
+ that.$element.one($.support.transition.end, function () { that.$element.trigger('shown') }) :
+ that.$element.trigger('shown')
+
+ })
+ }
+
+ , hide: function (e) {
+ e && e.preventDefault()
+
+ var that = this
+
+ e = $.Event('hide')
+
+ this.$element.trigger(e)
+
+ if (!this.isShown || e.isDefaultPrevented()) return
+
+ this.isShown = false
+
+ $('body').removeClass('modal-open')
+
+ escape.call(this)
+
+ this.$element.removeClass('in')
+
+ $.support.transition && this.$element.hasClass('fade') ?
+ hideWithTransition.call(this) :
+ hideModal.call(this)
+ }
+
+ }
+
+
+ /* MODAL PRIVATE METHODS
+ * ===================== */
+
+ function hideWithTransition() {
+ var that = this
+ , timeout = setTimeout(function () {
+ that.$element.off($.support.transition.end)
+ hideModal.call(that)
+ }, 500)
+
+ this.$element.one($.support.transition.end, function () {
+ clearTimeout(timeout)
+ hideModal.call(that)
+ })
+ }
+
+ function hideModal(that) {
+ this.$element
+ .hide()
+ .trigger('hidden')
+
+ backdrop.call(this)
+ }
+
+ function backdrop(callback) {
+ var that = this
+ , animate = this.$element.hasClass('fade') ? 'fade' : ''
+
+ if (this.isShown && this.options.backdrop) {
+ var doAnimate = $.support.transition && animate
+
+ this.$backdrop = $('<div class="modal-backdrop ' + animate + '" />')
+ .appendTo(document.body)
+
+ if (this.options.backdrop != 'static') {
+ this.$backdrop.click($.proxy(this.hide, this))
+ }
+
+ if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
+
+ this.$backdrop.addClass('in')
+
+ doAnimate ?
+ this.$backdrop.one($.support.transition.end, callback) :
+ callback()
+
+ } else if (!this.isShown && this.$backdrop) {
+ this.$backdrop.removeClass('in')
+
+ $.support.transition && this.$element.hasClass('fade')?
+ this.$backdrop.one($.support.transition.end, $.proxy(removeBackdrop, this)) :
+ removeBackdrop.call(this)
+
+ } else if (callback) {
+ callback()
+ }
+ }
+
+ function removeBackdrop() {
+ this.$backdrop.remove()
+ this.$backdrop = null
+ }
+
+ function escape() {
+ var that = this
+ if (this.isShown && this.options.keyboard) {
+ $(document).on('keyup.dismiss.modal', function ( e ) {
+ e.which == 27 && that.hide()
+ })
+ } else if (!this.isShown) {
+ $(document).off('keyup.dismiss.modal')
+ }
+ }
+
+
+ /* MODAL PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.modal = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('modal')
+ , options = $.extend({}, $.fn.modal.defaults, $this.data(), typeof option == 'object' && option)
+ if (!data) $this.data('modal', (data = new Modal(this, options)))
+ if (typeof option == 'string') data[option]()
+ else if (options.show) data.show()
+ })
+ }
+
+ $.fn.modal.defaults = {
+ backdrop: true
+ , keyboard: true
+ , show: true
+ }
+
+ $.fn.modal.Constructor = Modal
+
+
+ /* MODAL DATA-API
+ * ============== */
+
+ $(function () {
+ $('body').on('click.modal.data-api', '[data-toggle="modal"]', function ( e ) {
+ var $this = $(this), href
+ , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
+ , option = $target.data('modal') ? 'toggle' : $.extend({}, $target.data(), $this.data())
+
+ e.preventDefault()
+ $target.modal(option)
+ })
+ })
+
+}(window.jQuery);/* ===========================================================
+ * bootstrap-tooltip.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#tooltips
+ * Inspired by the original jQuery.tipsy by Jason Frame
+ * ===========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* TOOLTIP PUBLIC CLASS DEFINITION
+ * =============================== */
+
+ var Tooltip = function (element, options) {
+ this.init('tooltip', element, options)
+ }
+
+ Tooltip.prototype = {
+
+ constructor: Tooltip
+
+ , init: function (type, element, options) {
+ var eventIn
+ , eventOut
+
+ this.type = type
+ this.$element = $(element)
+ this.options = this.getOptions(options)
+ this.enabled = true
+
+ if (this.options.trigger != 'manual') {
+ eventIn = this.options.trigger == 'hover' ? 'mouseenter' : 'focus'
+ eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur'
+ this.$element.on(eventIn, this.options.selector, $.proxy(this.enter, this))
+ this.$element.on(eventOut, this.options.selector, $.proxy(this.leave, this))
+ }
+
+ this.options.selector ?
+ (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
+ this.fixTitle()
+ }
+
+ , getOptions: function (options) {
+ options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data())
+
+ if (options.delay && typeof options.delay == 'number') {
+ options.delay = {
+ show: options.delay
+ , hide: options.delay
+ }
+ }
+
+ return options
+ }
+
+ , enter: function (e) {
+ var self = $(e.currentTarget)[this.type](this._options).data(this.type)
+
+ if (!self.options.delay || !self.options.delay.show) return self.show()
+
+ clearTimeout(this.timeout)
+ self.hoverState = 'in'
+ this.timeout = setTimeout(function() {
+ if (self.hoverState == 'in') self.show()
+ }, self.options.delay.show)
+ }
+
+ , leave: function (e) {
+ var self = $(e.currentTarget)[this.type](this._options).data(this.type)
+
+ if (this.timeout) clearTimeout(this.timeout)
+ if (!self.options.delay || !self.options.delay.hide) return self.hide()
+
+ self.hoverState = 'out'
+ this.timeout = setTimeout(function() {
+ if (self.hoverState == 'out') self.hide()
+ }, self.options.delay.hide)
+ }
+
+ , show: function () {
+ var $tip
+ , inside
+ , pos
+ , actualWidth
+ , actualHeight
+ , placement
+ , tp
+
+ if (this.hasContent() && this.enabled) {
+ $tip = this.tip()
+ this.setContent()
+
+ if (this.options.animation) {
+ $tip.addClass('fade')
+ }
+
+ placement = typeof this.options.placement == 'function' ?
+ this.options.placement.call(this, $tip[0], this.$element[0]) :
+ this.options.placement
+
+ inside = /in/.test(placement)
+
+ $tip
+ .remove()
+ .css({ top: 0, left: 0, display: 'block' })
+ .appendTo(inside ? this.$element : document.body)
+
+ pos = this.getPosition(inside)
+
+ actualWidth = $tip[0].offsetWidth
+ actualHeight = $tip[0].offsetHeight
+
+ switch (inside ? placement.split(' ')[1] : placement) {
+ case 'bottom':
+ tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2}
+ break
+ case 'top':
+ tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2}
+ break
+ case 'left':
+ tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth}
+ break
+ case 'right':
+ tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width}
+ break
+ }
+
+ $tip
+ .css(tp)
+ .addClass(placement)
+ .addClass('in')
+ }
+ }
+
+ , isHTML: function(text) {
+ // html string detection logic adapted from jQuery
+ return typeof text != 'string'
+ || ( text.charAt(0) === "<"
+ && text.charAt( text.length - 1 ) === ">"
+ && text.length >= 3
+ ) || /^(?:[^<]*<[\w\W]+>[^>]*$)/.exec(text)
+ }
+
+ , setContent: function () {
+ var $tip = this.tip()
+ , title = this.getTitle()
+
+ $tip.find('.tooltip-inner')[this.isHTML(title) ? 'html' : 'text'](title)
+ $tip.removeClass('fade in top bottom left right')
+ }
+
+ , hide: function () {
+ var that = this
+ , $tip = this.tip()
+
+ $tip.removeClass('in')
+
+ function removeWithAnimation() {
+ var timeout = setTimeout(function () {
+ $tip.off($.support.transition.end).remove()
+ }, 500)
+
+ $tip.one($.support.transition.end, function () {
+ clearTimeout(timeout)
+ $tip.remove()
+ })
+ }
+
+ $.support.transition && this.$tip.hasClass('fade') ?
+ removeWithAnimation() :
+ $tip.remove()
+ }
+
+ , fixTitle: function () {
+ var $e = this.$element
+ if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') {
+ $e.attr('data-original-title', $e.attr('title') || '').removeAttr('title')
+ }
+ }
+
+ , hasContent: function () {
+ return this.getTitle()
+ }
+
+ , getPosition: function (inside) {
+ return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), {
+ width: this.$element[0].offsetWidth
+ , height: this.$element[0].offsetHeight
+ })
+ }
+
+ , getTitle: function () {
+ var title
+ , $e = this.$element
+ , o = this.options
+
+ title = $e.attr('data-original-title')
+ || (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)
+
+ return title
+ }
+
+ , tip: function () {
+ return this.$tip = this.$tip || $(this.options.template)
+ }
+
+ , validate: function () {
+ if (!this.$element[0].parentNode) {
+ this.hide()
+ this.$element = null
+ this.options = null
+ }
+ }
+
+ , enable: function () {
+ this.enabled = true
+ }
+
+ , disable: function () {
+ this.enabled = false
+ }
+
+ , toggleEnabled: function () {
+ this.enabled = !this.enabled
+ }
+
+ , toggle: function () {
+ this[this.tip().hasClass('in') ? 'hide' : 'show']()
+ }
+
+ }
+
+
+ /* TOOLTIP PLUGIN DEFINITION
+ * ========================= */
+
+ $.fn.tooltip = function ( option ) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('tooltip')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('tooltip', (data = new Tooltip(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.tooltip.Constructor = Tooltip
+
+ $.fn.tooltip.defaults = {
+ animation: true
+ , placement: 'top'
+ , selector: false
+ , template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>'
+ , trigger: 'hover'
+ , title: ''
+ , delay: 0
+ }
+
+}(window.jQuery);
+/* ===========================================================
+ * bootstrap-popover.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#popovers
+ * ===========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * =========================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* POPOVER PUBLIC CLASS DEFINITION
+ * =============================== */
+
+ var Popover = function ( element, options ) {
+ this.init('popover', element, options)
+ }
+
+
+ /* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js
+ ========================================== */
+
+ Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, {
+
+ constructor: Popover
+
+ , setContent: function () {
+ var $tip = this.tip()
+ , title = this.getTitle()
+ , content = this.getContent()
+
+ $tip.find('.popover-title')[this.isHTML(title) ? 'html' : 'text'](title)
+ $tip.find('.popover-content > *')[this.isHTML(content) ? 'html' : 'text'](content)
+
+ $tip.removeClass('fade top bottom left right in')
+ }
+
+ , hasContent: function () {
+ return this.getTitle() || this.getContent()
+ }
+
+ , getContent: function () {
+ var content
+ , $e = this.$element
+ , o = this.options
+
+ content = $e.attr('data-content')
+ || (typeof o.content == 'function' ? o.content.call($e[0]) : o.content)
+
+ return content
+ }
+
+ , tip: function () {
+ if (!this.$tip) {
+ this.$tip = $(this.options.template)
+ }
+ return this.$tip
+ }
+
+ })
+
+
+ /* POPOVER PLUGIN DEFINITION
+ * ======================= */
+
+ $.fn.popover = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('popover')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('popover', (data = new Popover(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.popover.Constructor = Popover
+
+ $.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, {
+ placement: 'right'
+ , content: ''
+ , template: '<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>'
+ })
+
+}(window.jQuery);/* =============================================================
+ * bootstrap-scrollspy.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#scrollspy
+ * =============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* SCROLLSPY CLASS DEFINITION
+ * ========================== */
+
+ function ScrollSpy( element, options) {
+ var process = $.proxy(this.process, this)
+ , $element = $(element).is('body') ? $(window) : $(element)
+ , href
+ this.options = $.extend({}, $.fn.scrollspy.defaults, options)
+ this.$scrollElement = $element.on('scroll.scroll.data-api', process)
+ this.selector = (this.options.target
+ || ((href = $(element).attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
+ || '') + ' .nav li > a'
+ this.$body = $('body')
+ this.refresh()
+ this.process()
+ }
+
+ ScrollSpy.prototype = {
+
+ constructor: ScrollSpy
+
+ , refresh: function () {
+ var self = this
+ , $targets
+
+ this.offsets = $([])
+ this.targets = $([])
+
+ $targets = this.$body
+ .find(this.selector)
+ .map(function () {
+ var $el = $(this)
+ , href = $el.data('target') || $el.attr('href')
+ , $href = /^#\w/.test(href) && $(href)
+ return ( $href
+ && href.length
+ && [[ $href.position().top, href ]] ) || null
+ })
+ .sort(function (a, b) { return a[0] - b[0] })
+ .each(function () {
+ self.offsets.push(this[0])
+ self.targets.push(this[1])
+ })
+ }
+
+ , process: function () {
+ var scrollTop = this.$scrollElement.scrollTop() + this.options.offset
+ , scrollHeight = this.$scrollElement[0].scrollHeight || this.$body[0].scrollHeight
+ , maxScroll = scrollHeight - this.$scrollElement.height()
+ , offsets = this.offsets
+ , targets = this.targets
+ , activeTarget = this.activeTarget
+ , i
+
+ if (scrollTop >= maxScroll) {
+ return activeTarget != (i = targets.last()[0])
+ && this.activate ( i )
+ }
+
+ for (i = offsets.length; i--;) {
+ activeTarget != targets[i]
+ && scrollTop >= offsets[i]
+ && (!offsets[i + 1] || scrollTop <= offsets[i + 1])
+ && this.activate( targets[i] )
+ }
+ }
+
+ , activate: function (target) {
+ var active
+ , selector
+
+ this.activeTarget = target
+
+ $(this.selector)
+ .parent('.active')
+ .removeClass('active')
+
+ selector = this.selector
+ + '[data-target="' + target + '"],'
+ + this.selector + '[href="' + target + '"]'
+
+ active = $(selector)
+ .parent('li')
+ .addClass('active')
+
+ if (active.parent('.dropdown-menu')) {
+ active = active.closest('li.dropdown').addClass('active')
+ }
+
+ active.trigger('activate')
+ }
+
+ }
+
+
+ /* SCROLLSPY PLUGIN DEFINITION
+ * =========================== */
+
+ $.fn.scrollspy = function ( option ) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('scrollspy')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('scrollspy', (data = new ScrollSpy(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.scrollspy.Constructor = ScrollSpy
+
+ $.fn.scrollspy.defaults = {
+ offset: 10
+ }
+
+
+ /* SCROLLSPY DATA-API
+ * ================== */
+
+ $(function () {
+ $('[data-spy="scroll"]').each(function () {
+ var $spy = $(this)
+ $spy.scrollspy($spy.data())
+ })
+ })
+
+}(window.jQuery);/* ========================================================
+ * bootstrap-tab.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#tabs
+ * ========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ======================================================== */
+
+
+!function ($) {
+
+ "use strict"; // jshint ;_;
+
+
+ /* TAB CLASS DEFINITION
+ * ==================== */
+
+ var Tab = function ( element ) {
+ this.element = $(element)
+ }
+
+ Tab.prototype = {
+
+ constructor: Tab
+
+ , show: function () {
+ var $this = this.element
+ , $ul = $this.closest('ul:not(.dropdown-menu)')
+ , selector = $this.attr('data-target')
+ , previous
+ , $target
+ , e
+
+ if (!selector) {
+ selector = $this.attr('href')
+ selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+ }
+
+ if ( $this.parent('li').hasClass('active') ) return
+
+ previous = $ul.find('.active a').last()[0]
+
+ e = $.Event('show', {
+ relatedTarget: previous
+ })
+
+ $this.trigger(e)
+
+ if (e.isDefaultPrevented()) return
+
+ $target = $(selector)
+
+ this.activate($this.parent('li'), $ul)
+ this.activate($target, $target.parent(), function () {
+ $this.trigger({
+ type: 'shown'
+ , relatedTarget: previous
+ })
+ })
+ }
+
+ , activate: function ( element, container, callback) {
+ var $active = container.find('> .active')
+ , transition = callback
+ && $.support.transition
+ && $active.hasClass('fade')
+
+ function next() {
+ $active
+ .removeClass('active')
+ .find('> .dropdown-menu > .active')
+ .removeClass('active')
+
+ element.addClass('active')
+
+ if (transition) {
+ element[0].offsetWidth // reflow for transition
+ element.addClass('in')
+ } else {
+ element.removeClass('fade')
+ }
+
+ if ( element.parent('.dropdown-menu') ) {
+ element.closest('li.dropdown').addClass('active')
+ }
+
+ callback && callback()
+ }
+
+ transition ?
+ $active.one($.support.transition.end, next) :
+ next()
+
+ $active.removeClass('in')
+ }
+ }
+
+
+ /* TAB PLUGIN DEFINITION
+ * ===================== */
+
+ $.fn.tab = function ( option ) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('tab')
+ if (!data) $this.data('tab', (data = new Tab(this)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.tab.Constructor = Tab
+
+
+ /* TAB DATA-API
+ * ============ */
+
+ $(function () {
+ $('body').on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) {
+ e.preventDefault()
+ $(this).tab('show')
+ })
+ })
+
+}(window.jQuery);/* =============================================================
+ * bootstrap-typeahead.js v2.0.4
+ * http://twitter.github.com/bootstrap/javascript.html#typeahead
+ * =============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function($){
+
+ "use strict"; // jshint ;_;
+
+
+ /* TYPEAHEAD PUBLIC CLASS DEFINITION
+ * ================================= */
+
+ var Typeahead = function (element, options) {
+ this.$element = $(element)
+ this.options = $.extend({}, $.fn.typeahead.defaults, options)
+ this.matcher = this.options.matcher || this.matcher
+ this.sorter = this.options.sorter || this.sorter
+ this.highlighter = this.options.highlighter || this.highlighter
+ this.updater = this.options.updater || this.updater
+ this.$menu = $(this.options.menu).appendTo('body')
+ this.source = this.options.source
+ this.shown = false
+ this.listen()
+ }
+
+ Typeahead.prototype = {
+
+ constructor: Typeahead
+
+ , select: function () {
+ var val = this.$menu.find('.active').attr('data-value')
+ this.$element
+ .val(this.updater(val))
+ .change()
+ return this.hide()
+ }
+
+ , updater: function (item) {
+ return item
+ }
+
+ , show: function () {
+ var pos = $.extend({}, this.$element.offset(), {
+ height: this.$element[0].offsetHeight
+ })
+
+ this.$menu.css({
+ top: pos.top + pos.height
+ , left: pos.left
+ })
+
+ this.$menu.show()
+ this.shown = true
+ return this
+ }
+
+ , hide: function () {
+ this.$menu.hide()
+ this.shown = false
+ return this
+ }
+
+ , lookup: function (event) {
+ var that = this
+ , items
+ , q
+
+ this.query = this.$element.val()
+
+ if (!this.query) {
+ return this.shown ? this.hide() : this
+ }
+
+ items = $.grep(this.source, function (item) {
+ return that.matcher(item)
+ })
+
+ items = this.sorter(items)
+
+ if (!items.length) {
+ return this.shown ? this.hide() : this
+ }
+
+ return this.render(items.slice(0, this.options.items)).show()
+ }
+
+ , matcher: function (item) {
+ return ~item.toLowerCase().indexOf(this.query.toLowerCase())
+ }
+
+ , sorter: function (items) {
+ var beginswith = []
+ , caseSensitive = []
+ , caseInsensitive = []
+ , item
+
+ while (item = items.shift()) {
+ if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item)
+ else if (~item.indexOf(this.query)) caseSensitive.push(item)
+ else caseInsensitive.push(item)
+ }
+
+ return beginswith.concat(caseSensitive, caseInsensitive)
+ }
+
+ , highlighter: function (item) {
+ var query = this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&')
+ return item.replace(new RegExp('(' + query + ')', 'ig'), function ($1, match) {
+ return '<strong>' + match + '</strong>'
+ })
+ }
+
+ , render: function (items) {
+ var that = this
+
+ items = $(items).map(function (i, item) {
+ i = $(that.options.item).attr('data-value', item)
+ i.find('a').html(that.highlighter(item))
+ return i[0]
+ })
+
+ items.first().addClass('active')
+ this.$menu.html(items)
+ return this
+ }
+
+ , next: function (event) {
+ var active = this.$menu.find('.active').removeClass('active')
+ , next = active.next()
+
+ if (!next.length) {
+ next = $(this.$menu.find('li')[0])
+ }
+
+ next.addClass('active')
+ }
+
+ , prev: function (event) {
+ var active = this.$menu.find('.active').removeClass('active')
+ , prev = active.prev()
+
+ if (!prev.length) {
+ prev = this.$menu.find('li').last()
+ }
+
+ prev.addClass('active')
+ }
+
+ , listen: function () {
+ this.$element
+ .on('blur', $.proxy(this.blur, this))
+ .on('keypress', $.proxy(this.keypress, this))
+ .on('keyup', $.proxy(this.keyup, this))
+
+ if ($.browser.webkit || $.browser.msie) {
+ this.$element.on('keydown', $.proxy(this.keypress, this))
+ }
+
+ this.$menu
+ .on('click', $.proxy(this.click, this))
+ .on('mouseenter', 'li', $.proxy(this.mouseenter, this))
+ }
+
+ , keyup: function (e) {
+ switch(e.keyCode) {
+ case 40: // down arrow
+ case 38: // up arrow
+ break
+
+ case 9: // tab
+ case 13: // enter
+ if (!this.shown) return
+ this.select()
+ break
+
+ case 27: // escape
+ if (!this.shown) return
+ this.hide()
+ break
+
+ default:
+ this.lookup()
+ }
+
+ e.stopPropagation()
+ e.preventDefault()
+ }
+
+ , keypress: function (e) {
+ if (!this.shown) return
+
+ switch(e.keyCode) {
+ case 9: // tab
+ case 13: // enter
+ case 27: // escape
+ e.preventDefault()
+ break
+
+ case 38: // up arrow
+ if (e.type != 'keydown') break
+ e.preventDefault()
+ this.prev()
+ break
+
+ case 40: // down arrow
+ if (e.type != 'keydown') break
+ e.preventDefault()
+ this.next()
+ break
+ }
+
+ e.stopPropagation()
+ }
+
+ , blur: function (e) {
+ var that = this
+ setTimeout(function () { that.hide() }, 150)
+ }
+
+ , click: function (e) {
+ e.stopPropagation()
+ e.preventDefault()
+ this.select()
+ }
+
+ , mouseenter: function (e) {
+ this.$menu.find('.active').removeClass('active')
+ $(e.currentTarget).addClass('active')
+ }
+
+ }
+
+
+ /* TYPEAHEAD PLUGIN DEFINITION
+ * =========================== */
+
+ $.fn.typeahead = function (option) {
+ return this.each(function () {
+ var $this = $(this)
+ , data = $this.data('typeahead')
+ , options = typeof option == 'object' && option
+ if (!data) $this.data('typeahead', (data = new Typeahead(this, options)))
+ if (typeof option == 'string') data[option]()
+ })
+ }
+
+ $.fn.typeahead.defaults = {
+ source: []
+ , items: 8
+ , menu: '<ul class="typeahead dropdown-menu"></ul>'
+ , item: '<li><a href="#"></a></li>'
+ }
+
+ $.fn.typeahead.Constructor = Typeahead
+
+
+ /* TYPEAHEAD DATA-API
+ * ================== */
+
+ $(function () {
+ $('body').on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) {
+ var $this = $(this)
+ if ($this.data('typeahead')) return
+ e.preventDefault()
+ $this.typeahead($this.data())
+ })
+ })
+
+}(window.jQuery); \ No newline at end of file
diff --git a/inst/web/js/bootstrap.min.js b/inst/web/js/bootstrap.min.js
new file mode 100644
index 0000000..1435698
--- /dev/null
+++ b/inst/web/js/bootstrap.min.js
@@ -0,0 +1,6 @@
+/*!
+* Bootstrap.js by @fat & @mdo
+* Copyright 2012 Twitter, Inc.
+* http://www.apache.org/licenses/LICENSE-2.0.txt
+*/
+!function(a){a(function(){"use strict",a.support.transition=function(){var a=function(){var a=document.createElement("bootstrap"),b={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd",msTransition:"MSTransitionEnd",transition:"transitionend"},c;for(c in b)if(a.style[c]!==undefined)return b[c]}();return a&&{end:a}}()})}(window.jQuery),!function(a){"use strict";var b='[data-dismiss="alert"]',c=function(c){a(c).on("click",b,this.close)};c.prototype.close=function(b){function f(){e.trigger("closed").remove()}var c=a(this),d=c.attr("data-target"),e;d||(d=c.attr("href"),d=d&&d.replace(/.*(?=#[^\s]*$)/,"")),e=a(d),b&&b.preventDefault(),e.length||(e=c.hasClass("alert")?c:c.parent()),e.trigger(b=a.Event("close"));if(b.isDefaultPrevented())return;e.removeClass("in"),a.support.transition&&e.hasClass("fade")?e.on(a.support.transition.end,f):f()},a.fn.alert=function(b){return this.each(function(){var d=a(this),e=d.data("alert");e||d.data("alert",e=new c(this)),typeof b=="string"&&e[b].call(d)})},a.fn.alert.Constructor=c,a(function(){a("body").on("click.alert.data-api",b,c.prototype.close)})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.button.defaults,c)};b.prototype.setState=function(a){var b="disabled",c=this.$element,d=c.data(),e=c.is("input")?"val":"html";a+="Text",d.resetText||c.data("resetText",c[e]()),c[e](d[a]||this.options[a]),setTimeout(function(){a=="loadingText"?c.addClass(b).attr(b,b):c.removeClass(b).removeAttr(b)},0)},b.prototype.toggle=function(){var a=this.$element.parent('[data-toggle="buttons-radio"]');a&&a.find(".active").removeClass("active"),this.$element.toggleClass("active")},a.fn.button=function(c){return this.each(function(){var d=a(this),e=d.data("button"),f=typeof c=="object"&&c;e||d.data("button",e=new b(this,f)),c=="toggle"?e.toggle():c&&e.setState(c)})},a.fn.button.defaults={loadingText:"loading..."},a.fn.button.Constructor=b,a(function(){a("body").on("click.button.data-api","[data-toggle^=button]",function(b){var c=a(b.target);c.hasClass("btn")||(c=c.closest(".btn")),c.button("toggle")})})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=c,this.options.slide&&this.slide(this.options.slide),this.options.pause=="hover"&&this.$element.on("mouseenter",a.proxy(this.pause,this)).on("mouseleave",a.proxy(this.cycle,this))};b.prototype={cycle:function(b){return b||(this.paused=!1),this.options.interval&&!this.paused&&(this.interval=setInterval(a.proxy(this.next,this),this.options.interval)),this},to:function(b){var c=this.$element.find(".active"),d=c.parent().children(),e=d.index(c),f=this;if(b>d.length-1||b<0)return;return this.sliding?this.$element.one("slid",function(){f.to(b)}):e==b?this.pause().cycle():this.slide(b>e?"next":"prev",a(d[b]))},pause:function(a){return a||(this.paused=!0),clearInterval(this.interval),this.interval=null,this},next:function(){if(this.sliding)return;return this.slide("next")},prev:function(){if(this.sliding)return;return this.slide("prev")},slide:function(b,c){var d=this.$element.find(".active"),e=c||d[b](),f=this.interval,g=b=="next"?"left":"right",h=b=="next"?"first":"last",i=this,j=a.Event("slide");this.sliding=!0,f&&this.pause(),e=e.length?e:this.$element.find(".item")[h]();if(e.hasClass("active"))return;if(a.support.transition&&this.$element.hasClass("slide")){this.$element.trigger(j);if(j.isDefaultPrevented())return;e.addClass(b),e[0].offsetWidth,d.addClass(g),e.addClass(g),this.$element.one(a.support.transition.end,function(){e.removeClass([b,g].join(" ")).addClass("active"),d.removeClass(["active",g].join(" ")),i.sliding=!1,setTimeout(function(){i.$element.trigger("slid")},0)})}else{this.$element.trigger(j);if(j.isDefaultPrevented())return;d.removeClass("active"),e.addClass("active"),this.sliding=!1,this.$element.trigger("slid")}return f&&this.cycle(),this}},a.fn.carousel=function(c){return this.each(function(){var d=a(this),e=d.data("carousel"),f=a.extend({},a.fn.carousel.defaults,typeof c=="object"&&c);e||d.data("carousel",e=new b(this,f)),typeof c=="number"?e.to(c):typeof c=="string"||(c=f.slide)?e[c]():f.interval&&e.cycle()})},a.fn.carousel.defaults={interval:5e3,pause:"hover"},a.fn.carousel.Constructor=b,a(function(){a("body").on("click.carousel.data-api","[data-slide]",function(b){var c=a(this),d,e=a(c.attr("data-target")||(d=c.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,"")),f=!e.data("modal")&&a.extend({},e.data(),c.data());e.carousel(f),b.preventDefault()})})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.collapse.defaults,c),this.options.parent&&(this.$parent=a(this.options.parent)),this.options.toggle&&this.toggle()};b.prototype={constructor:b,dimension:function(){var a=this.$element.hasClass("width");return a?"width":"height"},show:function(){var b,c,d,e;if(this.transitioning)return;b=this.dimension(),c=a.camelCase(["scroll",b].join("-")),d=this.$parent&&this.$parent.find("> .accordion-group > .in");if(d&&d.length){e=d.data("collapse");if(e&&e.transitioning)return;d.collapse("hide"),e||d.data("collapse",null)}this.$element[b](0),this.transition("addClass",a.Event("show"),"shown"),this.$element[b](this.$element[0][c])},hide:function(){var b;if(this.transitioning)return;b=this.dimension(),this.reset(this.$element[b]()),this.transition("removeClass",a.Event("hide"),"hidden"),this.$element[b](0)},reset:function(a){var b=this.dimension();return this.$element.removeClass("collapse")[b](a||"auto")[0].offsetWidth,this.$element[a!==null?"addClass":"removeClass"]("collapse"),this},transition:function(b,c,d){var e=this,f=function(){c.type=="show"&&e.reset(),e.transitioning=0,e.$element.trigger(d)};this.$element.trigger(c);if(c.isDefaultPrevented())return;this.transitioning=1,this.$element[b]("in"),a.support.transition&&this.$element.hasClass("collapse")?this.$element.one(a.support.transition.end,f):f()},toggle:function(){this[this.$element.hasClass("in")?"hide":"show"]()}},a.fn.collapse=function(c){return this.each(function(){var d=a(this),e=d.data("collapse"),f=typeof c=="object"&&c;e||d.data("collapse",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.collapse.defaults={toggle:!0},a.fn.collapse.Constructor=b,a(function(){a("body").on("click.collapse.data-api","[data-toggle=collapse]",function(b){var c=a(this),d,e=c.attr("data-target")||b.preventDefault()||(d=c.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,""),f=a(e).data("collapse")?"toggle":c.data();a(e).collapse(f)})})}(window.jQuery),!function(a){function d(){a(b).parent().removeClass("open")}"use strict";var b='[data-toggle="dropdown"]',c=function(b){var c=a(b).on("click.dropdown.data-api",this.toggle);a("html").on("click.dropdown.data-api",function(){c.parent().removeClass("open")})};c.prototype={constructor:c,toggle:function(b){var c=a(this),e,f,g;if(c.is(".disabled, :disabled"))return;return f=c.attr("data-target"),f||(f=c.attr("href"),f=f&&f.replace(/.*(?=#[^\s]*$)/,"")),e=a(f),e.length||(e=c.parent()),g=e.hasClass("open"),d(),g||e.toggleClass("open"),!1}},a.fn.dropdown=function(b){return this.each(function(){var d=a(this),e=d.data("dropdown");e||d.data("dropdown",e=new c(this)),typeof b=="string"&&e[b].call(d)})},a.fn.dropdown.Constructor=c,a(function(){a("html").on("click.dropdown.data-api",d),a("body").on("click.dropdown",".dropdown form",function(a){a.stopPropagation()}).on("click.dropdown.data-api",b,c.prototype.toggle)})}(window.jQuery),!function(a){function c(){var b=this,c=setTimeout(function(){b.$element.off(a.support.transition.end),d.call(b)},500);this.$element.one(a.support.transition.end,function(){clearTimeout(c),d.call(b)})}function d(a){this.$element.hide().trigger("hidden"),e.call(this)}function e(b){var c=this,d=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var e=a.support.transition&&d;this.$backdrop=a('<div class="modal-backdrop '+d+'" />').appendTo(document.body),this.options.backdrop!="static"&&this.$backdrop.click(a.proxy(this.hide,this)),e&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),e?this.$backdrop.one(a.support.transition.end,b):b()}else!this.isShown&&this.$backdrop?(this.$backdrop.removeClass("in"),a.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one(a.support.transition.end,a.proxy(f,this)):f.call(this)):b&&b()}function f(){this.$backdrop.remove(),this.$backdrop=null}function g(){var b=this;this.isShown&&this.options.keyboard?a(document).on("keyup.dismiss.modal",function(a){a.which==27&&b.hide()}):this.isShown||a(document).off("keyup.dismiss.modal")}"use strict";var b=function(b,c){this.options=c,this.$element=a(b).delegate('[data-dismiss="modal"]',"click.dismiss.modal",a.proxy(this.hide,this))};b.prototype={constructor:b,toggle:function(){return this[this.isShown?"hide":"show"]()},show:function(){var b=this,c=a.Event("show");this.$element.trigger(c);if(this.isShown||c.isDefaultPrevented())return;a("body").addClass("modal-open"),this.isShown=!0,g.call(this),e.call(this,function(){var c=a.support.transition&&b.$element.hasClass("fade");b.$element.parent().length||b.$element.appendTo(document.body),b.$element.show(),c&&b.$element[0].offsetWidth,b.$element.addClass("in"),c?b.$element.one(a.support.transition.end,function(){b.$element.trigger("shown")}):b.$element.trigger("shown")})},hide:function(b){b&&b.preventDefault();var e=this;b=a.Event("hide"),this.$element.trigger(b);if(!this.isShown||b.isDefaultPrevented())return;this.isShown=!1,a("body").removeClass("modal-open"),g.call(this),this.$element.removeClass("in"),a.support.transition&&this.$element.hasClass("fade")?c.call(this):d.call(this)}},a.fn.modal=function(c){return this.each(function(){var d=a(this),e=d.data("modal"),f=a.extend({},a.fn.modal.defaults,d.data(),typeof c=="object"&&c);e||d.data("modal",e=new b(this,f)),typeof c=="string"?e[c]():f.show&&e.show()})},a.fn.modal.defaults={backdrop:!0,keyboard:!0,show:!0},a.fn.modal.Constructor=b,a(function(){a("body").on("click.modal.data-api",'[data-toggle="modal"]',function(b){var c=a(this),d,e=a(c.attr("data-target")||(d=c.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,"")),f=e.data("modal")?"toggle":a.extend({},e.data(),c.data());b.preventDefault(),e.modal(f)})})}(window.jQuery),!function(a){"use strict";var b=function(a,b){this.init("tooltip",a,b)};b.prototype={constructor:b,init:function(b,c,d){var e,f;this.type=b,this.$element=a(c),this.options=this.getOptions(d),this.enabled=!0,this.options.trigger!="manual"&&(e=this.options.trigger=="hover"?"mouseenter":"focus",f=this.options.trigger=="hover"?"mouseleave":"blur",this.$element.on(e,this.options.selector,a.proxy(this.enter,this)),this.$element.on(f,this.options.selector,a.proxy(this.leave,this))),this.options.selector?this._options=a.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},getOptions:function(b){return b=a.extend({},a.fn[this.type].defaults,b,this.$element.data()),b.delay&&typeof b.delay=="number"&&(b.delay={show:b.delay,hide:b.delay}),b},enter:function(b){var c=a(b.currentTarget)[this.type](this._options).data(this.type);if(!c.options.delay||!c.options.delay.show)return c.show();clearTimeout(this.timeout),c.hoverState="in",this.timeout=setTimeout(function(){c.hoverState=="in"&&c.show()},c.options.delay.show)},leave:function(b){var c=a(b.currentTarget)[this.type](this._options).data(this.type);this.timeout&&clearTimeout(this.timeout);if(!c.options.delay||!c.options.delay.hide)return c.hide();c.hoverState="out",this.timeout=setTimeout(function(){c.hoverState=="out"&&c.hide()},c.options.delay.hide)},show:function(){var a,b,c,d,e,f,g;if(this.hasContent()&&this.enabled){a=this.tip(),this.setContent(),this.options.animation&&a.addClass("fade"),f=typeof this.options.placement=="function"?this.options.placement.call(this,a[0],this.$element[0]):this.options.placement,b=/in/.test(f),a.remove().css({top:0,left:0,display:"block"}).appendTo(b?this.$element:document.body),c=this.getPosition(b),d=a[0].offsetWidth,e=a[0].offsetHeight;switch(b?f.split(" ")[1]:f){case"bottom":g={top:c.top+c.height,left:c.left+c.width/2-d/2};break;case"top":g={top:c.top-e,left:c.left+c.width/2-d/2};break;case"left":g={top:c.top+c.height/2-e/2,left:c.left-d};break;case"right":g={top:c.top+c.height/2-e/2,left:c.left+c.width}}a.css(g).addClass(f).addClass("in")}},isHTML:function(a){return typeof a!="string"||a.charAt(0)==="<"&&a.charAt(a.length-1)===">"&&a.length>=3||/^(?:[^<]*<[\w\W]+>[^>]*$)/.exec(a)},setContent:function(){var a=this.tip(),b=this.getTitle();a.find(".tooltip-inner")[this.isHTML(b)?"html":"text"](b),a.removeClass("fade in top bottom left right")},hide:function(){function d(){var b=setTimeout(function(){c.off(a.support.transition.end).remove()},500);c.one(a.support.transition.end,function(){clearTimeout(b),c.remove()})}var b=this,c=this.tip();c.removeClass("in"),a.support.transition&&this.$tip.hasClass("fade")?d():c.remove()},fixTitle:function(){var a=this.$element;(a.attr("title")||typeof a.attr("data-original-title")!="string")&&a.attr("data-original-title",a.attr("title")||"").removeAttr("title")},hasContent:function(){return this.getTitle()},getPosition:function(b){return a.extend({},b?{top:0,left:0}:this.$element.offset(),{width:this.$element[0].offsetWidth,height:this.$element[0].offsetHeight})},getTitle:function(){var a,b=this.$element,c=this.options;return a=b.attr("data-original-title")||(typeof c.title=="function"?c.title.call(b[0]):c.title),a},tip:function(){return this.$tip=this.$tip||a(this.options.template)},validate:function(){this.$element[0].parentNode||(this.hide(),this.$element=null,this.options=null)},enable:function(){this.enabled=!0},disable:function(){this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled},toggle:function(){this[this.tip().hasClass("in")?"hide":"show"]()}},a.fn.tooltip=function(c){return this.each(function(){var d=a(this),e=d.data("tooltip"),f=typeof c=="object"&&c;e||d.data("tooltip",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.tooltip.Constructor=b,a.fn.tooltip.defaults={animation:!0,placement:"top",selector:!1,template:'<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover",title:"",delay:0}}(window.jQuery),!function(a){"use strict";var b=function(a,b){this.init("popover",a,b)};b.prototype=a.extend({},a.fn.tooltip.Constructor.prototype,{constructor:b,setContent:function(){var a=this.tip(),b=this.getTitle(),c=this.getContent();a.find(".popover-title")[this.isHTML(b)?"html":"text"](b),a.find(".popover-content > *")[this.isHTML(c)?"html":"text"](c),a.removeClass("fade top bottom left right in")},hasContent:function(){return this.getTitle()||this.getContent()},getContent:function(){var a,b=this.$element,c=this.options;return a=b.attr("data-content")||(typeof c.content=="function"?c.content.call(b[0]):c.content),a},tip:function(){return this.$tip||(this.$tip=a(this.options.template)),this.$tip}}),a.fn.popover=function(c){return this.each(function(){var d=a(this),e=d.data("popover"),f=typeof c=="object"&&c;e||d.data("popover",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.popover.Constructor=b,a.fn.popover.defaults=a.extend({},a.fn.tooltip.defaults,{placement:"right",content:"",template:'<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>'})}(window.jQuery),!function(a){function b(b,c){var d=a.proxy(this.process,this),e=a(b).is("body")?a(window):a(b),f;this.options=a.extend({},a.fn.scrollspy.defaults,c),this.$scrollElement=e.on("scroll.scroll.data-api",d),this.selector=(this.options.target||(f=a(b).attr("href"))&&f.replace(/.*(?=#[^\s]+$)/,"")||"")+" .nav li > a",this.$body=a("body"),this.refresh(),this.process()}"use strict",b.prototype={constructor:b,refresh:function(){var b=this,c;this.offsets=a([]),this.targets=a([]),c=this.$body.find(this.selector).map(function(){var b=a(this),c=b.data("target")||b.attr("href"),d=/^#\w/.test(c)&&a(c);return d&&c.length&&[[d.position().top,c]]||null}).sort(function(a,b){return a[0]-b[0]}).each(function(){b.offsets.push(this[0]),b.targets.push(this[1])})},process:function(){var a=this.$scrollElement.scrollTop()+this.options.offset,b=this.$scrollElement[0].scrollHeight||this.$body[0].scrollHeight,c=b-this.$scrollElement.height(),d=this.offsets,e=this.targets,f=this.activeTarget,g;if(a>=c)return f!=(g=e.last()[0])&&this.activate(g);for(g=d.length;g--;)f!=e[g]&&a>=d[g]&&(!d[g+1]||a<=d[g+1])&&this.activate(e[g])},activate:function(b){var c,d;this.activeTarget=b,a(this.selector).parent(".active").removeClass("active"),d=this.selector+'[data-target="'+b+'"],'+this.selector+'[href="'+b+'"]',c=a(d).parent("li").addClass("active"),c.parent(".dropdown-menu")&&(c=c.closest("li.dropdown").addClass("active")),c.trigger("activate")}},a.fn.scrollspy=function(c){return this.each(function(){var d=a(this),e=d.data("scrollspy"),f=typeof c=="object"&&c;e||d.data("scrollspy",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.scrollspy.Constructor=b,a.fn.scrollspy.defaults={offset:10},a(function(){a('[data-spy="scroll"]').each(function(){var b=a(this);b.scrollspy(b.data())})})}(window.jQuery),!function(a){"use strict";var b=function(b){this.element=a(b)};b.prototype={constructor:b,show:function(){var b=this.element,c=b.closest("ul:not(.dropdown-menu)"),d=b.attr("data-target"),e,f,g;d||(d=b.attr("href"),d=d&&d.replace(/.*(?=#[^\s]*$)/,""));if(b.parent("li").hasClass("active"))return;e=c.find(".active a").last()[0],g=a.Event("show",{relatedTarget:e}),b.trigger(g);if(g.isDefaultPrevented())return;f=a(d),this.activate(b.parent("li"),c),this.activate(f,f.parent(),function(){b.trigger({type:"shown",relatedTarget:e})})},activate:function(b,c,d){function g(){e.removeClass("active").find("> .dropdown-menu > .active").removeClass("active"),b.addClass("active"),f?(b[0].offsetWidth,b.addClass("in")):b.removeClass("fade"),b.parent(".dropdown-menu")&&b.closest("li.dropdown").addClass("active"),d&&d()}var e=c.find("> .active"),f=d&&a.support.transition&&e.hasClass("fade");f?e.one(a.support.transition.end,g):g(),e.removeClass("in")}},a.fn.tab=function(c){return this.each(function(){var d=a(this),e=d.data("tab");e||d.data("tab",e=new b(this)),typeof c=="string"&&e[c]()})},a.fn.tab.Constructor=b,a(function(){a("body").on("click.tab.data-api",'[data-toggle="tab"], [data-toggle="pill"]',function(b){b.preventDefault(),a(this).tab("show")})})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.typeahead.defaults,c),this.matcher=this.options.matcher||this.matcher,this.sorter=this.options.sorter||this.sorter,this.highlighter=this.options.highlighter||this.highlighter,this.updater=this.options.updater||this.updater,this.$menu=a(this.options.menu).appendTo("body"),this.source=this.options.source,this.shown=!1,this.listen()};b.prototype={constructor:b,select:function(){var a=this.$menu.find(".active").attr("data-value");return this.$element.val(this.updater(a)).change(),this.hide()},updater:function(a){return a},show:function(){var b=a.extend({},this.$element.offset(),{height:this.$element[0].offsetHeight});return this.$menu.css({top:b.top+b.height,left:b.left}),this.$menu.show(),this.shown=!0,this},hide:function(){return this.$menu.hide(),this.shown=!1,this},lookup:function(b){var c=this,d,e;return this.query=this.$element.val(),this.query?(d=a.grep(this.source,function(a){return c.matcher(a)}),d=this.sorter(d),d.length?this.render(d.slice(0,this.options.items)).show():this.shown?this.hide():this):this.shown?this.hide():this},matcher:function(a){return~a.toLowerCase().indexOf(this.query.toLowerCase())},sorter:function(a){var b=[],c=[],d=[],e;while(e=a.shift())e.toLowerCase().indexOf(this.query.toLowerCase())?~e.indexOf(this.query)?c.push(e):d.push(e):b.push(e);return b.concat(c,d)},highlighter:function(a){var b=this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&");return a.replace(new RegExp("("+b+")","ig"),function(a,b){return"<strong>"+b+"</strong>"})},render:function(b){var c=this;return b=a(b).map(function(b,d){return b=a(c.options.item).attr("data-value",d),b.find("a").html(c.highlighter(d)),b[0]}),b.first().addClass("active"),this.$menu.html(b),this},next:function(b){var c=this.$menu.find(".active").removeClass("active"),d=c.next();d.length||(d=a(this.$menu.find("li")[0])),d.addClass("active")},prev:function(a){var b=this.$menu.find(".active").removeClass("active"),c=b.prev();c.length||(c=this.$menu.find("li").last()),c.addClass("active")},listen:function(){this.$element.on("blur",a.proxy(this.blur,this)).on("keypress",a.proxy(this.keypress,this)).on("keyup",a.proxy(this.keyup,this)),(a.browser.webkit||a.browser.msie)&&this.$element.on("keydown",a.proxy(this.keypress,this)),this.$menu.on("click",a.proxy(this.click,this)).on("mouseenter","li",a.proxy(this.mouseenter,this))},keyup:function(a){switch(a.keyCode){case 40:case 38:break;case 9:case 13:if(!this.shown)return;this.select();break;case 27:if(!this.shown)return;this.hide();break;default:this.lookup()}a.stopPropagation(),a.preventDefault()},keypress:function(a){if(!this.shown)return;switch(a.keyCode){case 9:case 13:case 27:a.preventDefault();break;case 38:if(a.type!="keydown")break;a.preventDefault(),this.prev();break;case 40:if(a.type!="keydown")break;a.preventDefault(),this.next()}a.stopPropagation()},blur:function(a){var b=this;setTimeout(function(){b.hide()},150)},click:function(a){a.stopPropagation(),a.preventDefault(),this.select()},mouseenter:function(b){this.$menu.find(".active").removeClass("active"),a(b.currentTarget).addClass("active")}},a.fn.typeahead=function(c){return this.each(function(){var d=a(this),e=d.data("typeahead"),f=typeof c=="object"&&c;e||d.data("typeahead",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.typeahead.defaults={source:[],items:8,menu:'<ul class="typeahead dropdown-menu"></ul>',item:'<li><a href="#"></a></li>'},a.fn.typeahead.Constructor=b,a(function(){a("body").on("focus.typeahead.data-api",'[data-provide="typeahead"]',function(b){var c=a(this);if(c.data("typeahead"))return;b.preventDefault(),c.typeahead(c.data())})})}(window.jQuery); \ No newline at end of file
diff --git a/inst/web/pai.html b/inst/web/pai.html
new file mode 100644
index 0000000..bd19dc7
--- /dev/null
+++ b/inst/web/pai.html
@@ -0,0 +1,123 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>pai. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>An R6 class for pesticidal active ingredients and associated data</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>pai</div></pre>
+
+ <div class="Format">
+ <h2>Format</h2>
+
+ <p>An <code><a href='http://www.inside-r.org/packages/cran/R6/docs/R6Class'>R6Class</a></code> generator object</p>
+
+ </div>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>The class is initialised with an identifier which is generally an ISO common name.
+Additional chemical information is retrieved from the internet.</p>
+
+ </div>
+
+ <div class="Fields">
+ <h2>Fields</h2>
+
+ <p></p>
+
+ <p><dl>
+<dt><code>iso</code></dt><dd>ISO common name according to ISO 1750 as retreived from www.alanwood.net/pesticides</dd></p>
+
+ <p><dt><code>alanwood</code></dt><dd>List of information retreived from www.alanwood.net/pesticides</dd></p>
+
+ <p></dl></p>
+
+ </div>
+
+ <h2 id="examples">Examples</h2>
+ <pre class="examples"><div class='input'>atr &lt;- pai$new(&quot;atrazine&quot;)
+</div>
+<strong class='message'>Querying atrazine.html</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&amp;db=pccompound&amp;term=atrazine</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&amp;db=pccompound&amp;ID=2256</strong>
+<div class='input'>print(atr)
+</div>
+<div class='output'>&lt;pai&gt; with ISO common name $iso atrazine
+&lt;chent&gt;
+Identifier $identifier atrazine
+InChI Key $inchikey MXWJVTOOROXGIU-UHFFFAOYSA-N
+SMILES string $smiles CCNC1=NC(=NC(=N1)Cl)NC(C)C
+Molecular weight $mw: 215.7
+PubChem synonyms (first 10):
+ [1] &quot;atrazine&quot; &quot;1912-24-9&quot; &quot;Atazinax&quot; &quot;Atrasine&quot; &quot;Chromozin&quot; &quot;Fenatrol&quot; &quot;Gesaprim&quot; &quot;Gesoprim&quot;
+ [9] &quot;Hungazin&quot; &quot;Oleogesaprim&quot;
+</div></pre>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>pai</li>
+ </ul>
+ <ul>
+ <li>data</li>
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/plot.chent-8.png b/inst/web/plot.chent-8.png
new file mode 100644
index 0000000..dfc7eb3
--- /dev/null
+++ b/inst/web/plot.chent-8.png
Binary files differ
diff --git a/inst/web/plot.chent.html b/inst/web/plot.chent.html
new file mode 100644
index 0000000..beba724
--- /dev/null
+++ b/inst/web/plot.chent.html
@@ -0,0 +1,112 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>plot.chent. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>Plot method for chent objects</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>"plot"(x, ...)</div></pre>
+
+ <h2>Arguments</h2>
+ <dl>
+ <dt>x</dt>
+ <dd>The chent object to be plotted</dd>
+ <dt>...</dt>
+ <dd>Further arguments passed to <code><a href='http://www.inside-r.org/packages/cran/grImport/docs/grid.picture'>grid.picture</a></code></dd>
+ </dl>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>Plot method for chent objects</p>
+
+ </div>
+
+ <h2 id="examples">Examples</h2>
+ <pre class="examples"><div class='input'>caffeine &lt;- chent$new(&quot;caffeine&quot;, source = &quot;pubchem&quot;)
+</div>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&amp;db=pccompound&amp;term=caffeine</strong>
+<strong class='message'>Found 217 entries in PubChem, using the first one.</strong>
+<strong class='message'>http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&amp;db=pccompound&amp;ID=1188</strong>
+<div class='input'>print(caffeine)
+</div>
+<div class='output'>&lt;chent&gt;
+Identifier $identifier caffeine
+InChI Key $inchikey LRFVTYWOQMYALW-UHFFFAOYSA-N
+SMILES string $smiles C1=NC2=C(N1)C(=O)NC(=O)N2
+Molecular weight $mw: 152.1
+PubChem synonyms (first 10):
+ [1] &quot;xanthine&quot; &quot;2,6-Dihydroxypurine&quot; &quot;69-89-6&quot; &quot;Xanthin&quot; &quot;2,6-dioxopurine&quot;
+ [6] &quot;Pseudoxanthine&quot; &quot;Isoxanthine&quot; &quot;Xanthic oxide&quot; &quot;1H-Purine-2,6-diol&quot; &quot;Purine-2,6-diol&quot;
+</div>
+<div class='input'>caffeine$get_rdkit()
+plot(caffeine)
+</div>
+<p><img src='plot.chent-8.png' alt='' width='540' height='400' /></p></pre>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>plot.chent</li>
+ </ul>
+ <ul>
+
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/pp.html b/inst/web/pp.html
new file mode 100644
index 0000000..8c8f36f
--- /dev/null
+++ b/inst/web/pp.html
@@ -0,0 +1,107 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>pp. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>R6 class for holding a product with at least one active ingredient</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>pp</div></pre>
+
+ <div class="Format">
+ <h2>Format</h2>
+
+ <p>An <code><a href='http://www.inside-r.org/packages/cran/R6/docs/R6Class'>R6Class</a></code> generator object.</p>
+
+ </div>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>An R6 class for holding information about a product with at least one active ingredient</p>
+
+ </div>
+
+ <div class="Fields">
+ <h2>Fields</h2>
+
+ <p></p>
+
+ <p><dl>
+<dt><code>name</code></dt><dd>The name of the product</dd></p>
+
+ <p><dt><code>ais</code></dt><dd>A list of active ingredients</dd></p>
+
+ <p><dt><code>concentrations</code></dt><dd>The concentration of the ais</dd></p>
+
+ <p><dt><code>concentration_units</code></dt><dd>Defaults to g/L</dd></p>
+
+ <p></dl></p>
+
+ </div>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>pp</li>
+ </ul>
+ <ul>
+ <li>data</li>
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/print.chent.html b/inst/web/print.chent.html
new file mode 100644
index 0000000..ef913f1
--- /dev/null
+++ b/inst/web/print.chent.html
@@ -0,0 +1,90 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>print.chent. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>Printing method for chent objects</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>"print"(x, ...)</div></pre>
+
+ <h2>Arguments</h2>
+ <dl>
+ <dt>x</dt>
+ <dd>The chent object to be printed</dd>
+ <dt>...</dt>
+ <dd>Further arguments for compatibility with the S3 method</dd>
+ </dl>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>Printing method for chent objects</p>
+
+ </div>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>print.chent</li>
+ </ul>
+ <ul>
+
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/inst/web/print.pai.html b/inst/web/print.pai.html
new file mode 100644
index 0000000..a575269
--- /dev/null
+++ b/inst/web/print.pai.html
@@ -0,0 +1,90 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+ <meta charset="utf-8">
+<title>print.pai. chents 0.2-1</title>
+<meta name="viewport" content="width=device-width, initial-scale=1.0">
+<meta name="author" content="">
+
+<link href="css/bootstrap.css" rel="stylesheet">
+<link href="css/bootstrap-responsive.css" rel="stylesheet">
+<link href="css/highlight.css" rel="stylesheet">
+<link href="css/staticdocs.css" rel="stylesheet">
+
+<!--[if lt IE 9]>
+ <script src="http://html5shim.googlecode.com/svn/trunk/html5.js"></script>
+<![endif]-->
+
+<script type="text/x-mathjax-config">
+ MathJax.Hub.Config({
+ tex2jax: {
+ inlineMath: [ ['$','$'], ["\\(","\\)"] ],
+ processEscapes: true
+ }
+ });
+</script>
+<script type="text/javascript"
+ src="http://cdn.mathjax.org/mathjax/latest/MathJax.js?config=TeX-AMS-MML_HTMLorMML">
+</script>
+ </head>
+
+ <body>
+ <div class="navbar">
+ <div class="navbar-inner">
+ <div class="container">
+ <a class="brand" href="#">chents 0.2-1</a>
+ <div class="nav">
+ <ul class="nav">
+ <li><a href="index.html"><i class="icon-home icon-white"></i> Index</a></li>
+ </ul>
+ </div>
+ </div>
+ </div>
+</div>
+
+ <div class="container">
+ <header>
+
+ </header>
+
+ <h1>Printing method for pai objects (pesticidal active ingredients)</h1>
+
+<div class="row">
+ <div class="span8">
+ <h2>Usage</h2>
+ <pre><div>"print"(x, ...)</div></pre>
+
+ <h2>Arguments</h2>
+ <dl>
+ <dt>x</dt>
+ <dd>The chent object to be printed</dd>
+ <dt>...</dt>
+ <dd>Further arguments for compatibility with the S3 method</dd>
+ </dl>
+
+ <div class="Description">
+ <h2>Description</h2>
+
+ <p>Printing method for pai objects (pesticidal active ingredients)</p>
+
+ </div>
+ </div>
+ <div class="span4">
+ <!-- <ul>
+ <li>print.pai</li>
+ </ul>
+ <ul>
+
+ </ul> -->
+
+
+ </div>
+</div>
+
+ <footer>
+ <p class="pull-right"><a href="#">Back to top</a></p>
+<p>Built by <a href="https://github.com/hadley/staticdocs">staticdocs</a>. Styled with <a href="http://twitter.github.com/bootstrap">bootstrap</a>.</p>
+ </footer>
+ </div>
+ </body>
+</html> \ No newline at end of file
diff --git a/man/chent.Rd b/man/chent.Rd
index c42863d..da68b56 100644
--- a/man/chent.Rd
+++ b/man/chent.Rd
@@ -9,8 +9,9 @@
chent
}
\description{
-The class is initialised with an identifier. Chemical information is retrieved
-from the internet.
+The class is initialised with an identifier. Chemical information is retrieved from
+the internet. Additionally, it can be generated using RDKit if RDKit and its
+python bindings are installed.
}
\section{Fields}{
@@ -26,11 +27,18 @@ from the internet.
\item{\code{pubchem}}{List of information retreived from PubChem}
\item{\code{rdkit}}{List of information obtained with RDKit}
+
+\item{\code{Picture}}{Graph as a \code{\link{picture}} object obtained using grImport}
}}
\examples{
oct <- chent$new("1-octanol", smiles = "CCCCCCCCO")
oct$try_pubchem()
print(oct)
+plot(oct)
+caffeine <- chent$new("caffeine", source = "pubchem")
+print(caffeine)
+caffeine$get_rdkit()
+plot(caffeine)
}
\keyword{data}
diff --git a/man/draw_svg.chent.Rd b/man/draw_svg.chent.Rd
new file mode 100644
index 0000000..87234a1
--- /dev/null
+++ b/man/draw_svg.chent.Rd
@@ -0,0 +1,24 @@
+% Generated by roxygen2 (4.1.1): do not edit by hand
+% Please edit documentation in R/chent.R
+\name{draw_svg.chent}
+\alias{draw_svg.chent}
+\title{Draw SVG graph from a chent object using RDKit}
+\usage{
+draw_svg.chent(x, width = 300, height = 150,
+ filename = paste0(names(x$identifier), ".svg"), subdir = "svg")
+}
+\arguments{
+\item{x}{The chent object to be plotted}
+
+\item{width}{The desired width in pixels}
+
+\item{height}{The desired height in pixels}
+
+\item{filename}{The filename}
+
+\item{subdir}{The path to which the file should be written}
+}
+\description{
+Draw SVG graph from a chent object using RDKit
+}
+
diff --git a/man/plot.chent.Rd b/man/plot.chent.Rd
new file mode 100644
index 0000000..f2e7572
--- /dev/null
+++ b/man/plot.chent.Rd
@@ -0,0 +1,23 @@
+% Generated by roxygen2 (4.1.1): do not edit by hand
+% Please edit documentation in R/chent.R
+\name{plot.chent}
+\alias{plot.chent}
+\title{Plot method for chent objects}
+\usage{
+\method{plot}{chent}(x, ...)
+}
+\arguments{
+\item{x}{The chent object to be plotted}
+
+\item{...}{Further arguments passed to \code{\link{grid.picture}}}
+}
+\description{
+Plot method for chent objects
+}
+\examples{
+caffeine <- chent$new("caffeine", source = "pubchem")
+print(caffeine)
+caffeine$get_rdkit()
+plot(caffeine)
+}
+
diff --git a/roxygen.log b/roxygen.log
deleted file mode 100644
index 0205542..0000000
--- a/roxygen.log
+++ /dev/null
@@ -1,3 +0,0 @@
-Updating chents documentation
-Loading chents
-Writing print.pai.Rd
diff --git a/test.log b/test.log
new file mode 100644
index 0000000..049ffe1
--- /dev/null
+++ b/test.log
@@ -0,0 +1,15 @@
+Loading chents
+Loading required package: testthat
+Loading required package: methods
+
+Initialize Python Version 2.7.9 (default, Mar 1 2015, 13:01:26)
+[GCC 4.9.2]
+
+Testing chents
+Generation of chent objects : ......
+Generation of pai objects : Querying glyphosate.html
+http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esearch.fcgi?retmax=100000&db=pccompound&term=glyphosate
+http://eutils.ncbi.nlm.nih.gov/entrez/eutils/esummary.fcgi?retmax=100000&db=pccompound&ID=3496
+........
+
+DONE
diff --git a/tests/testthat.R b/tests/testthat.R
new file mode 100644
index 0000000..a7a46eb
--- /dev/null
+++ b/tests/testthat.R
@@ -0,0 +1,4 @@
+library(testthat)
+library(chents)
+
+test_check("chents")
diff --git a/tests/testthat/test_chent.R b/tests/testthat/test_chent.R
new file mode 100644
index 0000000..da018c5
--- /dev/null
+++ b/tests/testthat/test_chent.R
@@ -0,0 +1,21 @@
+context("Generation of chent objects")
+
+oct <- chent$new("1-octanol", smiles = "CCCCCCCCO")
+
+test_that("We can generate a chent object from SMILES using RDKit", {
+ expect_equivalent(round(oct$mw, 2), 130.23)
+ expect_equal(names(oct$identifier), "X1.octanol")
+ expect_equal(oct$smiles, "CCCCCCCCO")
+})
+
+test_that("We can add information retrieved from PubChem via webchem", {
+ oct$try_pubchem()
+ expect_equivalent(round(oct$mw, 2), 130.23)
+ ik = "KBPLFHHGFOOTCA-UHFFFAOYSA-N"
+ attr(ik, "source") <- "pubchem"
+ expect_equal(oct$inchikey, ik)
+ smiles <- "CCCCCCCCO"
+ attr(smiles, "source") <- "pubchem"
+ attr(smiles, "type") <- "canonical"
+ expect_equal(oct$smiles, smiles)
+})
diff --git a/tests/testthat/test_pai.R b/tests/testthat/test_pai.R
new file mode 100644
index 0000000..dd0b235
--- /dev/null
+++ b/tests/testthat/test_pai.R
@@ -0,0 +1,25 @@
+context("Generation of pai objects")
+
+glyphosate <- pai$new("glyphosate")
+
+test_that("We can generate a pai object from its ISO common name", {
+ expect_equivalent(glyphosate$alanwood$cas, "1071-83-6")
+ expect_equivalent(glyphosate$alanwood$formula, "C3H8NO5P")
+ expect_equivalent(glyphosate$alanwood$iupac_name, "N-(phosphonomethyl)glycine")
+ expect_equal(names(glyphosate$identifier), "glyphosate")
+ ik = "XDDAORKBJWWYJS-UHFFFAOYSA-N"
+ attr(ik, "source") <- "alanwood"
+ expect_equal(glyphosate$inchikey, ik)
+})
+
+test_that("RDKit information was added", {
+ expect_equivalent(glyphosate$rdkit$mw, 169.073)
+})
+
+test_that("PubChem information was added via webchem", {
+ expect_equivalent(round(glyphosate$mw, 2), 169.07)
+ smiles <- "C(C(=O)O)NCP(=O)(O)O"
+ attr(smiles, "source") <- "pubchem"
+ attr(smiles, "type") <- "canonical"
+ expect_equal(glyphosate$smiles, smiles)
+})

Contact - Imprint